Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (7) Show 7 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2005-11-16 15:48:42 UTC

Update Date

2021-09-14 15:00:08 UTC

HMDB ID

HMDB0001513

Secondary Accession Numbers

HMDB01513

Metabolite Identification

Common Name

Dolichyl diphosphate

Description

The term dolichol refers to a group of long-chain mostly unsaturated organic compounds consisting of a variable number of isoprene units that terminate with an alpha-saturated isoprenoid group containing an alcohol functional group. In the form of dolichol phosphate, dolichols help facilitate protein N-glycosylation (Wikipedia). Glycosylation of asparagine residues in proteins is carried out by transferring glucose from a dolichyl diphosphate oligosaccharide (PMID: 7379786 ).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652303062020142D          

 34 33  0  0  0  0            999 V2000
   11.8416   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2228   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4804   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4804   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7792   -5.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7792   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1605   -5.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4180   -5.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4180   -4.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7168   -6.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7168   -5.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9744   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -7.1136    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.2420   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -6.2474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -7.9797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9260   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1836   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4411   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1836   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6986   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9975   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2550   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5125   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2550   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7701   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0689   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3264   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5840   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3264   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -7.1136    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.5920   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -6.2886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -7.9386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  3  4  1  0  0  0  0
  3  2  1  0  0  0  0
  5  6  1  0  0  0  0
  6  3  2  0  0  0  0
  5  7  1  0  0  0  0
  8  9  1  0  0  0  0
  8  7  1  0  0  0  0
 10 11  1  0  0  0  0
 11  8  1  0  0  0  0
 10 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 13 16  2  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 23 25  1  0  0  0  0
 24 26  1  0  0  0  0
 19 21  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  2  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 28 30  1  0  0  0  0
 29  1  1  0  0  0  0
 18 20  1  0  0  0  0
 14 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  2  0  0  0  0
M  STY  1   1 SRU
M  SCN  1   1 HT 
M  SAL   1  5   2   3   4   5   6
M  SDI   1  4    9.7367   -5.9290    9.3122   -5.2215
M  SDI   1  4   11.2488   -4.0843   11.7064   -4.7708
M  SBL   1  2   1   6
M  SMT   1 n
M  END

HMDB0001513
     RDKit          3D
Dolichyl diphosphate
 80 79  0  0  0  0  0  0  0  0999 V2000
   -8.7643    1.1719    1.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6900    0.0548    0.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8181   -0.9219    0.5595 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6175   -0.0590   -0.1605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5074   -1.1661   -1.1424 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3064   -2.0285   -0.9598 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9971   -1.3964   -1.1914 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7579   -2.2253   -0.9258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7897   -0.1762   -1.6082 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4074    0.3312   -1.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2502    1.5222   -0.8800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8822    2.1163   -0.9871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4882    3.3025   -0.1805 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9419    1.6215   -1.8058 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4116    2.2157   -1.9063 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5255    1.2703   -1.5369 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4755    0.7601   -0.1629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2650   -0.0559    0.2509 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4006    0.9365    0.7722 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6199    1.6805    0.5552 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9204    0.9948    0.5545 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3865    0.2535    1.7311 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4961    1.0562    3.0001 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8530   -1.1377    1.9135 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2278   -2.0276    0.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183   -2.0529    0.6442 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1314   -3.0146   -0.6478 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.1836   -2.9368   -1.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2015   -4.6360   -0.1310 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6957   -2.5416   -1.0444 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8916   -0.8671   -0.9641 P   0  0  0  0  0  5  0  0  0  0  0  0
    9.1300   -0.5116    0.4954 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2672   -0.3860   -1.8189 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5127   -0.0569   -1.5496 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5682    2.1117    1.0362 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7374    1.2317    2.1109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9737    1.0050    2.3709 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6340   -0.6010    1.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2366   -1.0070   -0.4661 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4282   -1.8887    0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8609    0.6796   -0.0316 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4483   -0.7157   -2.1598 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4534   -1.7577   -1.1069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3486   -2.5321    0.0425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4241   -2.8838   -1.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0414   -3.2438   -0.5594 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341   -1.7668   -0.1549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2041   -2.3882   -1.8590 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6073    0.4686   -1.8497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6526   -0.4425   -1.6237 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2828    0.6352   -2.8748 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3579    1.1430    0.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0381    2.2433   -1.1233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3225    3.5534    0.5069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3261    4.1999   -0.8232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    3.0761    0.4520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2057    0.7594   -2.4084 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5638    2.4401   -3.0032 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4960    3.1854   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5166    1.6551   -1.8074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3850    0.3839   -2.2307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3974    0.5238    0.9071 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6218   -0.9185    0.8673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2742   -0.4702   -0.5975 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1990    0.5130    1.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6907    2.4838    1.3883 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5947    2.3318   -0.3693 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9663    0.3062   -0.3253 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7331    1.7596    0.3072 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.0389    1.4844 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0110    0.5114    3.8567 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5336    1.2615    3.3248 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0262    2.0753    2.8813 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2248   -1.6032    2.8589 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7578   -1.1140    1.9448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7863   -1.6926   -0.2147 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9238   -3.0781    0.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1282   -4.9501   -0.0154 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4138    0.5805   -1.5755 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4777    0.8068   -1.0618 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 31 34  1  0
  1 35  1  0
  1 36  1  0
  1 37  1  0
  3 38  1  0
  3 39  1  0
  3 40  1  0
  4 41  1  0
  5 42  1  0
  5 43  1  0
  6 44  1  0
  6 45  1  0
  8 46  1  0
  8 47  1  0
  8 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 11 52  1  0
 11 53  1  0
 13 54  1  0
 13 55  1  0
 13 56  1  0
 14 57  1  0
 15 58  1  0
 15 59  1  0
 16 60  1  0
 16 61  1  0
 18 62  1  0
 18 63  1  0
 18 64  1  0
 19 65  1  0
 20 66  1  0
 20 67  1  0
 21 68  1  0
 21 69  1  0
 22 70  1  0
 23 71  1  0
 23 72  1  0
 23 73  1  0
 24 74  1  0
 24 75  1  0
 25 76  1  0
 25 77  1  0
 29 78  1  0
 33 79  1  0
 34 80  1  0
M  END


