| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 10.184 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.7 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 553.2 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 376.7 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 33.4 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 242.2 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 116.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 301.5 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 226.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 927.8 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 625.5 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 40.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 745.4 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 233.3 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 372.1 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 732.1 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 467.7 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 489.1 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Cysteine sulfinic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C | 1541.7 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C | 1757.8 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C | 2238.9 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #2 | C[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C | 1629.6 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #2 | C[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C | 1833.7 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #2 | C[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C | 2145.3 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #3 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O | 1651.9 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #3 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O | 1765.0 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #3 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O | 2201.2 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #4 | C[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C | 1775.2 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #4 | C[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C | 1914.8 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TMS,isomer #4 | C[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C | 2377.6 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #1 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1657.8 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #1 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1901.8 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #1 | C[Si](C)(C)NC(CS(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1829.2 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1797.4 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2023.0 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2011.1 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #3 | C[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1799.6 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #3 | C[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1944.2 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TMS,isomer #3 | C[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2005.9 | Standard polar | 33892256 |
| Cysteine sulfinic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1841.7 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2041.1 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1787.7 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C(C)(C)C | 2022.2 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C(C)(C)C | 2353.2 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)CS(=O)O[Si](C)(C)C(C)(C)C | 2316.5 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2097.6 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2441.8 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(CS(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2269.3 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2118.9 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2313.1 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2289.3 | Standard polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2213.5 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2397.4 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(C(CS(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2380.5 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2289.4 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2664.2 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(CS(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2208.2 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2455.6 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2795.3 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2301.9 | Standard polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2435.8 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2658.4 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OS(=O)CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2289.4 | Standard polar | 33892256 |
| Cysteine sulfinic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2671.6 | Semi standard non polar | 33892256 |
| Cysteine sulfinic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3007.0 | Standard non polar | 33892256 |
| Cysteine sulfinic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(CS(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2259.7 | Standard polar | 33892256 |