| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.67 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.8916 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.42 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1317.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 233.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 81.2 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 179.8 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 87.9 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 288.4 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 312.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 475.6 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 682.6 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 318.0 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1027.8 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 212.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 237.6 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 468.8 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 260.2 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 144.8 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| O-Coumaric acid glucuronide,1TMS,isomer #1 | C[Si](C)(C)OC1C(C(=O)O)OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C1O | 3061.1 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TMS,isomer #2 | C[Si](C)(C)OC1C(O)C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C1O | 3052.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TMS,isomer #3 | C[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O)C1O | 3075.8 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TMS,isomer #4 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O)C1O | 3067.9 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TMS,isomer #5 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O)C1O | 3134.0 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O)C1O[Si](C)(C)C | 3000.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #10 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O)C(O)C1O | 3020.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C)C(O)C1O | 3045.5 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #3 | C[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O[Si](C)(C)C)C1O | 3025.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #4 | C[Si](C)(C)OC1C(C(=O)O)OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C1O[Si](C)(C)C | 3022.9 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #5 | C[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O)C1O[Si](C)(C)C | 3027.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #6 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O[Si](C)(C)C)C1O | 3056.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #7 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O[Si](C)(C)C)C1O | 2987.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #8 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O)C1O[Si](C)(C)C | 3057.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TMS,isomer #9 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C)C(O)C1O | 3005.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O | 2975.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #10 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C | 2984.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #2 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3000.0 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2969.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 3017.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #5 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 3038.5 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #6 | C[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3042.8 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #7 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3023.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #8 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2987.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TMS,isomer #9 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O | 2968.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2949.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 2991.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3004.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TMS,isomer #4 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2997.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TMS,isomer #5 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2958.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2966.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1C(C(=O)O)OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C1O | 3320.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1C(O)C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C1O | 3326.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O)C1O | 3341.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O)C1O | 3333.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O)C1O | 3396.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3495.0 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O | 3510.7 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3544.9 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C1O | 3504.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1C(C(=O)O)OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C1O[Si](C)(C)C(C)(C)C | 3496.1 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O)C1O[Si](C)(C)C(C)(C)C | 3513.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3555.0 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3492.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3553.8 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3491.8 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3660.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3659.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3664.1 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3644.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3693.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3708.8 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1C(OC2=CC=CC=C2C=CC(=O)O)OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3659.9 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3709.5 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3654.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3672.2 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3834.6 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3871.0 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C1OC(OC2=CC=CC=C2C=CC(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3803.4 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3849.3 | Semi standard non polar | 33892256 |
| O-Coumaric acid glucuronide,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)C=CC1=CC=CC=C1OC1OC(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3830.7 | Semi standard non polar | 33892256 |