  Mrv1652303062020142D          

 34 33  0  0  0  0            999 V2000
   11.8416   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2228   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4804   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4804   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7792   -5.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7792   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1605   -5.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4180   -5.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4180   -4.5562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7168   -6.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7168   -5.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9744   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -7.1136    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.2420   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -6.2474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1082   -7.9797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9260   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1836   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4411   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1836   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6986   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9975   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2550   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5125   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2550   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7701   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0689   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3264   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5840   -4.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3264   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -7.1136    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.5920   -7.1136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -6.2886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4170   -7.9386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  3  4  1  0  0  0  0
  3  2  1  0  0  0  0
  5  6  1  0  0  0  0
  6  3  2  0  0  0  0
  5  7  1  0  0  0  0
  8  9  1  0  0  0  0
  8  7  1  0  0  0  0
 10 11  1  0  0  0  0
 11  8  1  0  0  0  0
 10 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 15  1  0  0  0  0
 13 16  2  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 23 25  1  0  0  0  0
 24 26  1  0  0  0  0
 19 21  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  2  0  0  0  0
 26 27  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  2  0  0  0  0
 28 30  1  0  0  0  0
 29  1  1  0  0  0  0
 18 20  1  0  0  0  0
 14 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  0  0  0  0
 31 34  2  0  0  0  0
M  STY  1   1 SRU
M  SCN  1   1 HT 
M  SAL   1  5   2   3   4   5   6
M  SDI   1  4    9.7367   -5.9290    9.3122   -5.2215
M  SDI   1  4   11.2488   -4.0843   11.7064   -4.7708
M  SBL   1  2   1   6
M  SMT   1 n
M  END
> <DATABASE_ID>
HMDB0001513

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(CCOP(O)(=O)OP(O)(O)=O)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C

> <INCHI_IDENTIFIER>
InChI=1S/C25H46O7P2/c1-21(2)11-7-12-22(3)13-8-14-23(4)15-9-16-24(5)17-10-18-25(6)19-20-31-34(29,30)32-33(26,27)28/h11,13,15,17,25H,7-10,12,14,16,18-20H2,1-6H3,(H,29,30)(H2,26,27,28)/b22-13+,23-15+,24-17-

> <INCHI_KEY>
MXGLYEVGJRXBTP-QOLULZROSA-N

> <FORMULA>
(C5H8)nC20H38O7P2

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
dolichol pyrophosphate

> <ALOGPS_LOGP>
5.21

> <ALOGPS_LOGS>
-5.56

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.42e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
dolichol pyrophosphate

