| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2019-10-08 19:15:40 UTC |
|---|
| Update Date | 2022-03-07 03:18:17 UTC |
|---|
| HMDB ID | HMDB0240497 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Dihydroisoferulic acid 3-glucuronide |
|---|
| Description | Dihydroisoferulic acid 3-glucuronide belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Based on a literature review very few articles have been published on Dihydroisoferulic acid 3-glucuronide. |
|---|
| Structure | [H][C@@]1(OC2=C(OC)C=CC(CCC(O)=O)=C2)O[C@]([H])(C(O)=O)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])O InChI=1S/C16H20O10/c1-24-8-4-2-7(3-5-10(17)18)6-9(8)25-16-13(21)11(19)12(20)14(26-16)15(22)23/h2,4,6,11-14,16,19-21H,3,5H2,1H3,(H,17,18)(H,22,23)/t11-,12-,13+,14-,16+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Dihydroisoferulate 3-glucuronide | Generator |
|
|---|
| Chemical Formula | C16H20O10 |
|---|
| Average Molecular Weight | 372.326 |
|---|
| Monoisotopic Molecular Weight | 372.105646844 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[5-(2-carboxyethyl)-2-methoxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-6-[5-(2-carboxyethyl)-2-methoxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | [H][C@@]1(OC2=C(OC)C=CC(CCC(O)=O)=C2)O[C@]([H])(C(O)=O)[C@@]([H])(O)[C@]([H])(O)[C@@]1([H])O |
|---|
| InChI Identifier | InChI=1S/C16H20O10/c1-24-8-4-2-7(3-5-10(17)18)6-9(8)25-16-13(21)11(19)12(20)14(26-16)15(22)23/h2,4,6,11-14,16,19-21H,3,5H2,1H3,(H,17,18)(H,22,23)/t11-,12-,13+,14-,16+/m0/s1 |
|---|
| InChI Key | OSJGZCUHTGTJHT-JHZZJYKESA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Phenolic glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Phenolic glycoside
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Hexose monosaccharide
- O-glycosyl compound
- 3-phenylpropanoic-acid
- Phenoxy compound
- Anisole
- Methoxybenzene
- Phenol ether
- Alkyl aryl ether
- Beta-hydroxy acid
- Oxane
- Pyran
- Dicarboxylic acid or derivatives
- Benzenoid
- Monosaccharide
- Hydroxy acid
- Monocyclic benzene moiety
- Secondary alcohol
- Ether
- Acetal
- Carboxylic acid
- Carboxylic acid derivative
- Organoheterocyclic compound
- Oxacycle
- Polyol
- Carbonyl group
- Hydrocarbon derivative
- Organic oxide
- Alcohol
- Aromatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aromatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.24 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.6103 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.43 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1158.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 221.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 84.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 178.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 63.3 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 280.9 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 323.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 488.5 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 662.3 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 325.5 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1013.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 224.4 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 231.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 490.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 293.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 262.1 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Dihydroisoferulic acid 3-glucuronide,1TMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 2982.4 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TMS,isomer #2 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 2997.8 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TMS,isomer #3 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3008.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TMS,isomer #4 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3003.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3006.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 2893.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #10 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2966.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 2921.4 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 2927.8 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 2923.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 2959.8 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #6 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 2951.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #7 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 2950.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #8 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 2976.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TMS,isomer #9 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 2987.5 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 2895.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #10 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2977.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 2909.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 2897.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 2914.7 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #5 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 2929.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #6 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2910.4 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #7 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 2975.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #8 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 2989.8 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TMS,isomer #9 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2961.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 2943.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 2970.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2935.7 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2926.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2995.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,5TMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 2987.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TBDMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 3275.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TBDMS,isomer #2 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3282.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TBDMS,isomer #3 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3257.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TBDMS,isomer #4 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3262.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,1TBDMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3268.5 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3461.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #10 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3442.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3460.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3464.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3472.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3473.7 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #6 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3465.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #7 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3480.3 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #8 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3437.5 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,2TBDMS,isomer #9 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3452.4 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3645.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #10 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3609.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3639.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3650.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3615.2 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #5 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3632.5 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #6 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3617.9 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #7 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3627.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #8 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3668.0 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,3TBDMS,isomer #9 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3625.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TBDMS,isomer #1 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3778.8 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TBDMS,isomer #2 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3819.6 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TBDMS,isomer #3 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3781.1 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TBDMS,isomer #4 | COC1=CC=C(CCC(=O)O[Si](C)(C)C(C)(C)C)C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3772.7 | Semi standard non polar | 33892256 | | Dihydroisoferulic acid 3-glucuronide,4TBDMS,isomer #5 | COC1=CC=C(CCC(=O)O)C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3833.5 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Dihydroisoferulic acid 3-glucuronide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 10V, Positive-QTOF | splash10-057i-0904000000-3215bc96fe32efb38321 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 20V, Positive-QTOF | splash10-004i-0901000000-181d2f5f6b76078a03df | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 40V, Positive-QTOF | splash10-01y9-0911000000-a5a34638d8bdf2f1a1f5 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 10V, Negative-QTOF | splash10-00di-0109000000-86512e870e928d78dfbc | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 20V, Negative-QTOF | splash10-0k92-4913000000-2eebe5a916eff531341e | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Dihydroisoferulic acid 3-glucuronide 40V, Negative-QTOF | splash10-0002-4911000000-21fde6321adc6ee457f6 | 2021-09-25 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Predicted 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-25 | Wishart Lab | View Spectrum |
|
|---|