| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-12 03:05:53 UTC |
|---|
| Update Date | 2022-03-07 02:57:00 UTC |
|---|
| HMDB ID | HMDB0041416 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Hydroxymyricanone |
|---|
| Description | Hydroxymyricanone belongs to the class of organic compounds known as meta,meta-bridged biphenyls. These are cyclic diarylheptanoids where the two aryl groups are linked to each other by an ether group conjugated to their 3-position. Hydroxymyricanone has been detected, but not quantified in, herbs and spices. This could make hydroxymyricanone a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Hydroxymyricanone. |
|---|
| Structure | COC1=C(O)C2=CC(=C1OC)C1=C(O)C=CC(CC(O)C(=O)CCCC2)=C1 InChI=1S/C21H24O6/c1-26-20-15-11-13(19(25)21(20)27-2)5-3-4-6-17(23)18(24)10-12-7-8-16(22)14(15)9-12/h7-9,11,18,22,24-25H,3-6,10H2,1-2H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 12-Hydroxymyricanone | HMDB |
|
|---|
| Chemical Formula | C21H24O6 |
|---|
| Average Molecular Weight | 372.4117 |
|---|
| Monoisotopic Molecular Weight | 372.1572885 |
|---|
| IUPAC Name | 3,8,15-trihydroxy-16,17-dimethoxytricyclo[12.3.1.1²,⁶]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
|---|
| Traditional Name | 3,8,15-trihydroxy-16,17-dimethoxytricyclo[12.3.1.1²,⁶]nonadeca-1(17),2,4,6(19),14(18),15-hexaen-9-one |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=C(O)C2=CC(=C1OC)C1=C(O)C=CC(CC(O)C(=O)CCCC2)=C1 |
|---|
| InChI Identifier | InChI=1S/C21H24O6/c1-26-20-15-11-13(19(25)21(20)27-2)5-3-4-6-17(23)18(24)10-12-7-8-16(22)14(15)9-12/h7-9,11,18,22,24-25H,3-6,10H2,1-2H3 |
|---|
| InChI Key | MZTZAESUYFUQBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as meta,meta-bridged biphenyls. These are cyclic diarylheptanoids where the two aryl groups are linked to each other by an ether group conjugated to their 3-position. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Diarylheptanoids |
|---|
| Sub Class | Cyclic diarylheptanoids |
|---|
| Direct Parent | Meta,meta-bridged biphenyls |
|---|
| Alternative Parents | |
|---|
| Substituents | - Meta,meta-bridged biphenyl
- Anisole
- 1-hydroxy-2-unsubstituted benzenoid
- Alkyl aryl ether
- Benzenoid
- Ketone
- Cyclic ketone
- Secondary alcohol
- Ether
- Polyol
- Hydrocarbon derivative
- Alcohol
- Carbonyl group
- Organic oxide
- Organooxygen compound
- Organic oxygen compound
- Aromatic homopolycyclic compound
|
|---|
| Molecular Framework | Aromatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.65 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.8075 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 1.8 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2218.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 201.9 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 179.4 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 163.2 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 153.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 615.6 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 502.2 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 156.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 973.1 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 487.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1306.3 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 324.3 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 408.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 285.5 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 188.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 41.2 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Hydroxymyricanone,1TMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3331.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TMS,isomer #2 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3310.3 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TMS,isomer #3 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3289.6 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TMS,isomer #4 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3228.6 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TMS,isomer #5 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3289.2 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3266.6 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #2 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3283.8 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #3 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3229.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #4 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3259.4 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #5 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3242.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #6 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3230.8 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #7 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3224.3 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #8 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3235.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TMS,isomer #9 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3233.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3238.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #2 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3233.4 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #3 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C)=C1OC | 3219.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #4 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3223.6 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #5 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3211.1 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #6 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3255.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TMS,isomer #7 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O)=C1OC | 3208.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TMS,isomer #1 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3270.8 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TMS,isomer #1 | COC1=C2C=C(CCCCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3242.8 | Standard non polar | 33892256 | | Hydroxymyricanone,4TMS,isomer #2 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3215.4 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TMS,isomer #2 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)CC3=CC2=C(O[Si](C)(C)C)C=C3)C(O[Si](C)(C)C)=C1OC | 3132.6 | Standard non polar | 33892256 | | Hydroxymyricanone,1TBDMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3554.0 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TBDMS,isomer #2 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3535.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TBDMS,isomer #3 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3526.6 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TBDMS,isomer #4 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3534.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,1TBDMS,isomer #5 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3548.0 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3689.2 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #2 | COC1=C2C=C(CCCCC(=O)C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3706.4 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #3 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3691.3 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #4 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3700.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #5 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3668.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #6 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3680.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #7 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3705.0 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #8 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3733.0 | Semi standard non polar | 33892256 | | Hydroxymyricanone,2TBDMS,isomer #9 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O)=C1OC | 3685.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #1 | COC1=C2C=C(CCCCC(=O)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3854.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #2 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3869.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #3 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3807.3 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #4 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3843.9 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #5 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3838.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #6 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3869.5 | Semi standard non polar | 33892256 | | Hydroxymyricanone,3TBDMS,isomer #7 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O)=C1OC | 3830.7 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TBDMS,isomer #1 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 4006.3 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TBDMS,isomer #1 | COC1=C2C=C(CCCCC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3846.6 | Standard non polar | 33892256 | | Hydroxymyricanone,4TBDMS,isomer #2 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3963.1 | Semi standard non polar | 33892256 | | Hydroxymyricanone,4TBDMS,isomer #2 | COC1=C2C=C(CCCC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC3=CC2=C(O[Si](C)(C)C(C)(C)C)C=C3)C(O[Si](C)(C)C(C)(C)C)=C1OC | 3706.7 | Standard non polar | 33892256 |
|
|---|