$$$$

HMDB0001513
     RDKit          3D
Dolichyl diphosphate
 80 79  0  0  0  0  0  0  0  0999 V2000
   -8.7643    1.1719    1.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6900    0.0548    0.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8181   -0.9219    0.5595 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6175   -0.0590   -0.1605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5074   -1.1661   -1.1424 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3064   -2.0285   -0.9598 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9971   -1.3964   -1.1914 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7579   -2.2253   -0.9258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7897   -0.1762   -1.6082 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4074    0.3312   -1.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2502    1.5222   -0.8800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8822    2.1163   -0.9871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4882    3.3025   -0.1805 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9419    1.6215   -1.8058 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4116    2.2157   -1.9063 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5255    1.2703   -1.5369 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4755    0.7601   -0.1629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2650   -0.0559    0.2509 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4006    0.9365    0.7722 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6199    1.6805    0.5552 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9204    0.9948    0.5545 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3865    0.2535    1.7311 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4961    1.0562    3.0001 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8530   -1.1377    1.9135 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2278   -2.0276    0.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183   -2.0529    0.6442 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1314   -3.0146   -0.6478 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.1836   -2.9368   -1.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2015   -4.6360   -0.1310 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6957   -2.5416   -1.0444 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8916   -0.8671   -0.9641 P   0  0  0  0  0  5  0  0  0  0  0  0
    9.1300   -0.5116    0.4954 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2672   -0.3860   -1.8189 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5127   -0.0569   -1.5496 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5682    2.1117    1.0362 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7374    1.2317    2.1109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9737    1.0050    2.3709 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6340   -0.6010    1.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2366   -1.0070   -0.4661 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4282   -1.8887    0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8609    0.6796   -0.0316 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4483   -0.7157   -2.1598 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4534   -1.7577   -1.1069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3486   -2.5321    0.0425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4241   -2.8838   -1.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0414   -3.2438   -0.5594 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341   -1.7668   -0.1549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2041   -2.3882   -1.8590 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6073    0.4686   -1.8497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6526   -0.4425   -1.6237 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2828    0.6352   -2.8748 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3579    1.1430    0.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0381    2.2433   -1.1233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3225    3.5534    0.5069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3261    4.1999   -0.8232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    3.0761    0.4520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2057    0.7594   -2.4084 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5638    2.4401   -3.0032 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4960    3.1854   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5166    1.6551   -1.8074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3850    0.3839   -2.2307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3974    0.5238    0.9071 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6218   -0.9185    0.8673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2742   -0.4702   -0.5975 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1990    0.5130    1.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6907    2.4838    1.3883 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5947    2.3318   -0.3693 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9663    0.3062   -0.3253 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7331    1.7596    0.3072 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.0389    1.4844 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0110    0.5114    3.8567 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5336    1.2615    3.3248 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0262    2.0753    2.8813 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2248   -1.6032    2.8589 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7578   -1.1140    1.9448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7863   -1.6926   -0.2147 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9238   -3.0781    0.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1282   -4.9501   -0.0154 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4138    0.5805   -1.5755 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4777    0.8068   -1.0618 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 31 34  1  0
  1 35  1  0
  1 36  1  0
  1 37  1  0
  3 38  1  0
  3 39  1  0
  3 40  1  0
  4 41  1  0
  5 42  1  0
  5 43  1  0
  6 44  1  0
  6 45  1  0
  8 46  1  0
  8 47  1  0
  8 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 11 52  1  0
 11 53  1  0
 13 54  1  0
 13 55  1  0
 13 56  1  0
 14 57  1  0
 15 58  1  0
 15 59  1  0
 16 60  1  0
 16 61  1  0
 18 62  1  0
 18 63  1  0
 18 64  1  0
 19 65  1  0
 20 66  1  0
 20 67  1  0
 21 68  1  0
 21 69  1  0
 22 70  1  0
 23 71  1  0
 23 72  1  0
 23 73  1  0
 24 74  1  0
 24 75  1  0
 25 76  1  0
 25 77  1  0
 29 78  1  0
 33 79  1  0
 34 80  1  0
M  END

HEADER    PROTEIN                                 06-MAR-20   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAR-20         0                                  
HETATM    1  C   UNK     0      22.104  -7.812   0.000  0.00  0.00           C+0
HETATM    2  C     n     1      20.949  -8.582   0.000  0.00  0.00           C+0
HETATM    3  C     n     1      19.563  -7.812   0.000  0.00  0.00           C+0
HETATM    4  C     n     1      19.563  -6.272   0.000  0.00  0.00           C+0
HETATM    5  C     n     1      18.255 -10.122   0.000  0.00  0.00           C+0
HETATM    6  C     n     1      18.255  -8.582   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      17.100 -10.815   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      15.714 -10.045   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      15.714  -8.505   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      14.405 -12.355   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      14.405 -10.815   0.000  0.00  0.00           C+0
HETATM   12  O   UNK     0      13.019 -13.279   0.000  0.00  0.00           O+0
HETATM   13  P   UNK     0      11.402 -13.279   0.000  0.00  0.00           P+0
HETATM   14  O   UNK     0       9.785 -13.279   0.000  0.00  0.00           O+0
HETATM   15  O   UNK     0      11.402 -11.662   0.000  0.00  0.00           O+0
HETATM   16  O   UNK     0      11.402 -14.895   0.000  0.00  0.00           O+0
HETATM   17  C   UNK     0      37.195  -8.582   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      35.809  -7.812   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      34.423  -8.582   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      35.809  -6.272   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      33.037  -7.812   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      31.729  -8.582   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      30.343  -7.812   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      28.957  -8.582   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      30.343  -6.272   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      27.571  -7.812   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      26.262  -8.582   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      24.876  -7.812   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      23.490  -8.582   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      24.876  -6.272   0.000  0.00  0.00           C+0
HETATM   31  P   UNK     0       8.245 -13.279   0.000  0.00  0.00           P+0
HETATM   32  O   UNK     0       6.705 -13.279   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       8.245 -11.739   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       8.245 -14.819   0.000  0.00  0.00           O+0
CONECT    1    2   29                                                       
CONECT    2    1    3                                                       
CONECT    3    4    2    6                                                  
CONECT    4    3                                                            
CONECT    5    6    7                                                       
CONECT    6    5    3                                                       
CONECT    7    5    8                                                       
CONECT    8    9    7   11                                                  
CONECT    9    8                                                            
CONECT   10   11   12                                                       
CONECT   11   10    8                                                       
CONECT   12   10   13                                                       
CONECT   13   12   14   15   16                                             
CONECT   14   13   31                                                       
CONECT   15   13                                                            
CONECT   16   13                                                            
CONECT   17   18                                                            
CONECT   18   17   19   20                                                  
CONECT   19   21   18                                                       
CONECT   20   18                                                            
CONECT   21   22   19                                                       
CONECT   22   21   23                                                       
CONECT   23   22   24   25                                                  
CONECT   24   23   26                                                       
CONECT   25   23                                                            
CONECT   26   24   27                                                       
CONECT   27   26   28                                                       
CONECT   28   27   29   30                                                  
CONECT   29   28    1                                                       
CONECT   30   28                                                            
CONECT   31   14   32   33   34                                             
CONECT   32   31                                                            
CONECT   33   31                                                            
CONECT   34   31                                                            
MASTER        0    0    0    0    0    0    0    0   34    0   66    0
END

