| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.64 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 10.127 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.19 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 294.1 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 961.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 205.8 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 80.7 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 156.2 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 60.5 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 285.6 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 288.6 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 536.4 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 623.2 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 245.1 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 941.4 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 178.2 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 208.1 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 415.2 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 375.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 281.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Leucyl-Glutamate,1TMS,isomer #1 | CC(C)CC(N)C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O | 2175.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TMS,isomer #2 | CC(C)CC(N)C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C | 2166.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TMS,isomer #3 | CC(C)CC(N[Si](C)(C)C)C(=O)NC(CCC(=O)O)C(=O)O | 2228.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TMS,isomer #4 | CC(C)CC(N)C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C | 2188.1 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #1 | CC(C)CC(N)C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2155.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #2 | CC(C)CC(N[Si](C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O | 2237.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #3 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2188.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #4 | CC(C)CC(N[Si](C)(C)C)C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C | 2246.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #5 | CC(C)CC(N)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2185.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #6 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2403.5 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TMS,isomer #7 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C | 2260.5 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #1 | CC(C)CC(N[Si](C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2213.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #1 | CC(C)CC(N[Si](C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2224.8 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #2 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2151.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #2 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2232.2 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #3 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2402.3 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #3 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2313.9 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #4 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2235.0 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #4 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2278.2 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #5 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2410.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #5 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2287.4 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #6 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2237.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #6 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2242.8 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #7 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2403.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TMS,isomer #7 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2316.1 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #1 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2322.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #1 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2361.9 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #2 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2204.2 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #2 | CC(C)CC(N[Si](C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C | 2310.7 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #3 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2380.5 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #3 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2402.8 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #4 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2399.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TMS,isomer #4 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2371.2 | Standard non polar | 33892256 |
| Leucyl-Glutamate,5TMS,isomer #1 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2374.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,5TMS,isomer #1 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2448.7 | Standard non polar | 33892256 |
| Leucyl-Glutamate,1TBDMS,isomer #1 | CC(C)CC(N)C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2424.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TBDMS,isomer #2 | CC(C)CC(N)C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2422.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TBDMS,isomer #3 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)NC(CCC(=O)O)C(=O)O | 2466.2 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,1TBDMS,isomer #4 | CC(C)CC(N)C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2414.2 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #1 | CC(C)CC(N)C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2630.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #2 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2699.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #3 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2650.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #4 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2699.2 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #5 | CC(C)CC(N)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2635.5 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #6 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2816.6 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,2TBDMS,isomer #7 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2707.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #1 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2877.4 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #1 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2759.4 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #2 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2851.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #2 | CC(C)CC(N)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2769.7 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #3 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3057.2 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #3 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2827.7 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #4 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2912.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #4 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2779.6 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #5 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3044.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #5 | CC(C)CC(C(=O)NC(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2786.8 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #6 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2911.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #6 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2758.5 | Standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #7 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3060.1 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,3TBDMS,isomer #7 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2798.5 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #1 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3235.1 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #1 | CC(C)CC(C(=O)NC(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3032.2 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #2 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3074.9 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #2 | CC(C)CC(N[Si](C)(C)C(C)(C)C)C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2993.7 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #3 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3282.5 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #3 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3048.4 | Standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #4 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3271.8 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,4TBDMS,isomer #4 | CC(C)CC(C(=O)N(C(CCC(=O)O)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3030.9 | Standard non polar | 33892256 |
| Leucyl-Glutamate,5TBDMS,isomer #1 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3481.0 | Semi standard non polar | 33892256 |
| Leucyl-Glutamate,5TBDMS,isomer #1 | CC(C)CC(C(=O)N(C(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3272.2 | Standard non polar | 33892256 |