| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.52 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 9.5444 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.35 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 456.5 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 405.1 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 264.4 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 38.2 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 164.8 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 56.5 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 291.7 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 237.7 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 935.0 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 550.2 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 47.6 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 745.4 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 193.6 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 259.0 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 717.6 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 608.6 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 459.3 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Aspartylhydroxyproline,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2261.3 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TMS,isomer #2 | C[Si](C)(C)O[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@@H](N)CC(=O)O)C1 | 2280.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N)CC(=O)O | 2205.7 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TMS,isomer #4 | C[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2266.6 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O | 2272.7 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C | 2252.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #3 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2280.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C)CN1C(=O)[C@@H](N)CC(=O)O | 2229.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #5 | C[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O | 2287.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #6 | C[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C | 2244.9 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TMS,isomer #7 | C[Si](C)(C)N([C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O)[Si](C)(C)C | 2399.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C | 2272.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #2 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O | 2271.6 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #3 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C | 2277.5 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2399.2 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #5 | C[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C | 2279.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #6 | C[Si](C)(C)O[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@H](CC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C1 | 2433.6 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TMS,isomer #7 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2393.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C | 2282.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C | 2361.7 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C | 2796.6 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2425.5 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2449.4 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2970.2 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2419.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2395.2 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #3 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2830.5 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2434.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2399.9 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2837.9 | Standard polar | 33892256 |
| Aspartylhydroxyproline,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2457.7 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2433.1 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,5TMS,isomer #1 | C[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2632.8 | Standard polar | 33892256 |
| Aspartylhydroxyproline,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2513.7 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@@H](N)CC(=O)O)C1 | 2507.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](N)CC(=O)O | 2467.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2506.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O | 2735.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 2708.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)O | 2741.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)[C@@H](N)CC(=O)O | 2709.3 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O | 2745.6 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 2711.9 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N([C@@H](CC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O)[Si](C)(C)C(C)(C)C | 2828.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@H](N)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 2907.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O | 2959.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 2938.0 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3069.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 2956.6 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@H](CC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C1 | 3094.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3058.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 3145.2 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 3051.1 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CC(=O)O[Si](C)(C)C(C)(C)C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C | 3153.3 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3322.8 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3156.1 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3217.0 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3285.5 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3131.4 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3132.8 | Standard polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3314.4 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3092.9 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)[C@H](CC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3131.4 | Standard polar | 33892256 |
| Aspartylhydroxyproline,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3522.1 | Semi standard non polar | 33892256 |
| Aspartylhydroxyproline,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3272.5 | Standard non polar | 33892256 |
| Aspartylhydroxyproline,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C[C@@H](C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3085.8 | Standard polar | 33892256 |