COMPND    HMDB0001513
HETATM    1  C1  UNL     1      -8.764   1.172   1.597  1.00  0.00           C  
HETATM    2  C2  UNL     1      -8.690   0.055   0.630  1.00  0.00           C  
HETATM    3  C3  UNL     1      -9.818  -0.922   0.560  1.00  0.00           C  
HETATM    4  C4  UNL     1      -7.618  -0.059  -0.161  1.00  0.00           C  
HETATM    5  C5  UNL     1      -7.507  -1.166  -1.142  1.00  0.00           C  
HETATM    6  C6  UNL     1      -6.306  -2.028  -0.960  1.00  0.00           C  
HETATM    7  C7  UNL     1      -4.997  -1.396  -1.191  1.00  0.00           C  
HETATM    8  C8  UNL     1      -3.758  -2.225  -0.926  1.00  0.00           C  
HETATM    9  C9  UNL     1      -4.790  -0.176  -1.608  1.00  0.00           C  
HETATM   10  C10 UNL     1      -3.407   0.331  -1.794  1.00  0.00           C  
HETATM   11  C11 UNL     1      -3.250   1.522  -0.880  1.00  0.00           C  
HETATM   12  C12 UNL     1      -1.882   2.116  -0.987  1.00  0.00           C  
HETATM   13  C13 UNL     1      -1.488   3.302  -0.181  1.00  0.00           C  
HETATM   14  C14 UNL     1      -0.942   1.621  -1.806  1.00  0.00           C  
HETATM   15  C15 UNL     1       0.412   2.216  -1.906  1.00  0.00           C  
HETATM   16  C16 UNL     1       1.525   1.270  -1.537  1.00  0.00           C  
HETATM   17  C17 UNL     1       1.476   0.760  -0.163  1.00  0.00           C  
HETATM   18  C18 UNL     1       0.265  -0.056   0.251  1.00  0.00           C  
HETATM   19  C19 UNL     1       2.401   0.936   0.772  1.00  0.00           C  
HETATM   20  C20 UNL     1       3.620   1.681   0.555  1.00  0.00           C  
HETATM   21  C21 UNL     1       4.920   0.995   0.555  1.00  0.00           C  
HETATM   22  C22 UNL     1       5.387   0.254   1.731  1.00  0.00           C  
HETATM   23  C23 UNL     1       5.496   1.056   3.000  1.00  0.00           C  
HETATM   24  C24 UNL     1       4.853  -1.138   1.913  1.00  0.00           C  
HETATM   25  C25 UNL     1       5.228  -2.028   0.721  1.00  0.00           C  
HETATM   26  O1  UNL     1       6.618  -2.053   0.644  1.00  0.00           O  
HETATM   27  P1  UNL     1       7.131  -3.015  -0.648  1.00  0.00           P  
HETATM   28  O2  UNL     1       6.184  -2.937  -1.814  1.00  0.00           O  
HETATM   29  O3  UNL     1       7.201  -4.636  -0.131  1.00  0.00           O  
HETATM   30  O4  UNL     1       8.696  -2.542  -1.044  1.00  0.00           O  
HETATM   31  P2  UNL     1       8.892  -0.867  -0.964  1.00  0.00           P  
HETATM   32  O5  UNL     1       9.130  -0.512   0.495  1.00  0.00           O  
HETATM   33  O6  UNL     1      10.267  -0.386  -1.819  1.00  0.00           O  
HETATM   34  O7  UNL     1       7.513  -0.057  -1.550  1.00  0.00           O  
HETATM   35  H1  UNL     1      -8.568   2.112   1.036  1.00  0.00           H  
HETATM   36  H2  UNL     1      -9.737   1.232   2.111  1.00  0.00           H  
HETATM   37  H3  UNL     1      -7.974   1.005   2.371  1.00  0.00           H  
HETATM   38  H4  UNL     1     -10.634  -0.601   1.236  1.00  0.00           H  
HETATM   39  H5  UNL     1     -10.237  -1.007  -0.466  1.00  0.00           H  
HETATM   40  H6  UNL     1      -9.428  -1.889   0.947  1.00  0.00           H  
HETATM   41  H7  UNL     1      -6.861   0.680  -0.032  1.00  0.00           H  
HETATM   42  H8  UNL     1      -7.448  -0.716  -2.160  1.00  0.00           H  
HETATM   43  H9  UNL     1      -8.453  -1.758  -1.107  1.00  0.00           H  
HETATM   44  H10 UNL     1      -6.349  -2.532   0.043  1.00  0.00           H  
HETATM   45  H11 UNL     1      -6.424  -2.884  -1.681  1.00  0.00           H  
