| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2019-10-08 19:32:59 UTC |
|---|
| Update Date | 2022-03-07 03:18:18 UTC |
|---|
| HMDB ID | HMDB0240504 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Enterodiol sulfate |
|---|
| Description | Enterodiol sulfate belongs to the class of organic compounds known as dibenzylbutanediol lignans. These are lignan compounds containing a 2,3-dibenzylbutane-1,4-diol moiety. Based on a literature review a significant number of articles have been published on Enterodiol sulfate. |
|---|
| Structure | [H][C@@](CO)(CC1=CC(O)=CC=C1)[C@]([H])(CO)CC1=CC(OS(O)(=O)=O)=CC=C1 InChI=1S/C18H22O7S/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(10-14)25-26(22,23)24/h1-6,9-10,15-16,19-21H,7-8,11-12H2,(H,22,23,24)/t15-,16-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Enterodiol sulfuric acid | Generator | | Enterodiol sulphate | Generator | | Enterodiol sulphuric acid | Generator | | {3-[(2R,3R)-4-hydroxy-2-(hydroxymethyl)-3-[(3-hydroxyphenyl)methyl]butyl]phenyl}oxidanesulfonate | HMDB | | {3-[(2R,3R)-4-hydroxy-2-(hydroxymethyl)-3-[(3-hydroxyphenyl)methyl]butyl]phenyl}oxidanesulphonate | HMDB | | {3-[(2R,3R)-4-hydroxy-2-(hydroxymethyl)-3-[(3-hydroxyphenyl)methyl]butyl]phenyl}oxidanesulphonic acid | HMDB | | Enterodiol monosulfate | HMDB | | Enterodiol monosulphate | HMDB | | Enterodiol sulfate | HMDB |
|
|---|
| Chemical Formula | C18H22O7S |
|---|
| Average Molecular Weight | 382.43 |
|---|
| Monoisotopic Molecular Weight | 382.108624222 |
|---|
| IUPAC Name | {3-[(2R,3R)-4-hydroxy-2-(hydroxymethyl)-3-[(3-hydroxyphenyl)methyl]butyl]phenyl}oxidanesulfonic acid |
|---|
| Traditional Name | {3-[(2R,3R)-4-hydroxy-2-(hydroxymethyl)-3-[(3-hydroxyphenyl)methyl]butyl]phenyl}oxidanesulfonic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | [H][C@@](CO)(CC1=CC(O)=CC=C1)[C@]([H])(CO)CC1=CC(OS(O)(=O)=O)=CC=C1 |
|---|
| InChI Identifier | InChI=1S/C18H22O7S/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(10-14)25-26(22,23)24/h1-6,9-10,15-16,19-21H,7-8,11-12H2,(H,22,23,24)/t15-,16-/m0/s1 |
|---|
| InChI Key | QFWYXPNNPTWNSP-HOTGVXAUSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as dibenzylbutanediol lignans. These are lignan compounds containing a 2,3-dibenzylbutane-1,4-diol moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lignans, neolignans and related compounds |
|---|
| Class | Dibenzylbutane lignans |
|---|
| Sub Class | Dibenzylbutanediol lignans |
|---|
| Direct Parent | Dibenzylbutanediol lignans |
|---|
| Alternative Parents | |
|---|
| Substituents | - Dibenzylbutanediol
- Phenylsulfate
- Arylsulfate
- Phenoxy compound
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Benzenoid
- Sulfuric acid ester
- Sulfate-ester
- Sulfuric acid monoester
- Monocyclic benzene moiety
- Organic sulfuric acid or derivatives
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Primary alcohol
- Organooxygen compound
- Alcohol
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 6.27 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.6409 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.65 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1607.6 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 226.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 155.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 167.2 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 132.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 454.9 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 412.9 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 151.9 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 918.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 445.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1233.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 283.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 310.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 269.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 154.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 106.1 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Enterodiol sulfate,1TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3320.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TMS,isomer #2 | C[Si](C)(C)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(OS(=O)(=O)O)=C2)=C1 | 3311.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TMS,isomer #3 | C[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O)=C1)[C@H](CO)CC1=CC=CC(O)=C1 | 3314.9 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TMS,isomer #4 | C[Si](C)(C)OS(=O)(=O)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(O)=C2)=C1 | 3335.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3206.8 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #2 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3193.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #3 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3232.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #4 | C[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O)=C1)[C@H](CO)CC1=CC=CC(O[Si](C)(C)C)=C1 | 3205.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #5 | C[Si](C)(C)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C2)=C1 | 3271.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TMS,isomer #6 | C[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1)[C@H](CO)CC1=CC=CC(O)=C1 | 3227.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3167.6 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TMS,isomer #2 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3195.2 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TMS,isomer #3 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3162.8 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TMS,isomer #4 | C[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1)[C@H](CO)CC1=CC=CC(O[Si](C)(C)C)=C1 | 3195.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3165.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3286.3 | Standard non polar | 33892256 | | Enterodiol sulfate,4TMS,isomer #1 | C[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C)=C1)[C@H](CO[Si](C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C)=C1 | 3754.6 | Standard polar | 33892256 | | Enterodiol sulfate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3574.5 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(OS(=O)(=O)O)=C2)=C1 | 3572.9 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O)=C1)[C@H](CO)CC1=CC=CC(O)=C1 | 3568.6 | Semi standard non polar | 33892256 | | Enterodiol sulfate,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OS(=O)(=O)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(O)=C2)=C1 | 3547.3 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3702.8 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3695.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 3674.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O)=C1)[C@H](CO)CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1 | 3701.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=CC(C[C@@H](CO)[C@H](CO)CC2=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C2)=C1 | 3744.8 | Semi standard non polar | 33892256 | | Enterodiol sulfate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO)CC1=CC=CC(O)=C1 | 3671.4 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O)=C1 | 3866.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 3862.7 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 3781.5 | Semi standard non polar | 33892256 | | Enterodiol sulfate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO)CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1 | 3861.8 | Semi standard non polar | 33892256 | | Enterodiol sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 4027.1 | Semi standard non polar | 33892256 | | Enterodiol sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 4197.8 | Standard non polar | 33892256 | | Enterodiol sulfate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC[C@H](CC1=CC=CC(O[Si](C)(C)C(C)(C)C)=C1)[C@H](CO[Si](C)(C)C(C)(C)C)CC1=CC=CC(OS(=O)(=O)O[Si](C)(C)C(C)(C)C)=C1 | 3906.0 | Standard polar | 33892256 |
|
|---|