| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.84 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.7514 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.84 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 476.7 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 376.6 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 26.2 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 247.3 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 142.1 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 326.8 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 224.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 933.9 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 662.8 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 40.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 679.0 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 233.3 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 449.2 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 858.7 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 502.9 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 472.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Thioxanthine monophosphate,1TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O)C2=N1 | 2629.2 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S)N=C(O)N=C21 | 2728.3 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,1TMS,isomer #3 | C[Si](C)(C)SC1=NC(O)=NC2=C1N=CN2OP(=O)(O)O | 2627.5 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 2610.6 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 2612.5 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 3180.1 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 2439.4 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 2797.0 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 3649.9 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C | 2755.9 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C | 2641.2 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C | 3086.4 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21 | 2581.9 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21 | 2822.6 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21 | 3363.4 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 2643.6 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 2700.1 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #1 | C[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 2975.3 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 2460.2 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 2833.3 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #2 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C)C2=N1 | 3304.4 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21)O[Si](C)(C)C | 2566.7 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21)O[Si](C)(C)C | 2844.7 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C)N=C(O)N=C21)O[Si](C)(C)C | 3062.2 | Standard polar | 33892256 |
| Thioxanthine monophosphate,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 2569.3 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 2811.2 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,4TMS,isomer #1 | C[Si](C)(C)OC1=NC(S[Si](C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C2=N1 | 3026.8 | Standard polar | 33892256 |
| Thioxanthine monophosphate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O)C2=N1 | 2872.5 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S)N=C(O)N=C21 | 3018.6 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)SC1=NC(O)=NC2=C1N=CN2OP(=O)(O)O | 2879.5 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3057.6 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3050.8 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3369.5 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 2885.5 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 3251.9 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O)C2=N1 | 3684.1 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3249.6 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3055.3 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3271.6 | Standard polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21 | 3038.9 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21 | 3255.6 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21 | 3530.4 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3179.3 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3303.4 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3251.7 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3062.2 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3446.2 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O)O[Si](C)(C)C(C)(C)C)C2=N1 | 3519.9 | Standard polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3185.4 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3452.1 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(ON1C=NC2=C(S[Si](C)(C)C(C)(C)C)N=C(O)N=C21)O[Si](C)(C)C(C)(C)C | 3368.0 | Standard polar | 33892256 |
| Thioxanthine monophosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3270.4 | Semi standard non polar | 33892256 |
| Thioxanthine monophosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3552.4 | Standard non polar | 33892256 |
| Thioxanthine monophosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=NC(S[Si](C)(C)C(C)(C)C)=C2N=CN(OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C2=N1 | 3386.7 | Standard polar | 33892256 |