HETATM   46  H12 UNL     1      -4.041  -3.244  -0.559  1.00  0.00           H  
HETATM   47  H13 UNL     1      -3.134  -1.767  -0.155  1.00  0.00           H  
HETATM   48  H14 UNL     1      -3.204  -2.388  -1.859  1.00  0.00           H  
HETATM   49  H15 UNL     1      -5.607   0.469  -1.850  1.00  0.00           H  
HETATM   50  H16 UNL     1      -2.653  -0.442  -1.624  1.00  0.00           H  
HETATM   51  H17 UNL     1      -3.283   0.635  -2.875  1.00  0.00           H  
HETATM   52  H18 UNL     1      -3.358   1.143   0.158  1.00  0.00           H  
HETATM   53  H19 UNL     1      -4.038   2.243  -1.123  1.00  0.00           H  
HETATM   54  H20 UNL     1      -2.322   3.553   0.507  1.00  0.00           H  
HETATM   55  H21 UNL     1      -1.326   4.200  -0.823  1.00  0.00           H  
HETATM   56  H22 UNL     1      -0.601   3.076   0.452  1.00  0.00           H  
HETATM   57  H23 UNL     1      -1.206   0.759  -2.408  1.00  0.00           H  
HETATM   58  H24 UNL     1       0.564   2.440  -3.003  1.00  0.00           H  
HETATM   59  H25 UNL     1       0.496   3.185  -1.399  1.00  0.00           H  
HETATM   60  H26 UNL     1       2.517   1.655  -1.807  1.00  0.00           H  
HETATM   61  H27 UNL     1       1.385   0.384  -2.231  1.00  0.00           H  
HETATM   62  H28 UNL     1      -0.397   0.524   0.907  1.00  0.00           H  
HETATM   63  H29 UNL     1       0.622  -0.919   0.867  1.00  0.00           H  
HETATM   64  H30 UNL     1      -0.274  -0.470  -0.598  1.00  0.00           H  
HETATM   65  H31 UNL     1       2.199   0.513   1.748  1.00  0.00           H  
HETATM   66  H32 UNL     1       3.691   2.484   1.388  1.00  0.00           H  
HETATM   67  H33 UNL     1       3.595   2.332  -0.369  1.00  0.00           H  
HETATM   68  H34 UNL     1       4.966   0.306  -0.325  1.00  0.00           H  
HETATM   69  H35 UNL     1       5.733   1.760   0.307  1.00  0.00           H  
HETATM   70  H36 UNL     1       6.513   0.039   1.484  1.00  0.00           H  
HETATM   71  H37 UNL     1       5.011   0.511   3.857  1.00  0.00           H  
HETATM   72  H38 UNL     1       6.534   1.261   3.325  1.00  0.00           H  
HETATM   73  H39 UNL     1       5.026   2.075   2.881  1.00  0.00           H  
HETATM   74  H40 UNL     1       5.225  -1.603   2.859  1.00  0.00           H  
HETATM   75  H41 UNL     1       3.758  -1.114   1.945  1.00  0.00           H  
HETATM   76  H42 UNL     1       4.786  -1.693  -0.215  1.00  0.00           H  
HETATM   77  H43 UNL     1       4.924  -3.078   0.916  1.00  0.00           H  
HETATM   78  H44 UNL     1       8.128  -4.950  -0.015  1.00  0.00           H  
HETATM   79  H45 UNL     1      10.414   0.580  -1.575  1.00  0.00           H  
HETATM   80  H46 UNL     1       7.478   0.807  -1.062  1.00  0.00           H  
CONECT    1    2   35   36   37
CONECT    2    3    4    4
CONECT    3   38   39   40
CONECT    4    5   41
CONECT    5    6   42   43
CONECT    6    7   44   45
CONECT    7    8    9    9
CONECT    8   46   47   48
CONECT    9   10   49
CONECT   10   11   50   51
CONECT   11   12   52   53
CONECT   12   13   14   14
CONECT   13   54   55   56
CONECT   14   15   57
CONECT   15   16   58   59
CONECT   16   17   60   61
CONECT   17   18   19   19
CONECT   18   62   63   64
CONECT   19   20   65
CONECT   20   21   66   67
CONECT   21   22   68   69
CONECT   22   23   24   70
CONECT   23   71   72   73
CONECT   24   25   74   75
CONECT   25   26   76   77
CONECT   26   27
CONECT   27   28   28   29   30
CONECT   29   78
CONECT   30   31
CONECT   31   32   32   33   34
CONECT   33   79
CONECT   34   80
END

