| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 0.83 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.8962 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.66 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 411.4 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 424.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 330.0 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 37.7 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 213.7 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 92.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 278.4 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 217.4 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 929.6 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 565.7 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 39.3 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 651.7 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 211.7 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 338.9 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 740.1 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 606.0 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 415.8 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| D-Asparagine,1TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H](N)CC(N)=O | 1480.3 | Semi standard non polar | 33892256 |
| D-Asparagine,1TMS,isomer #2 | C[Si](C)(C)N[C@H](CC(N)=O)C(=O)O | 1554.1 | Semi standard non polar | 33892256 |
| D-Asparagine,1TMS,isomer #3 | C[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O | 1575.0 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #1 | C[Si](C)(C)N[C@H](CC(N)=O)C(=O)O[Si](C)(C)C | 1577.0 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #1 | C[Si](C)(C)N[C@H](CC(N)=O)C(=O)O[Si](C)(C)C | 1579.7 | Standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #2 | C[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O[Si](C)(C)C | 1552.7 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #2 | C[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O[Si](C)(C)C | 1668.8 | Standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #3 | C[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C)C(=O)O | 1647.5 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #3 | C[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C)C(=O)O | 1676.0 | Standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #4 | C[Si](C)(C)N([C@H](CC(N)=O)C(=O)O)[Si](C)(C)C | 1734.3 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #4 | C[Si](C)(C)N([C@H](CC(N)=O)C(=O)O)[Si](C)(C)C | 1633.9 | Standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #5 | C[Si](C)(C)N(C(=O)C[C@@H](N)C(=O)O)[Si](C)(C)C | 1715.3 | Semi standard non polar | 33892256 |
| D-Asparagine,2TMS,isomer #5 | C[Si](C)(C)N(C(=O)C[C@@H](N)C(=O)O)[Si](C)(C)C | 1689.0 | Standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #1 | C[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1668.6 | Semi standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #1 | C[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1696.3 | Standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](CC(N)=O)N([Si](C)(C)C)[Si](C)(C)C | 1729.5 | Semi standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](CC(N)=O)N([Si](C)(C)C)[Si](C)(C)C | 1687.5 | Standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](N)CC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1670.2 | Semi standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](N)CC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1739.7 | Standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #4 | C[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1749.3 | Semi standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #4 | C[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1717.5 | Standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #5 | C[Si](C)(C)NC(=O)C[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1799.7 | Semi standard non polar | 33892256 |
| D-Asparagine,3TMS,isomer #5 | C[Si](C)(C)NC(=O)C[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1755.2 | Standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #1 | C[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1767.5 | Semi standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #1 | C[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1789.1 | Standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #2 | C[Si](C)(C)NC(=O)C[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1813.2 | Semi standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #2 | C[Si](C)(C)NC(=O)C[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1800.9 | Standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #3 | C[Si](C)(C)N(C(=O)C[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1878.6 | Semi standard non polar | 33892256 |
| D-Asparagine,4TMS,isomer #3 | C[Si](C)(C)N(C(=O)C[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1849.9 | Standard non polar | 33892256 |
| D-Asparagine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1952.7 | Semi standard non polar | 33892256 |
| D-Asparagine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](CC(=O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1906.5 | Standard non polar | 33892256 |
| D-Asparagine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CC(N)=O | 1705.2 | Semi standard non polar | 33892256 |
| D-Asparagine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@H](CC(N)=O)C(=O)O | 1796.6 | Semi standard non polar | 33892256 |
| D-Asparagine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O | 1813.3 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CC(N)=O)C(=O)O[Si](C)(C)C(C)(C)C | 2018.7 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CC(N)=O)C(=O)O[Si](C)(C)C(C)(C)C | 1977.5 | Standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 1995.6 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 2045.0 | Standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O | 2106.3 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O | 2028.6 | Standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N([C@H](CC(N)=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2171.1 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N([C@H](CC(N)=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2037.3 | Standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(=O)C[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C | 2124.3 | Semi standard non polar | 33892256 |
| D-Asparagine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(=O)C[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C | 2100.7 | Standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2297.4 | Semi standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)C[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2256.1 | Standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CC(N)=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2388.8 | Semi standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CC(N)=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2311.7 | Standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2310.9 | Semi standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2364.2 | Standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2394.3 | Semi standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2325.7 | Standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=O)C[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2435.4 | Semi standard non polar | 33892256 |
| D-Asparagine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=O)C[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2322.4 | Standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2591.2 | Semi standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2534.1 | Standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)C[C@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2641.7 | Semi standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)C[C@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2528.0 | Standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)C[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2730.7 | Semi standard non polar | 33892256 |
| D-Asparagine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)C[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2606.8 | Standard non polar | 33892256 |
| D-Asparagine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2942.3 | Semi standard non polar | 33892256 |
| D-Asparagine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2795.8 | Standard non polar | 33892256 |