| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 17:39:35 UTC |
|---|
| Update Date | 2022-03-07 02:52:44 UTC |
|---|
| HMDB ID | HMDB0030883 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Leptophylloside |
|---|
| Description | Leptophylloside, also known as isorutarin, belongs to the class of organic compounds known as psoralens. These are organic compounds containing a psoralen moiety, which consists of a furan fused to a chromenone to for 7H-furo[3,2-g]chromen-7-one. Based on a literature review very few articles have been published on Leptophylloside. |
|---|
| Structure | CC(C)(OC1OC(CO)C(O)C(O)C1O)C1CC2=C(O1)C(O)=C1OC(=O)C=CC1=C2 InChI=1S/C20H24O10/c1-20(2,30-19-15(25)14(24)13(23)10(7-21)27-19)11-6-9-5-8-3-4-12(22)29-17(8)16(26)18(9)28-11/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3 |
|---|
| Synonyms | | Value | Source |
|---|
| Isorutarin | HMDB |
|
|---|
| Chemical Formula | C20H24O10 |
|---|
| Average Molecular Weight | 424.3986 |
|---|
| Monoisotopic Molecular Weight | 424.136946988 |
|---|
| IUPAC Name | 9-hydroxy-2-(2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propan-2-yl)-2H,3H,7H-furo[3,2-g]chromen-7-one |
|---|
| Traditional Name | 9-hydroxy-2-(2-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propan-2-yl)-2H,3H-furo[3,2-g]chromen-7-one |
|---|
| CAS Registry Number | 53846-51-8 |
|---|
| SMILES | CC(C)(OC1OC(CO)C(O)C(O)C1O)C1CC2=C(O1)C(O)=C1OC(=O)C=CC1=C2 |
|---|
| InChI Identifier | InChI=1S/C20H24O10/c1-20(2,30-19-15(25)14(24)13(23)10(7-21)27-19)11-6-9-5-8-3-4-12(22)29-17(8)16(26)18(9)28-11/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3 |
|---|
| InChI Key | QZUDEXAHKXCIDG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as psoralens. These are organic compounds containing a psoralen moiety, which consists of a furan fused to a chromenone to for 7H-furo[3,2-g]chromen-7-one. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Coumarins and derivatives |
|---|
| Sub Class | Furanocoumarins |
|---|
| Direct Parent | Psoralens |
|---|
| Alternative Parents | |
|---|
| Substituents | - Psoralen
- Hexose monosaccharide
- O-glycosyl compound
- Glycosyl compound
- Benzopyran
- 1-benzopyran
- Coumaran
- 1-hydroxy-4-unsubstituted benzenoid
- Alkyl aryl ether
- Pyranone
- Pyran
- Monosaccharide
- Oxane
- Benzenoid
- Heteroaromatic compound
- Secondary alcohol
- Lactone
- Acetal
- Ether
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Hydrocarbon derivative
- Alcohol
- Organic oxygen compound
- Primary alcohol
- Organic oxide
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 275 - 276 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 5761 mg/L @ 25 °C (est) | The Good Scents Company Information System | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.58 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.6267 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.36 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 141.5 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1523.3 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 206.4 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 109.9 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 177.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 59.7 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 352.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 364.2 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 388.1 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 657.4 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 252.6 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1102.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 202.5 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 252.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 366.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 415.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 106.5 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Leptophylloside,1TMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3665.0 | Semi standard non polar | 33892256 | | Leptophylloside,1TMS,isomer #2 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3656.8 | Semi standard non polar | 33892256 | | Leptophylloside,1TMS,isomer #3 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3676.7 | Semi standard non polar | 33892256 | | Leptophylloside,1TMS,isomer #4 | CC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3640.8 | Semi standard non polar | 33892256 | | Leptophylloside,1TMS,isomer #5 | CC(C)(OC1OC(CO)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3717.0 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3561.9 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #10 | CC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3586.8 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3598.2 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3541.0 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3594.5 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #5 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3588.3 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #6 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3570.0 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #7 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3599.1 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #8 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3606.3 | Semi standard non polar | 33892256 | | Leptophylloside,2TMS,isomer #9 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3613.2 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3525.4 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #10 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3534.1 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3498.5 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3508.1 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3519.9 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #5 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3528.9 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #6 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3487.7 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #7 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3531.2 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #8 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3523.7 | Semi standard non polar | 33892256 | | Leptophylloside,3TMS,isomer #9 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3521.6 | Semi standard non polar | 33892256 | | Leptophylloside,4TMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3476.1 | Semi standard non polar | 33892256 | | Leptophylloside,4TMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3465.2 | Semi standard non polar | 33892256 | | Leptophylloside,4TMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3439.5 | Semi standard non polar | 33892256 | | Leptophylloside,4TMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3461.4 | Semi standard non polar | 33892256 | | Leptophylloside,4TMS,isomer #5 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3467.0 | Semi standard non polar | 33892256 | | Leptophylloside,5TMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C)=C2O1 | 3409.3 | Semi standard non polar | 33892256 | | Leptophylloside,1TBDMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3892.6 | Semi standard non polar | 33892256 | | Leptophylloside,1TBDMS,isomer #2 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3909.9 | Semi standard non polar | 33892256 | | Leptophylloside,1TBDMS,isomer #3 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3916.0 | Semi standard non polar | 33892256 | | Leptophylloside,1TBDMS,isomer #4 | CC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 3892.0 | Semi standard non polar | 33892256 | | Leptophylloside,1TBDMS,isomer #5 | CC(C)(OC1OC(CO)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 3937.2 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4044.5 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #10 | CC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4062.0 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4068.5 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4022.0 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4047.1 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #5 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4063.9 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #6 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4059.6 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #7 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4072.9 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #8 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4078.1 | Semi standard non polar | 33892256 | | Leptophylloside,2TBDMS,isomer #9 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4078.7 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4219.2 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #10 | CC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4191.6 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4198.7 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4157.8 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4217.1 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #5 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4191.4 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #6 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4130.1 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #7 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4230.0 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #8 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4180.3 | Semi standard non polar | 33892256 | | Leptophylloside,3TBDMS,isomer #9 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4176.8 | Semi standard non polar | 33892256 | | Leptophylloside,4TBDMS,isomer #1 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O)=C2O1 | 4346.7 | Semi standard non polar | 33892256 | | Leptophylloside,4TBDMS,isomer #2 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4293.5 | Semi standard non polar | 33892256 | | Leptophylloside,4TBDMS,isomer #3 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4257.0 | Semi standard non polar | 33892256 | | Leptophylloside,4TBDMS,isomer #4 | CC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4279.9 | Semi standard non polar | 33892256 | | Leptophylloside,4TBDMS,isomer #5 | CC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CC2=CC3=C(OC(=O)C=C3)C(O[Si](C)(C)C(C)(C)C)=C2O1 | 4292.1 | Semi standard non polar | 33892256 |
|
|---|