HMDB0001513
     RDKit          3D
Dolichyl diphosphate
 80 79  0  0  0  0  0  0  0  0999 V2000
   -8.7643    1.1719    1.5970 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6900    0.0548    0.6300 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8181   -0.9219    0.5595 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6175   -0.0590   -0.1605 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5074   -1.1661   -1.1424 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3064   -2.0285   -0.9598 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9971   -1.3964   -1.1914 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7579   -2.2253   -0.9258 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7897   -0.1762   -1.6082 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4074    0.3312   -1.7937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2502    1.5222   -0.8800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8822    2.1163   -0.9871 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4882    3.3025   -0.1805 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9419    1.6215   -1.8058 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4116    2.2157   -1.9063 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5255    1.2703   -1.5369 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4755    0.7601   -0.1629 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2650   -0.0559    0.2509 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4006    0.9365    0.7722 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6199    1.6805    0.5552 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9204    0.9948    0.5545 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3865    0.2535    1.7311 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4961    1.0562    3.0001 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8530   -1.1377    1.9135 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2278   -2.0276    0.7212 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6183   -2.0529    0.6442 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1314   -3.0146   -0.6478 P   0  0  0  0  0  5  0  0  0  0  0  0
    6.1836   -2.9368   -1.8143 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2015   -4.6360   -0.1310 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6957   -2.5416   -1.0444 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8916   -0.8671   -0.9641 P   0  0  0  0  0  5  0  0  0  0  0  0
    9.1300   -0.5116    0.4954 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2672   -0.3860   -1.8189 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5127   -0.0569   -1.5496 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5682    2.1117    1.0362 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7374    1.2317    2.1109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9737    1.0050    2.3709 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6340   -0.6010    1.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2366   -1.0070   -0.4661 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4282   -1.8887    0.9466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8609    0.6796   -0.0316 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4483   -0.7157   -2.1598 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4534   -1.7577   -1.1069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3486   -2.5321    0.0425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4241   -2.8838   -1.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0414   -3.2438   -0.5594 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341   -1.7668   -0.1549 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2041   -2.3882   -1.8590 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6073    0.4686   -1.8497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6526   -0.4425   -1.6237 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2828    0.6352   -2.8748 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3579    1.1430    0.1575 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0381    2.2433   -1.1233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3225    3.5534    0.5069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3261    4.1999   -0.8232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    3.0761    0.4520 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2057    0.7594   -2.4084 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5638    2.4401   -3.0032 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4960    3.1854   -1.3995 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5166    1.6551   -1.8074 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3850    0.3839   -2.2307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3974    0.5238    0.9071 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6218   -0.9185    0.8673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2742   -0.4702   -0.5975 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1990    0.5130    1.7478 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6907    2.4838    1.3883 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5947    2.3318   -0.3693 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9663    0.3062   -0.3253 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7331    1.7596    0.3072 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5134    0.0389    1.4844 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0110    0.5114    3.8567 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5336    1.2615    3.3248 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0262    2.0753    2.8813 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2248   -1.6032    2.8589 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7578   -1.1140    1.9448 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7863   -1.6926   -0.2147 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9238   -3.0781    0.9155 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1282   -4.9501   -0.0154 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4138    0.5805   -1.5755 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4777    0.8068   -1.0618 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 27 30  1  0
 30 31  1  0
 31 32  2  0
 31 33  1  0
 31 34  1  0
  1 35  1  0
  1 36  1  0
  1 37  1  0
  3 38  1  0
  3 39  1  0
  3 40  1  0
  4 41  1  0
  5 42  1  0
  5 43  1  0
  6 44  1  0
  6 45  1  0
  8 46  1  0
  8 47  1  0
  8 48  1  0
  9 49  1  0
 10 50  1  0
 10 51  1  0
 11 52  1  0
 11 53  1  0
 13 54  1  0
 13 55  1  0
 13 56  1  0
 14 57  1  0
 15 58  1  0
 15 59  1  0
 16 60  1  0
 16 61  1  0
 18 62  1  0
 18 63  1  0
 18 64  1  0
 19 65  1  0
 20 66  1  0
 20 67  1  0
 21 68  1  0
 21 69  1  0
 22 70  1  0
 23 71  1  0
 23 72  1  0
 23 73  1  0
 24 74  1  0
 24 75  1  0
 25 76  1  0
 25 77  1  0
 29 78  1  0
 33 79  1  0
 34 80  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Dolichol diphosphate	Kegg
Dolichol diphosphoric acid	Generator
Dolichyl diphosphoric acid	Generator
Dolichol pyrophosphate	HMDB
Dolichyl pyrophosphate	HMDB
Pyrophosphoryl dolichol	HMDB
Dolichyl diphosphate	HMDB

