| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 23:34:12 UTC |
|---|
| Update Date | 2022-03-07 02:55:42 UTC |
|---|
| HMDB ID | HMDB0038286 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Eujambin |
|---|
| Description | Eujambin belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Eujambin has been detected, but not quantified in, fruits. This could make eujambin a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Eujambin. |
|---|
| Structure | CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C(O)=C2)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1OC(C)=O InChI=1S/C30H26O17/c1-9-25(44-10(2)31)24(41)28(46-29(42)12-5-17(36)22(39)18(37)6-12)30(43-9)47-27-23(40)20-14(33)7-13(32)8-19(20)45-26(27)11-3-15(34)21(38)16(35)4-11/h3-9,24-25,28,30,32-39,41H,1-2H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 5-(Acetyloxy)-2-{[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy}-4-hydroxy-6-methyloxan-3-yl 3,4,5-trihydroxybenzoic acid | Generator |
|
|---|
| Chemical Formula | C30H26O17 |
|---|
| Average Molecular Weight | 658.5172 |
|---|
| Monoisotopic Molecular Weight | 658.116999406 |
|---|
| IUPAC Name | 5-(acetyloxy)-2-{[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy}-4-hydroxy-6-methyloxan-3-yl 3,4,5-trihydroxybenzoate |
|---|
| Traditional Name | 5-(acetyloxy)-2-{[5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)chromen-3-yl]oxy}-4-hydroxy-6-methyloxan-3-yl 3,4,5-trihydroxybenzoate |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CC1OC(OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC(O)=C(O)C(O)=C2)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C(O)C1OC(C)=O |
|---|
| InChI Identifier | InChI=1S/C30H26O17/c1-9-25(44-10(2)31)24(41)28(46-29(42)12-5-17(36)22(39)18(37)6-12)30(43-9)47-27-23(40)20-14(33)7-13(32)8-19(20)45-26(27)11-3-15(34)21(38)16(35)4-11/h3-9,24-25,28,30,32-39,41H,1-2H3 |
|---|
| InChI Key | PYGGSPJDJQBCNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as flavonoid-3-o-glycosides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Flavonoids |
|---|
| Sub Class | Flavonoid glycosides |
|---|
| Direct Parent | Flavonoid-3-O-glycosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Flavonoid-3-o-glycoside
- Hydroxyflavonoid
- 3'-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 5-hydroxyflavonoid
- 7-hydroxyflavonoid
- Flavone
- Galloyl ester
- Hexose monosaccharide
- Gallic acid or derivatives
- Chromone
- P-hydroxybenzoic acid ester
- M-hydroxybenzoic acid ester
- P-hydroxybenzoic acid alkyl ester
- Glycosyl compound
- O-glycosyl compound
- Benzopyran
- 1-benzopyran
- Benzoate ester
- Benzenetriol
- Pyrogallol derivative
- Benzoic acid or derivatives
- Benzoyl
- Phenol
- Pyranone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Oxane
- Monosaccharide
- Monocyclic benzene moiety
- Pyran
- Benzenoid
- Dicarboxylic acid or derivatives
- Heteroaromatic compound
- Vinylogous acid
- Secondary alcohol
- Carboxylic acid ester
- Acetal
- Organoheterocyclic compound
- Oxacycle
- Polyol
- Carboxylic acid derivative
- Organooxygen compound
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.68 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.2 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.07 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2437.1 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 153.9 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 90.7 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 110.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 109.8 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 710.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 529.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 476.9 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 845.0 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 478.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1982.3 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 326.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 413.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 412.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 274.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 407.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Eujambin,1TMS,isomer #1 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5798.7 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #2 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5749.3 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #3 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5719.0 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #4 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5711.4 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #5 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5732.2 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #6 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5729.1 | Semi standard non polar | 33892256 | | Eujambin,1TMS,isomer #7 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5784.1 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #1 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5577.1 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #10 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5531.4 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #11 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5614.7 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #12 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5542.7 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #13 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5500.2 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #14 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5520.9 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #15 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5503.9 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #16 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5569.8 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #17 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5483.9 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #18 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5500.1 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #19 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5547.4 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #2 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5545.9 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #20 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5561.0 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #21 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5509.0 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #22 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5576.6 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #23 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O[Si](C)(C)C | 5563.0 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #3 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5594.6 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #4 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5580.4 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #5 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5561.6 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #6 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5659.9 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #7 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5541.6 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #8 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5515.5 | Semi standard non polar | 33892256 | | Eujambin,2TMS,isomer #9 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5546.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #1 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5446.8 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #10 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5456.6 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #11 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5437.8 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #12 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5416.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #13 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5509.0 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #14 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5455.4 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #15 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5431.9 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #16 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5476.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #17 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O[Si](C)(C)C | 5467.9 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #18 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5408.0 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #19 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5386.5 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #2 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5424.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #20 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5358.5 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #21 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5334.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #22 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5436.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #23 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5324.8 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #24 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5294.9 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #25 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5421.6 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #26 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5420.