| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2012-09-12 03:42:51 UTC |
|---|
| Update Date | 2022-03-07 02:57:12 UTC |
|---|
| HMDB ID | HMDB0041787 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Urolithin B 3-O-glucuronide |
|---|
| Description | Urolithin B 3-O-glucuronide belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Based on a literature review very few articles have been published on Urolithin B 3-O-glucuronide. |
|---|
| Structure | O[C@@H]1[C@@H](O)[C@H](OC2=CC3=C(C=C2)C2=CC=CC=C2C(=O)O3)O[C@@H]([C@H]1O)C(O)=O InChI=1S/C19H16O9/c20-13-14(21)16(17(23)24)28-19(15(13)22)26-8-5-6-10-9-3-1-2-4-11(9)18(25)27-12(10)7-8/h1-7,13-16,19-22H,(H,23,24)/t13-,14-,15+,16-,19+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-({6-oxo-6H-benzo[c]chromen-3-yl}oxy)oxane-2-carboxylate | HMDB | | 3,4,5-trihydroxy-6-(6-oxo-6H-benzo[c]chromen-3-yl)oxyoxane-2-carboxylic acid | HMDB | | urolithin-3-glucuronide | HMDB | | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-({6-Oxo-6H-Benzo[C]Chromen-3-Yl}Oxy)Oxane-2-Carboxylic acid | HMDB |
|
|---|
| Chemical Formula | C19H16O9 |
|---|
| Average Molecular Weight | 388.3249 |
|---|
| Monoisotopic Molecular Weight | 388.07943211 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-({6-oxo-6H-benzo[c]chromen-3-yl}oxy)oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-({6-oxobenzo[c]chromen-3-yl}oxy)oxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | O[C@@H]1[C@@H](O)[C@H](OC2=CC3=C(C=C2)C2=CC=CC=C2C(=O)O3)O[C@@H]([C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C19H16O9/c20-13-14(21)16(17(23)24)28-19(15(13)22)26-8-5-6-10-9-3-1-2-4-11(9)18(25)27-12(10)7-8/h1-7,13-16,19-22H,(H,23,24)/t13-,14-,15+,16-,19+/m0/s1 |
|---|
| InChI Key | MHBWCULXQBVPQT-KSPMYQCISA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as phenolic glycosides. These are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Phenolic glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Phenolic glycoside
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Coumarin
- Isocoumarin
- O-glycosyl compound
- 2-benzopyran
- 1-benzopyran
- Benzopyran
- Pyranone
- Beta-hydroxy acid
- Benzenoid
- Pyran
- Oxane
- Hydroxy acid
- Monosaccharide
- Heteroaromatic compound
- Secondary alcohol
- Lactone
- Acetal
- Carboxylic acid
- Carboxylic acid derivative
- Polyol
- Oxacycle
- Organoheterocyclic compound
- Monocarboxylic acid or derivatives
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Carbonyl group
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.17 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.0186 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.84 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1642.5 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 226.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 120.4 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 184.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 74.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 343.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 377.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 202.9 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 618.1 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 410.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1366.4 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 237.5 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 268.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 407.5 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 253.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 140.1 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Urolithin B 3-O-glucuronide,1TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@H]1O | 3639.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O | 3649.8 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@H]1O | 3651.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O)[C@@H]1O | 3637.3 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@@H]1O[Si](C)(C)C | 3587.6 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3599.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@H]1O[Si](C)(C)C | 3574.6 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O | 3601.6 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C)[C@H]1O | 3593.7 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TMS,isomer #6 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3608.8 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C | 3594.5 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O | 3611.2 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3606.9 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C | 3618.0 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,4TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C | 3667.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@H]1O | 3925.7 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O | 3939.3 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@H]1O | 3916.0 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O)[C@@H]1O | 3935.1 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@@H]1O[Si](C)(C)C(C)(C)C | 4140.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4130.0 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4118.1 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4153.8 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4143.1 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4148.7 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C(C)(C)C | 4329.4 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4325.0 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4318.5 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4349.7 | Semi standard non polar | 33892256 | | Urolithin B 3-O-glucuronide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)OC(=O)C2=CC=CC=C23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4500.4 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Urolithin B 3-O-glucuronide GC-MS (Non-derivatized) - 70eV, Positive | splash10-0c00-9154000000-19aa225d277ec8d7b5d0 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Urolithin B 3-O-glucuronide GC-MS (4 TMS) - 70eV, Positive | splash10-03di-2022139000-70524de478491667ce5b | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Urolithin B 3-O-glucuronide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 10V, Positive-QTOF | splash10-03dr-0189000000-d7c82014c960ceb3b66e | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 20V, Positive-QTOF | splash10-03di-0191000000-f4d7d4e7955ef2a240d5 | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 40V, Positive-QTOF | splash10-03di-4590000000-2f2cb51b07aa49527a46 | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 10V, Negative-QTOF | splash10-01pc-0149000000-f0ed8cb967c76cf270cd | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 20V, Negative-QTOF | splash10-03di-1193000000-d2cad51c99ec4dae7285 | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 40V, Negative-QTOF | splash10-03di-3390000000-64e86588ba8459991889 | 2017-06-28 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 10V, Negative-QTOF | splash10-02vr-0329000000-0aee3fb317b2f54da1d0 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 20V, Negative-QTOF | splash10-03di-2092000000-16ebb008c8a7bf9f15bc | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 40V, Negative-QTOF | splash10-03e9-0970000000-5b73a2f2927b0db3eb74 | 2021-09-23 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 10V, Positive-QTOF | splash10-03dr-0097000000-bb09091b091b5c55cbf4 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 20V, Positive-QTOF | splash10-03di-0198000000-0a785c163bea8110f1c2 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Urolithin B 3-O-glucuronide 40V, Positive-QTOF | splash10-03di-3296000000-6406c245588442ea3ed2 | 2021-09-24 | Wishart Lab | View Spectrum |
|
|---|