Chemical Formula

(C₅H₈)nC₂₀H₃₈O₇P₂

Average Molecular Weight

Not Available

Monoisotopic Molecular Weight

Not Available

IUPAC Name

dolichol pyrophosphate

Traditional Name

dolichol pyrophosphate

CAS Registry Number

37247-98-6

SMILES

CC(CCOP(O)(=O)OP(O)(O)=O)CC\C=C(\C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C

InChI Identifier

InChI=1S/C25H46O7P2/c1-21(2)11-7-12-22(3)13-8-14-23(4)15-9-16-24(5)17-10-18-25(6)19-20-31-34(29,30)32-33(26,27)28/h11,13,15,17,25H,7-10,12,14,16,18-20H2,1-6H3,(H,29,30)(H2,26,27,28)/b22-13+,23-15+,24-17-

InChI Key

MXGLYEVGJRXBTP-QOLULZROSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as polyprenyl diphosphates. These are prenol lipids in which the diphosphate group is linked to one end of the polyprenol moiety.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Prenol lipids

Sub Class

Polyprenols

Direct Parent

Polyprenyl diphosphates

Alternative Parents

Substituents

Polyprenyl diphosphate
Dolichyl diphosphate
Polyprenyl monophosphate
Sesterterpenoid
Organic pyrophosphate
Monoalkyl phosphate
Alkyl phosphate
Phosphoric acid ester
Organic phosphoric acid derivative
Organic oxygen compound
Organic oxide
Hydrocarbon derivative
Organooxygen compound
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Dolichol diphosphates (C00621 )
Dolichol diphosphates (LMPR03090023 )

Ontology

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.64 g/L	ALOGPS
logP	5.21	ALOGPS
logS	-5.6	ALOGPS
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	205.625	30932474
DeepCCS	[M-H]-	203.228	30932474
DeepCCS	[M-2H]-	236.112	30932474
DeepCCS	[M+Na]+	211.538	30932474
AllCCS	[M+H]+	233.4	32859911
AllCCS	[M+H-H2O]+	231.8	32859911
AllCCS	[M+NH4]+	234.9	32859911
AllCCS	[M+Na]+	235.3	32859911
AllCCS	[M-H]-	225.7	32859911
AllCCS	[M+Na-2H]-	229.1	32859911
AllCCS	[M+HCOO]-	233.1	32859911

Predicted Retention Times

Underivatized

Chromatographic Method	Retention Time	Reference
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022.	10.05 minutes	32390414
Predicted by Siyang on May 30, 2022	16.3102 minutes	33406817
Predicted by Siyang using ReTip algorithm on June 8, 2022	2.06 minutes	32390414
AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid	78.5 seconds	40023050
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid	3331.9 seconds	40023050
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid	201.0 seconds	40023050
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid	221.1 seconds	40023050
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid	174.7 seconds	40023050
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	172.8 seconds	40023050
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid	886.8 seconds	40023050
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid	987.0 seconds	40023050
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate)	92.7 seconds	40023050
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid	1518.0 seconds	40023050
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid	789.5 seconds	40023050
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid	853.1 seconds	40023050
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	636.5 seconds	40023050
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid	403.6 seconds	40023050
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate	264.5 seconds	40023050
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA	421.0 seconds	40023050
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water	8.5 seconds	40023050

Predicted Kovats Retention Indices

Not Available

Spectra

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 10V, Positive-QTOF	splash10-006x-1319560000-708df26fea5e6e561485	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 20V, Positive-QTOF	splash10-0006-4429100000-b4180d49ab72f97027cd	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 40V, Positive-QTOF	splash10-0006-4449000000-0d19b360327c0b2132b5	2019-02-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 10V, Negative-QTOF	splash10-014i-0400090000-09ed3e8ebf064013ea39	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 20V, Negative-QTOF	splash10-004i-9201000000-982c4e7291f91755e0c0	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 40V, Negative-QTOF	splash10-004i-9000000000-9fcecdd44b53bc65fe73	2019-02-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 10V, Negative-QTOF	splash10-01b9-0000590000-ff40a651a148f6c74039	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 20V, Negative-QTOF	splash10-05r0-9800080000-210bd881391d3e7f8611	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 40V, Negative-QTOF	splash10-0a4i-4900000000-bb700d3d1e704cc8cb9c	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 10V, Positive-QTOF	splash10-00di-2205490000-452e15fea66a1a585f73	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 20V, Positive-QTOF	splash10-0006-4259100000-9ee831d9b538b00af707	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Dolichyl diphosphate 40V, Positive-QTOF	splash10-000f-1957000000-f2d839d16273b5d22ada	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Membrane (predicted from logP)

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB022667

KNApSAcK ID

Not Available

Chemspider ID

24846867

KEGG Compound ID

C00621

BioCyc ID

Dolichol-PP

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

6290

PubChem Compound

24892721

PDB ID

Not Available

ChEBI ID

15750

Food Biomarker Ontology

Not Available

VMH ID

DOLDP_L

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Staneloni RJ, Ugalde RA, Leloir LF: Addition of glucose to dolichyl diphosphate oligosaccharide and transfer to protein. Eur J Biochem. 1980 Apr;105(2):275-8. doi: 10.1111/j.1432-1033.1980.tb04498.x. [PubMed:7379786 ]

Enzymes

Enzyme Details

1. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1

General function:: Involved in dolichyl-diphosphooligosaccharide-protein glycotransferase activity
Specific function:: Essential subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains.
Gene Name:: RPN1
Uniprot ID:: P04843
Molecular weight:: 68568.81

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details

Enzyme Details

2. Dolichyldiphosphatase 1

General function:: Involved in catalytic activity
Specific function:: Required for efficient N-glycosylation. Necessary for maintaining optimal levels of dolichol-linked oligosaccharides. Hydrolyzes dolichyl pyrophosphate at a very high rate and dolichyl monophosphate at a much lower rate. Does not act on phosphatidate (By similarity).
Gene Name:: DOLPP1
Uniprot ID:: Q86YN1
Molecular weight:: 22133.63

