| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2013-05-17 01:24:38 UTC |
|---|
| Update Date | 2021-09-14 15:42:59 UTC |
|---|
| HMDB ID | HMDB0060491 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Mycophenolic acid O-acyl-glucuronide |
|---|
| Description | Mycophenolic acid O-acyl-glucuronide, also known as acmpag, belongs to the class of organic compounds known as o-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. Mycophenolic acid O-acyl-glucuronide is an extremely weak basic (essentially neutral) compound (based on its pKa). Within humans, mycophenolic acid O-acyl-glucuronide participates in a number of enzymatic reactions. In particular, mycophenolic acid O-acyl-glucuronide and uridine 5'-diphosphate can be biosynthesized from mycophenolic acid and uridine diphosphate glucuronic acid; which is catalyzed by the enzyme UDP-glucuronosyltransferase 2B7. In addition, mycophenolic acid O-acyl-glucuronide and uridine 5'-diphosphate can be biosynthesized from mycophenolic acid and uridine diphosphate glucuronic acid; which is mediated by the enzyme UDP-glucuronosyltransferase 2B7. Mycophenolic acid O-acyl-glucuronide is a metabolite of mycophenolate mofetil. In humans, mycophenolic acid O-acyl-glucuronide is involved in mycophenolic acid metabolism pathway. Other cells are able to recover purines via a separate, scavenger, pathway and are, thus, able to escape the effect. It is a reversible inhibitor of inosine monophosphate dehydrogenase (IMPDH) in purine biosynthesis which is necessary for the growth of T cells and B cells. MMF is a less toxic alternative to azathioprine. Mycophenolate mofetil (MMF) (brand names CellCept, Myfortic) is an immunosuppressant and prodrug of mycophenolic acid, used extensively in transplant medicine. |
|---|
| Structure | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C\C=C(/C)CCC(=O)O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O InChI=1S/C23H28O12/c1-9(4-6-11-15(25)14-12(8-33-22(14)31)10(2)19(11)32-3)5-7-13(24)34-23-18(28)16(26)17(27)20(35-23)21(29)30/h4,16-18,20,23,25-28H,5-8H2,1-3H3,(H,29,30)/b9-4+/t16-,17-,18+,20-,23+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| AcMPAG | ChEBI | | Mycophenolic acid acyl glucuronide | ChEBI | | Mycophenolic acid acyl-glucuronide | ChEBI | | Mycophenolic acid-O-acyl-beta-D-glucopyranuronoside | ChEBI | | Mycophenolate acyl glucuronide | Generator | | Mycophenolate acyl-glucuronide | Generator | | Mycophenolate-O-acyl-b-D-glucopyranuronoside | Generator | | Mycophenolate-O-acyl-beta-D-glucopyranuronoside | Generator | | Mycophenolate-O-acyl-β-D-glucopyranuronoside | Generator | | Mycophenolic acid-O-acyl-b-D-glucopyranuronoside | Generator | | Mycophenolic acid-O-acyl-β-D-glucopyranuronoside | Generator | | Mycophenolate O-acyl-glucuronide | Generator |
|
|---|
| Chemical Formula | C23H28O12 |
|---|
| Average Molecular Weight | 496.4612 |
|---|
| Monoisotopic Molecular Weight | 496.15807636 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1,3-dihydro-2-benzofuran-5-yl)-4-methylhex-4-enoyl]oxy}oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(4E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]oxy}oxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C\C=C(/C)CCC(=O)O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C23H28O12/c1-9(4-6-11-15(25)14-12(8-33-22(14)31)10(2)19(11)32-3)5-7-13(24)34-23-18(28)16(26)17(27)20(35-23)21(29)30/h4,16-18,20,23,25-28H,5-8H2,1-3H3,(H,29,30)/b9-4+/t16-,17-,18+,20-,23+/m0/s1 |
|---|
| InChI Key | QBMSTEZXAMABFF-UEARNRKISA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as o-glucuronides. These are glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | O-glucuronides |
|---|
| Alternative Parents | |
|---|
| Substituents | - 1-o-glucuronide
- O-glucuronide
- Isobenzofuranone
- Phthalide
- Isocoumaran
- Tricarboxylic acid or derivatives
- Anisole
- Alkyl aryl ether
- Beta-hydroxy acid
- Fatty acid ester
- Fatty acyl
- Hydroxy acid
- Benzenoid
- Monosaccharide
- Pyran
- Oxane
- Vinylogous acid
- Secondary alcohol
- Lactone
- Carboxylic acid ester
- Acetal
- Organoheterocyclic compound
- Ether
- Carboxylic acid
- Carboxylic acid derivative
- Oxacycle
- Polyol
- Carbonyl group
- Hydrocarbon derivative
- Organic oxide
- Alcohol
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 6.08 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 12.9613 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.88 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2443.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 185.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 136.1 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 157.1 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 89.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 458.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 525.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 109.8 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 970.9 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 491.6 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1491.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 330.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 375.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 267.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 144.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 59.1 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Mycophenolic acid O-acyl-glucuronide,1TMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 3718.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3701.5 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3689.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3698.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3681.2 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3696.4 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #10 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3667.9 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3712.2 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3697.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3705.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3678.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #6 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3676.4 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #7 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3692.4 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #8 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3657.