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #27 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5395.5 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #28 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5438.8 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #29 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O[Si](C)(C)C | 5435.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #3 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5438.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #30 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5424.9 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #31 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5362.5 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #32 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5351.3 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #33 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5449.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #34 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5342.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #35 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5327.0 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #36 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5420.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #37 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5371.0 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #38 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5347.3 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #39 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5401.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #4 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5388.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #40 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O[Si](C)(C)C | 5383.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #41 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5344.4 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #42 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5320.5 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #43 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5369.9 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #44 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O[Si](C)(C)C | 5362.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #45 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O | 5431.7 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #46 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5459.0 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #47 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C1O[Si](C)(C)C | 5428.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #5 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5361.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #6 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C | 5476.4 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #7 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5407.2 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #8 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)C1O | 5351.1 | Semi standard non polar | 33892256 | | Eujambin,3TMS,isomer #9 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)C1O | 5329.7 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #1 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5976.4 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #2 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5950.0 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #3 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5931.0 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #4 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5938.0 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #5 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5941.6 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #6 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O | 5959.3 | Semi standard non polar | 33892256 | | Eujambin,1TBDMS,isomer #7 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 5996.9 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #1 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5992.8 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #10 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O | 5964.0 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #11 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 6007.0 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #12 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5963.6 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #13 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5938.4 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #14 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5930.6 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #15 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O | 5928.5 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #16 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 5983.8 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #17 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5910.9 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #18 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O | 5944.4 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #19 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 5980.1 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #2 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5978.2 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #20 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5988.2 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #21 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5952.4 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #22 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O[Si](C)(C)C(C)(C)C | 5992.5 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #23 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 6000.4 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #3 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5996.9 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #4 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 6002.0 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #5 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C1O | 5999.8 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #6 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O[Si](C)(C)C(C)(C)C | 6050.1 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #7 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5950.0 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #8 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O)=C2)C1O | 5941.6 | Semi standard non polar | 33892256 | | Eujambin,2TBDMS,isomer #9 | CC(=O)OC1C(C)OC(OC2=C(C3=CC(O)=C(O)C(O)=C3)OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C2=O)C(OC(=O)C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C1O | 5959.0 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (Non-derivatized) - 70eV, Positive | splash10-002f-8906551000-771cbb906f98f4317d71 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_1) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_2) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_3) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_4) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_5) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_6) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_1_7) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_1) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_2) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_3) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_4) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_5) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_6) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_7) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_8) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_9) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_10) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_11) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_12) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_13) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_14) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_15) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_16) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Eujambin GC-MS (TMS_2_17) - 70eV, Positive | Not Available | 2021-10-17 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 10V, Positive-QTOF | splash10-0gb9-0309214000-e83d650f3d370459bdb9 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 20V, Positive-QTOF | splash10-0gb9-0209000000-75f127c38d9996e474c7 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 40V, Positive-QTOF | splash10-0uxr-1917000000-790126eb85cde06a68d9 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 10V, Negative-QTOF | splash10-066r-3818329000-1434b9a47ad8afae8c73 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 20V, Negative-QTOF | splash10-014i-3938201000-4e2ae1ff674522a9efd6 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 40V, Negative-QTOF | splash10-0690-3922000000-14dcf69a8a8ece74d667 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 10V, Negative-QTOF | splash10-0a4i-0000009000-2cae8c95cd8d744a1f14 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 20V, Negative-QTOF | splash10-0a4i-0300009000-77aa9b30b6966afffd0b | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 40V, Negative-QTOF | splash10-0ukc-2910123000-72fe9c15641a0a1a9cd5 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 10V, Positive-QTOF | splash10-0a4i-0000009000-b3726c9652edce7d0aa2 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 20V, Positive-QTOF | splash10-0a4i-0000009000-04bfdfc58a47925087b8 | 2021-09-24 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Eujambin 40V, Positive-QTOF | splash10-0zfr-2900035000-ee3ab6cefbd364ee95e4 | 2021-09-24 | Wishart Lab | View Spectrum |
|
|---|