| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:53:15 UTC |
|---|
| Update Date | 2022-03-07 02:53:33 UTC |
|---|
| HMDB ID | HMDB0033014 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Hovenitin I |
|---|
| Description | Hovenitin I belongs to the class of organic compounds known as oxanes. Oxanes are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. Based on a literature review very few articles have been published on Hovenitin I. |
|---|
| Structure | COC1=C(O)C(O)=CC(=C1)C1OC2=CC(O)=CC(O)=C2C(=O)C1O InChI=1S/C16H14O8/c1-23-11-3-6(2-9(19)13(11)20)16-15(22)14(21)12-8(18)4-7(17)5-10(12)24-16/h2-5,15-20,22H,1H3 |
|---|
| Synonyms | | Value | Source |
|---|
| 5,7,4',5'-Tetrahydroxy-3'-methoxydihydroflavonol | MeSH | | Hovenitin II | MeSH | | (2R,3R)-3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone | HMDB | | 3,4',5,5',7-Pentahydroxy-3'-methoxyflavanone | HMDB | | 4',5,5',7-Tetrahydroxy-3'-methoxydihydroflavonol | HMDB | | Hovenitin I | MeSH |
|
|---|
| Chemical Formula | C16H14O8 |
|---|
| Average Molecular Weight | 334.2776 |
|---|
| Monoisotopic Molecular Weight | 334.068867424 |
|---|
| IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-4-one |
|---|
| Traditional Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-2,3-dihydro-1-benzopyran-4-one |
|---|
| CAS Registry Number | 71106-82-6 |
|---|
| SMILES | COC1=C(O)C(O)=CC(=C1)C1OC2=CC(O)=CC(O)=C2C(=O)C1O |
|---|
| InChI Identifier | InChI=1S/C16H14O8/c1-23-11-3-6(2-9(19)13(11)20)16-15(22)14(21)12-8(18)4-7(17)5-10(12)24-16/h2-5,15-20,22H,1H3 |
|---|
| InChI Key | MIEZPHMCERQLMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as oxanes. Oxanes are compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Oxanes |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Oxanes |
|---|
| Alternative Parents | |
|---|
| Substituents | - Oxane
- Cyclic alcohol
- Secondary alcohol
- Oxacycle
- Ether
- Dialkyl ether
- Organic oxygen compound
- Hydrocarbon derivative
- Organooxygen compound
- Alcohol
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 41550 mg/L @ 25 °C (est) | The Good Scents Company Information System | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.14 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.5696 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.3 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1547.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 204.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 89.0 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 141.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 68.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 449.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 381.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 356.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 663.3 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 306.4 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1152.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 237.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 271.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 499.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 363.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 296.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Hovenitin I,1TMS,isomer #1 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C | 3285.5 | Semi standard non polar | 33892256 | | Hovenitin I,1TMS,isomer #2 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O | 3337.0 | Semi standard non polar | 33892256 | | Hovenitin I,1TMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O)=C1O | 3333.0 | Semi standard non polar | 33892256 | | Hovenitin I,1TMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O)=C1O | 3317.7 | Semi standard non polar | 33892256 | | Hovenitin I,1TMS,isomer #5 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O | 3255.2 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C | 3205.4 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #10 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O | 3172.2 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #2 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C | 3186.1 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #3 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3127.5 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3143.8 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #5 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O | 3207.5 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #6 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O | 3207.1 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #7 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3134.8 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #8 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O)=C1O | 3186.7 | Semi standard non polar | 33892256 | | Hovenitin I,2TMS,isomer #9 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O | 3096.6 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C | 3131.2 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #10 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O | 3023.2 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #2 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3033.2 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3097.5 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3064.2 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #5 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3087.4 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #6 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3035.0 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #7 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O | 3148.1 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #8 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3034.5 | Semi standard non polar | 33892256 | | Hovenitin I,3TMS,isomer #9 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3060.2 | Semi standard non polar | 33892256 | | Hovenitin I,4TMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3050.0 | Semi standard non polar | 33892256 | | Hovenitin I,4TMS,isomer #2 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3093.5 | Semi standard non polar | 33892256 | | Hovenitin I,4TMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3010.9 | Semi standard non polar | 33892256 | | Hovenitin I,4TMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3019.7 | Semi standard non polar | 33892256 | | Hovenitin I,4TMS,isomer #5 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3044.5 | Semi standard non polar | 33892256 | | Hovenitin I,5TMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C(=O)C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3046.6 | Semi standard non polar | 33892256 | | Hovenitin I,1TBDMS,isomer #1 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3556.7 | Semi standard non polar | 33892256 | | Hovenitin I,1TBDMS,isomer #2 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3600.5 | Semi standard non polar | 33892256 | | Hovenitin I,1TBDMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O)=C1O | 3586.4 | Semi standard non polar | 33892256 | | Hovenitin I,1TBDMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O)=C1O | 3587.6 | Semi standard non polar | 33892256 | | Hovenitin I,1TBDMS,isomer #5 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3556.4 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3712.7 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #10 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3702.5 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #2 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3708.6 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #3 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3663.6 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3701.8 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #5 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3742.9 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #6 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3728.9 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #7 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3682.4 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #8 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O)=C1O | 3710.1 | Semi standard non polar | 33892256 | | Hovenitin I,2TBDMS,isomer #9 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3638.6 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3857.6 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #10 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3786.1 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #2 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3784.3 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3852.0 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3801.0 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #5 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3843.7 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #6 | COC1=CC(C2OC3=CC(O)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3780.3 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #7 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3867.6 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #8 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3790.3 | Semi standard non polar | 33892256 | | Hovenitin I,3TBDMS,isomer #9 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3798.0 | Semi standard non polar | 33892256 | | Hovenitin I,4TBDMS,isomer #1 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3955.3 | Semi standard non polar | 33892256 | | Hovenitin I,4TBDMS,isomer #2 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3977.5 | Semi standard non polar | 33892256 | | Hovenitin I,4TBDMS,isomer #3 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3922.5 | Semi standard non polar | 33892256 | | Hovenitin I,4TBDMS,isomer #4 | COC1=CC(C2OC3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3922.0 | Semi standard non polar | 33892256 | | Hovenitin I,4TBDMS,isomer #5 | COC1=CC(C2OC3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C(=O)C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3954.5 | Semi standard non polar | 33892256 |
|
|---|