| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2021-09-11 21:35:23 UTC |
|---|
| Update Date | 2022-11-23 22:29:18 UTC |
|---|
| HMDB ID | HMDB0259129 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Pglu-his-pro-gly; Gly-thyrotropin-releasing hormone |
|---|
| Description | Pglu-his-pro-gly; Gly-thyrotropin-releasing hormone belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. Based on a literature review a small amount of articles have been published on Pglu-his-pro-gly; Gly-thyrotropin-releasing hormone. This compound has been identified in human blood as reported by (PMID: 31557052 ). Pglu-his-pro-gly; gly-thyrotropin-releasing hormone is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Pglu-his-pro-gly; Gly-thyrotropin-releasing hormone is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. |
|---|
| Structure | OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1)NC(=O)C1CCC(=O)N1 InChI=1S/C18H24N6O6/c25-14-4-3-11(22-14)16(28)23-12(6-10-7-19-9-21-10)18(30)24-5-1-2-13(24)17(29)20-8-15(26)27/h7,9,11-13H,1-6,8H2,(H,19,21)(H,20,29)(H,22,25)(H,23,28)(H,26,27) |
|---|
| Synonyms | | Value | Source |
|---|
| 2-({hydroxy[1-(2-{[hydroxy(5-hydroxy-3,4-dihydro-2H-pyrrol-2-yl)methylidene]amino}-3-(1H-imidazol-5-yl)propanoyl)pyrrolidin-2-yl]methylidene}amino)acetate | HMDB |
|
|---|
| Chemical Formula | C18H24N6O6 |
|---|
| Average Molecular Weight | 420.426 |
|---|
| Monoisotopic Molecular Weight | 420.175732517 |
|---|
| IUPAC Name | 2-({1-[3-(1H-imidazol-5-yl)-2-[(5-oxopyrrolidin-2-yl)formamido]propanoyl]pyrrolidin-2-yl}formamido)acetic acid |
|---|
| Traditional Name | ({1-[3-(3H-imidazol-4-yl)-2-[(5-oxopyrrolidin-2-yl)formamido]propanoyl]pyrrolidin-2-yl}formamido)acetic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1)NC(=O)C1CCC(=O)N1 |
|---|
| InChI Identifier | InChI=1S/C18H24N6O6/c25-14-4-3-11(22-14)16(28)23-12(6-10-7-19-9-21-10)18(30)24-5-1-2-13(24)17(29)20-8-15(26)27/h7,9,11-13H,1-6,8H2,(H,19,21)(H,20,29)(H,22,25)(H,23,28)(H,26,27) |
|---|
| InChI Key | CSVCLHYFVGHUCM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Oligopeptides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Alpha-oligopeptide
- Histidine or derivatives
- N-acyl-alpha-amino acid
- Proline or derivatives
- N-acyl-alpha amino acid or derivatives
- Alpha-amino acid amide
- Alpha-amino acid or derivatives
- Imidazolyl carboxylic acid derivative
- N-acylpyrrolidine
- Pyrrolidine carboxylic acid or derivatives
- Pyrrolidine-2-carboxamide
- 2-pyrrolidone
- Pyrrolidone
- Pyrrolidine
- Azole
- Heteroaromatic compound
- Tertiary carboxylic acid amide
- Imidazole
- Secondary carboxylic acid amide
- Carboxamide group
- Lactam
- Azacycle
- Organoheterocyclic compound
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Organooxygen compound
- Organic nitrogen compound
- Organic oxide
- Hydrocarbon derivative
- Carbonyl group
- Organic oxygen compound
- Organonitrogen compound
- Aromatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aromatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.72 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 9.6308 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.17 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 850.5 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 196.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 90.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 161.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 58.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 255.9 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 312.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 890.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 596.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 108.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1009.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 213.6 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 240.8 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 422.1 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 565.2 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 287.4 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Trh-gly,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 3894.1 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 3660.3 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 6042.5 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 3735.7 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 3596.5 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 5761.0 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #2 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 4064.6 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #2 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 3668.7 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #2 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 6223.0 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3914.6 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3617.8 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 6062.3 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3762.9 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3647.4 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 5800.1 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 4044.4 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 3686.1 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1 | 6084.2 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #6 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3879.4 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #6 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3632.7 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #6 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 5936.2 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3734.9 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3658.3 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 5719.0 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #8 | C[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 4060.6 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #8 | C[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 3654.2 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #8 | C[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 6149.6 | Standard polar | 33892256 | | Trh-gly,2TMS,isomer #9 | C[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 3929.8 | Semi standard non polar | 33892256 | | Trh-gly,2TMS,isomer #9 | C[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 3652.8 | Standard non polar | 33892256 | | Trh-gly,2TMS,isomer #9 | C[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 5916.2 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 3950.3 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 3688.2 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C | 5690.8 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 3848.8 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 3668.9 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #10 | C[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C | 5441.5 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 3771.6 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 3620.0 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 5527.4 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3666.0 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3659.5 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 5331.3 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3959.4 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3670.6 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 5711.3 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3872.3 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3680.4 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 5493.2 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #6 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3655.3 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #6 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3607.6 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #6 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 5330.0 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3948.2 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 3703.7 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #7 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C | 5578.2 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #8 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3845.7 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #8 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 3718.9 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #8 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C | 5402.2 | Standard polar | 33892256 | | Trh-gly,3TMS,isomer #9 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3644.3 | Semi standard non polar | 33892256 | | Trh-gly,3TMS,isomer #9 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3635.8 | Standard non polar | 33892256 | | Trh-gly,3TMS,isomer #9 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 5250.0 | Standard polar | 33892256 | | Trh-gly,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 3857.1 | Semi standard non polar | 33892256 | | Trh-gly,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 3701.2 | Standard non polar | 33892256 | | Trh-gly,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C)[Si](C)(C)C | 5216.0 | Standard polar | 33892256 | | Trh-gly,4TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3780.8 | Semi standard non polar | 33892256 | | Trh-gly,4TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3733.7 | Standard non polar | 33892256 | | Trh-gly,4TMS,isomer #2 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 5050.9 | Standard polar | 33892256 | | Trh-gly,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 3606.6 | Semi standard non polar | 33892256 | | Trh-gly,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 3646.0 | Standard non polar | 33892256 | | Trh-gly,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 4857.2 | Standard polar | 33892256 | | Trh-gly,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3784.6 | Semi standard non polar | 33892256 | | Trh-gly,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3699.1 | Standard non polar | 33892256 | | Trh-gly,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 5047.8 | Standard polar | 33892256 | | Trh-gly,4TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3771.6 | Semi standard non polar | 33892256 | | Trh-gly,4TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 3742.4 | Standard non polar | 33892256 | | Trh-gly,4TMS,isomer #5 | C[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C | 4971.6 | Standard polar | 33892256 | | Trh-gly,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 3735.3 | Semi standard non polar | 33892256 | | Trh-gly,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 3755.6 | Standard non polar | 33892256 | | Trh-gly,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 4646.5 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4361.5 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4004.1 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5838.2 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 4273.4 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 3938.4 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=C[NH]1)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 5630.0 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 4561.3 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 4039.1 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 5985.4 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4407.4 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 3968.5 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5828.5 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4331.3 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 3995.8 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 5663.2 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 4508.2 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 4044.6 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1 | 5885.7 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4353.4 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 3971.3 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5734.4 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4276.7 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 3997.8 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 5590.5 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 4536.5 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 4021.4 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(C(=O)C1CCC(=O)N1)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 5912.8 | Standard polar | 33892256 | | Trh-gly,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 4457.6 | Semi standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 4029.9 | Standard non polar | 33892256 | | Trh-gly,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)NC(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O | 5753.7 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4629.4 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4219.9 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5468.7 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 4579.8 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 4198.7 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)N1C(=O)CCC1C(=O)N(C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)C(=O)N1CCCC1C(=O)NCC(=O)O)[Si](C)(C)C(C)(C)C | 5294.8 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4496.6 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4113.8 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 5324.5 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4423.3 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4146.1 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 5197.6 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4678.7 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4201.7 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5461.1 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4606.3 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4217.3 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 5323.6 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4424.3 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4097.8 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 5197.4 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4640.1 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 4218.5 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C | 5376.9 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4561.8 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 4243.7 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C | 5267.2 | Standard polar | 33892256 | | Trh-gly,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4388.2 | Semi standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4119.9 | Standard non polar | 33892256 | | Trh-gly,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 5147.4 | Standard polar | 33892256 | | Trh-gly,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4751.1 | Semi standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4360.7 | Standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 5073.1 | Standard polar | 33892256 | | Trh-gly,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4693.8 | Semi standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4395.2 | Standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)NC(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4967.7 | Standard polar | 33892256 | | Trh-gly,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4557.1 | Semi standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4267.3 | Standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CN(C(=O)C1CCCN1C(=O)C(CC1=CN=C[NH]1)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4803.1 | Standard polar | 33892256 | | Trh-gly,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4707.3 | Semi standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4357.5 | Standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CNC(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4971.6 | Standard polar | 33892256 | | Trh-gly,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4698.5 | Semi standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4380.2 | Standard non polar | 33892256 | | Trh-gly,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CC(=O)O)C(=O)C1CCCN1C(=O)C(CC1=CN=CN1[Si](C)(C)C(C)(C)C)N(C(=O)C1CCC(=O)N1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4938.2 | Standard polar | 33892256 |
|
|---|