Reactions

Dolichyl diphosphate + Water → Dolichol-20 + Phosphate	details

Enzyme Details

3. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit

General function:: Involved in dolichyl-diphosphooligosaccharide-protein glycotransferase activity
Specific function:: Essential subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains.
Gene Name:: DDOST
Uniprot ID:: P39656
Molecular weight:: 50701.205

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details

Enzyme Details

4. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2

General function:: Involved in dolichyl-diphosphooligosaccharide-protein glycotransferase activity
Specific function:: Essential subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains.
Gene Name:: RPN2
Uniprot ID:: P04844
Molecular weight:: 67722.73

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details

Enzyme Details

5. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A

General function:: Involved in oligosaccharyl transferase activity
Specific function:: Catalytic subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains. N-glycosylation occurs cotranslationally and the complex associates with the Sec61 complex at the channel-forming translocon complex that mediates protein translocation across the endoplasmic reticulum (ER). SST3A seems to be involved in complex substrate specificity. STT3A is present in the majority of OST complexes and mediates cotranslational N-glycosylation of most sites on target proteins, while STT3B-containing complexes are required for efficient cotranslational glycosylation and mediate glycosylation of sites that have been skipped by STT3A.
Gene Name:: STT3A
Uniprot ID:: P46977
Molecular weight:: 80528.83

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details
Dolichyl diphosphooligosaccharide + Protein asparagine → Dolichyl diphosphate + Glycoprotein with the oligosaccharide chain attached by N-glycosyl linkage to protein L-asparagine	details
Protein asparagine + → Dolichyl diphosphate +	details

Enzyme Details

6. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1

General function:: Involved in dolichyl-diphosphooligosaccharide-protein g
Specific function:: Essential subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains. N-glycosylation occurs cotranslationally and the complex associates with the Sec61 complex at the channel-forming translocon complex that mediates protein translocation across the endoplasmic reticulum (ER). Loss of the DAD1 protein triggers apoptosis (By similarity).
Gene Name:: DAD1
Uniprot ID:: P61803
Molecular weight:: 12496.55

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details

Enzyme Details

7. Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B

General function:: Involved in oligosaccharyl transferase activity
Specific function:: Catalytic subunit of the N-oligosaccharyl transferase (OST) complex which catalyzes the transfer of a high mannose oligosaccharide from a lipid-linked oligosaccharide donor to an asparagine residue within an Asn-X-Ser/Thr consensus motif in nascent polypeptide chains. N-glycosylation occurs cotranslationally and the complex associates with the Sec61 complex at the channel-forming translocon complex that mediates protein translocation across the endoplasmic reticulum (ER). STT3B is present in a small subset of OST complexes and mediates both cotranslational and post-translational N-glycosylation of target proteins: STT3B-containing complexes are required for efficient cotranslational glycosylation and while they are less competent than STT3A-containing complexes for cotranslational glycosylation, they have the ability to mediate glycosylation of some nascent sites that are not accessible for STT3A. STT3B-containing complexes also act post-translationally and mediate modification of skipped glycosylation sites in unfolded proteins. Plays a role in ER-associated degradation (ERAD) pathway that mediates ubiquitin-dependent degradation of misfolded endoplasmic reticulum proteins by mediating N-glycosylation of unfolded proteins, which are then recognized by the ERAD pathway and targeted for degradation. Mediates glycosylation of the disease variant AMYL-TTR 'Asp-38' of TTR at 'Asn-118', leading to its degradation.
Gene Name:: STT3B
Uniprot ID:: Q8TCJ2
Molecular weight:: 93673.495

Reactions

Dolichyl diphosphooligosaccharide + [protein]-L-asparagine → Dolichyl diphosphate + a glycoprotein with the oligosaccharide chain attached by N-beta-D-glycosyl linkage to a protein L-asparagine	details
Dolichyl diphosphooligosaccharide + Protein asparagine → Dolichyl diphosphate + Glycoprotein with the oligosaccharide chain attached by N-glycosyl linkage to protein L-asparagine	details
Protein asparagine + → Dolichyl diphosphate +	details

Showing metabocard for Dolichyl diphosphate (HMDB0001513)

MOL for HMDB0001513 (Dolichyl diphosphate)

3D MOL for HMDB0001513 (Dolichyl diphosphate)

3D SDF for HMDB0001513 (Dolichyl diphosphate)

3D-SDF for HMDB0001513 (Dolichyl diphosphate)

PDB for HMDB0001513 (Dolichyl diphosphate)

3D PDB for HMDB0001513 (Dolichyl diphosphate)

SMILES for HMDB0001513 (Dolichyl diphosphate)

INCHI for HMDB0001513 (Dolichyl diphosphate)

Structure for HMDB0001513 (Dolichyl diphosphate)

3D Structure for HMDB0001513 (Dolichyl diphosphate)

Predicted Collision Cross Sections

Predicted Retention Times

Underivatized

Predicted Kovats Retention Indices

MS/MS Spectra

Enzymes

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions

Reactions