| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2017-03-21 06:25:10 UTC |
|---|
| Update Date | 2022-09-22 18:34:29 UTC |
|---|
| HMDB ID | HMDB0062445 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | alpha-CEHC glucuronide |
|---|
| Description | alpha-CEHC glucuronide, also known as α-cehc glucuronide, belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. alpha-CEHC glucuronide has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make alpha-cehc glucuronide a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on alpha-CEHC glucuronide. |
|---|
| Structure | CC1=C(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)C(C)=C2CC[C@@](C)(CCC(O)=O)OC2=C1C InChI=1S/C22H30O10/c1-9-10(2)18-12(5-7-22(4,32-18)8-6-13(23)24)11(3)17(9)30-21-16(27)14(25)15(26)19(31-21)20(28)29/h14-16,19,21,25-27H,5-8H2,1-4H3,(H,23,24)(H,28,29)/t14-,15-,16+,19-,21+,22-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| a-CEHC glucuronide | Generator | | Α-cehc glucuronide | Generator | | α-Carboxyethyl hydrochroman glucuronide | HMDB | | alpha-Carboxyethyl hydrochroman glucuronide | HMDB |
|
|---|
| Chemical Formula | C22H30O10 |
|---|
| Average Molecular Weight | 454.472 |
|---|
| Monoisotopic Molecular Weight | 454.183897166 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-6-{[(2S)-2-(2-carboxyethyl)-2,5,7,8-tetramethyl-3,4-dihydro-2H-1-benzopyran-6-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-6-{[(2S)-2-(2-carboxyethyl)-2,5,7,8-tetramethyl-3,4-dihydro-1-benzopyran-6-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| CAS Registry Number | 477200-36-5 |
|---|
| SMILES | CC1=C(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)C(C)=C2CC[C@@](C)(CCC(O)=O)OC2=C1C |
|---|
| InChI Identifier | InChI=1S/C22H30O10/c1-9-10(2)18-12(5-7-22(4,32-18)8-6-13(23)24)11(3)17(9)30-21-16(27)14(25)15(26)19(31-21)20(28)29/h14-16,19,21,25-27H,5-8H2,1-4H3,(H,23,24)(H,28,29)/t14-,15-,16+,19-,21+,22-/m0/s1 |
|---|
| InChI Key | MWDYOFPRWKTECC-XOIOWARXSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Phenolic glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Phenolic glycoside
- O-glucuronide
- 1-o-glucuronide
- Glucuronic acid or derivatives
- Hexose monosaccharide
- O-glycosyl compound
- 1-benzopyran
- Benzopyran
- Chromane
- Beta-hydroxy acid
- Alkyl aryl ether
- Benzenoid
- Pyran
- Oxane
- Monosaccharide
- Hydroxy acid
- Dicarboxylic acid or derivatives
- Secondary alcohol
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Ether
- Carboxylic acid
- Carboxylic acid derivative
- Acetal
- Organic oxide
- Hydrocarbon derivative
- Carbonyl group
- Alcohol
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross Sections| Predictor | Adduct Type | CCS Value (Å2) | Reference |
|---|
| DeepCCS | [M+H]+ | 199.219 | 30932474 | | DeepCCS | [M-H]- | 197.326 | 30932474 | | DeepCCS | [M-2H]- | 230.589 | 30932474 | | DeepCCS | [M+Na]+ | 204.825 | 30932474 |
Predicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.75 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 12.5439 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.27 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1841.8 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 189.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 153.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 173.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 112.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 598.4 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 546.2 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 82.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 933.1 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 496.8 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1630.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 335.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 357.3 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 281.2 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 90.2 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 102.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| alpha-CEHC glucuronide,1TMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3421.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3412.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3427.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3417.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 3416.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3422.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #10 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3391.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3396.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3413.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3387.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3398.7 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #6 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3399.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #7 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3386.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #8 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3411.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TMS,isomer #9 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3395.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3411.1 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #10 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3411.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3440.1 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3407.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3410.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3385.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #6 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3403.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #7 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3404.4 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #8 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3389.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TMS,isomer #9 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3394.6 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,4TMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3458.4 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,4TMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3409.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,4TMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3444.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,4TMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3405.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,4TMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3415.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,5TMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3441.6 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TBDMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3666.6 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TBDMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3662.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TBDMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3679.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TBDMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3695.6 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,1TBDMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 3692.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3914.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #10 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3892.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3887.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3895.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3892.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3890.0 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #6 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3889.4 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #7 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3891.8 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #8 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3909.3 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,2TBDMS,isomer #9 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3907.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #1 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4103.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #10 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4105.7 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #2 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4140.7 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #3 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4088.2 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #4 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4112.4 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #5 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4074.7 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #6 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4093.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #7 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4101.9 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #8 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4073.5 | Semi standard non polar | 33892256 | | alpha-CEHC glucuronide,3TBDMS,isomer #9 | CC1=C(C)C2=C(CC[C@@](C)(CCC(=O)O[Si](C)(C)C(C)(C)C)O2)C(C)=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4080.0 | Semi standard non polar | 33892256 |
|
|---|