| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2020-11-01 18:41:56 UTC |
|---|
| Update Date | 2022-03-07 03:18:21 UTC |
|---|
| HMDB ID | HMDB0240727 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Avenanthramide P |
|---|
| Description | Avenanthramide P belongs to the class of organic compounds known as acylaminobenzoic acid and derivatives. These are derivatives of amino benzoic acid derivatives where the amine group is N-acylated. Based on a literature review a significant number of articles have been published on Avenanthramide P. |
|---|
| Structure | COC1=C(O)C=CC(\C=C\C=C\C(=O)NC2=C(C=C(O)C=C2)C(O)=O)=C1 InChI=1S/C19H17NO6/c1-26-17-10-12(6-9-16(17)22)4-2-3-5-18(23)20-15-8-7-13(21)11-14(15)19(24)25/h2-11,21-22H,1H3,(H,20,23)(H,24,25)/b4-2+,5-3+ |
|---|
| Synonyms | | Value | Source |
|---|
| 5-Hydroxy-2-{[(2E,4E)-1-hydroxy-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dien-1-ylidene]amino}benzoate | HMDB |
|
|---|
| Chemical Formula | C19H17NO6 |
|---|
| Average Molecular Weight | 355.346 |
|---|
| Monoisotopic Molecular Weight | 355.105587271 |
|---|
| IUPAC Name | 5-hydroxy-2-[(2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamido]benzoic acid |
|---|
| Traditional Name | 5-hydroxy-2-[(2E,4E)-5-(4-hydroxy-3-methoxyphenyl)penta-2,4-dienamido]benzoic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=C(O)C=CC(\C=C\C=C\C(=O)NC2=C(C=C(O)C=C2)C(O)=O)=C1 |
|---|
| InChI Identifier | InChI=1S/C19H17NO6/c1-26-17-10-12(6-9-16(17)22)4-2-3-5-18(23)20-15-8-7-13(21)11-14(15)19(24)25/h2-11,21-22H,1H3,(H,20,23)(H,24,25)/b4-2+,5-3+ |
|---|
| InChI Key | UXYPQEDKRALATQ-ZUVMSYQZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as acylaminobenzoic acid and derivatives. These are derivatives of amino benzoic acid derivatives where the amine group is N-acylated. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Benzoic acids and derivatives |
|---|
| Direct Parent | Acylaminobenzoic acid and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Acylaminobenzoic acid or derivatives
- Hydroxybenzoic acid
- Methoxyphenol
- Benzoic acid
- Anilide
- Anisole
- Benzoyl
- Phenoxy compound
- Phenol ether
- Styrene
- N-arylamide
- Methoxybenzene
- Alkyl aryl ether
- Phenol
- 1-hydroxy-2-unsubstituted benzenoid
- Vinylogous amide
- Secondary carboxylic acid amide
- Carboxamide group
- Carboxylic acid derivative
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Ether
- Organopnictogen compound
- Organonitrogen compound
- Carbonyl group
- Organooxygen compound
- Organic oxygen compound
- Organic nitrogen compound
- Hydrocarbon derivative
- Organic oxide
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Predicted by Siyang on May 30, 2022 | 12.3235 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.44 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2114.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 219.1 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 134.0 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 152.5 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 109.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 560.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 513.6 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 98.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1069.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 406.2 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1379.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 350.7 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 403.3 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 361.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 171.7 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 41.0 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Avenanthramide P,1TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O)=CC=C1O[Si](C)(C)C | 3631.8 | Semi standard non polar | 33892256 | | Avenanthramide P,1TMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C)C=C2C(=O)O)=CC=C1O | 3630.3 | Semi standard non polar | 33892256 | | Avenanthramide P,1TMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O[Si](C)(C)C)=CC=C1O | 3617.6 | Semi standard non polar | 33892256 | | Avenanthramide P,1TMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O)[Si](C)(C)C)=CC=C1O | 3519.3 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C)C=C2C(=O)O)=CC=C1O[Si](C)(C)C | 3648.6 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3627.6 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3505.6 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)=CC=C1O | 3637.2 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #5 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O)[Si](C)(C)C)=CC=C1O | 3490.0 | Semi standard non polar | 33892256 | | Avenanthramide P,2TMS,isomer #6 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O | 3443.5 | Semi standard non polar | 33892256 | | Avenanthramide P,3TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3672.7 | Semi standard non polar | 33892256 | | Avenanthramide P,3TMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3525.0 | Semi standard non polar | 33892256 | | Avenanthramide P,3TMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3465.2 | Semi standard non polar | 33892256 | | Avenanthramide P,3TMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O | 3464.3 | Semi standard non polar | 33892256 | | Avenanthramide P,4TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3530.6 | Semi standard non polar | 33892256 | | Avenanthramide P,4TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3276.8 | Standard non polar | 33892256 | | Avenanthramide P,4TMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C)C=C2C(=O)O[Si](C)(C)C)[Si](C)(C)C)=CC=C1O[Si](C)(C)C | 3693.4 | Standard polar | 33892256 | | Avenanthramide P,1TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O)=CC=C1O[Si](C)(C)C(C)(C)C | 3907.2 | Semi standard non polar | 33892256 | | Avenanthramide P,1TBDMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O)=CC=C1O | 3920.8 | Semi standard non polar | 33892256 | | Avenanthramide P,1TBDMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O[Si](C)(C)C(C)(C)C)=CC=C1O | 3883.7 | Semi standard non polar | 33892256 | | Avenanthramide P,1TBDMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O)[Si](C)(C)C(C)(C)C)=CC=C1O | 3816.3 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O)=CC=C1O[Si](C)(C)C(C)(C)C | 4171.7 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O)C=C2C(=O)O[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4122.7 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4052.5 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)=CC=C1O | 4131.8 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #5 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O)[Si](C)(C)C(C)(C)C)=CC=C1O | 4047.4 | Semi standard non polar | 33892256 | | Avenanthramide P,2TBDMS,isomer #6 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O | 4002.9 | Semi standard non polar | 33892256 | | Avenanthramide P,3TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)NC2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4368.6 | Semi standard non polar | 33892256 | | Avenanthramide P,3TBDMS,isomer #2 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4275.9 | Semi standard non polar | 33892256 | | Avenanthramide P,3TBDMS,isomer #3 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4204.9 | Semi standard non polar | 33892256 | | Avenanthramide P,3TBDMS,isomer #4 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O | 4195.3 | Semi standard non polar | 33892256 | | Avenanthramide P,4TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 4404.9 | Semi standard non polar | 33892256 | | Avenanthramide P,4TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 3934.4 | Standard non polar | 33892256 | | Avenanthramide P,4TBDMS,isomer #1 | COC1=CC(/C=C/C=C/C(=O)N(C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=CC=C1O[Si](C)(C)C(C)(C)C | 3903.5 | Standard polar | 33892256 |
|
|---|