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TMS,isomer #9 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3682.2 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3694.9 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #10 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3650.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3678.2 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3686.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3693.4 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3700.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #6 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3686.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #7 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3654.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #8 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3677.4 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TMS,isomer #9 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3679.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,4TMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3682.6 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,4TMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3699.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,4TMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3680.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,4TMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3689.9 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,4TMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3678.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,5TMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3697.2 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TBDMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O | 3955.5 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TBDMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3910.8 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TBDMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3901.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TBDMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3914.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,1TBDMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3907.8 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 4136.6 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #10 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4107.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4146.0 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4139.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4146.9 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4106.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #6 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4097.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #7 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4115.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #8 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4091.3 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,2TBDMS,isomer #9 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4105.6 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #1 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 4324.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #10 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4293.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #2 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4316.5 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #3 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4320.8 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #4 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4310.9 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #5 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4320.1 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #6 | COC1=C(C)C2=C(C(=O)OC2)C(O[Si](C)(C)C(C)(C)C)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4311.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #7 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4287.7 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #8 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4322.6 | Semi standard non polar | 33892256 | | Mycophenolic acid O-acyl-glucuronide,3TBDMS,isomer #9 | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1C/C=C(\C)CCC(=O)O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4302.4 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Mycophenolic acid O-acyl-glucuronide GC-MS (Non-derivatized) - 70eV, Positive | splash10-056r-9132400000-8d1d445b5c92387b8fdd | 2017-09-20 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Mycophenolic acid O-acyl-glucuronide GC-MS (2 TMS) - 70eV, Positive | splash10-004i-9807007000-7f6173b63131c0199045 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Mycophenolic acid O-acyl-glucuronide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Mycophenolic acid O-acyl-glucuronide GC-MS (TBDMS_3_6) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Mycophenolic acid O-acyl-glucuronide GC-MS ("Mycophenolic acid O-acyl-glucuronide,3TBDMS,#6" TMS) - 70eV, Positive | Not Available | 2021-10-14 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 10V, Positive-QTOF | splash10-0fi1-0539500000-bfc6fff89aeca9bc0aeb | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 20V, Positive-QTOF | splash10-0kk9-1898200000-2b4abbcf7a3d676e09ff | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 40V, Positive-QTOF | splash10-004i-3951000000-bf27b3a68a384eb61846 | 2016-06-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 10V, Negative-QTOF | splash10-0udi-1229400000-a00fd0b14652a8a073e4 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 20V, Negative-QTOF | splash10-0v00-3927200000-b03a15a97c3652e63eb5 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 40V, Negative-QTOF | splash10-0miy-9725000000-7d44f74d3818db669d41 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 10V, Positive-QTOF | splash10-0002-0032900000-688e9215c56e8c6bc792 | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 20V, Positive-QTOF | splash10-0a4i-0091000000-e2000425e22fefbd07ad | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 40V, Positive-QTOF | splash10-014j-0091100000-9d561f09ce0219cf3eaa | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 10V, Negative-QTOF | splash10-0002-0001900000-3a9bf5cebae751792dee | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 20V, Negative-QTOF | splash10-0ktb-2054900000-3d6868acf21096f78353 | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Mycophenolic acid O-acyl-glucuronide 40V, Negative-QTOF | splash10-052g-1192200000-4eb5e92df9f368cdbdd2 | 2021-10-12 | Wishart Lab | View Spectrum |
|
|---|