| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-06 15:16:52 UTC |
|---|
| Update Date | 2022-03-07 02:51:58 UTC |
|---|
| HMDB ID | HMDB0015414 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Rolitetracycline |
|---|
| Description | Rolitetracycline, also known as synterin or reverin, belongs to the class of organic compounds known as tetracyclines. These are polyketides having an octahydrotetracene-2-carboxamide skeleton, substituted with many hydroxy and other groups. Rolitetracycline is a very strong basic compound (based on its pKa). It is a pyrrolidinylmethyl tetracycline. In humans, rolitetracycline is involved in rolitetracycline action pathway. Rolitetracycline is only found in individuals that have used or taken this drug. LD50=262 mg/kg (I.P. in rat). Symptoms of overdose include anorexia, nausea, diarrhoea, glossitis, dysphagia, enterocolitis and inflammatory lesions (with monilial overgrowth) in the anogenital region, skin reactions such as maculopapular and erythematous rashes, exfoliative dermatitis, photosensitivity, hypersensitivity reactions such as urticaria, angioneurotic oedema, anaphylaxis, anaphyl-actoid purpura, pericarditis, and exacerbation of systemic lupus erythematosus, benign intracranial hypertension in adults disappearing on discontinuation of the medicine, haematologic abnormalities such as haemolytic anaemia, thrombocytopenia, neutropenia, and eosinophilia. |
|---|
| Structure | [H][C@@]12C[C@@]3([H])C(C(=O)C4=C(O)C=CC=C4[C@@]3(C)O)=C(O)[C@]1(O)C(=O)C(C(=O)NCN1CCCC1)=C(O)[C@H]2N(C)C InChI=1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14-,15-,20-,26+,27-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| N-(1-Pyrrolidinylmethyl)-tetracycline | ChEBI | | N-(Pyrrolidinomethyl)tetracycline | ChEBI | | Pyrrolidino-methyl-tetracycline | ChEBI | | Reverin | ChEBI | | Rolitetraciclina | ChEBI | | Rolitetracyclinum | ChEBI | | Synterin | ChEBI |
|
|---|
| Chemical Formula | C27H33N3O8 |
|---|
| Average Molecular Weight | 527.5662 |
|---|
| Monoisotopic Molecular Weight | 527.226765047 |
|---|
| IUPAC Name | (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-N-(pyrrolidin-1-ylmethyl)-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
|---|
| Traditional Name | rolitetracycline |
|---|
| CAS Registry Number | 751-97-3 |
|---|
| SMILES | [H][C@@]12C[C@@]3([H])C(C(=O)C4=C(O)C=CC=C4[C@@]3(C)O)=C(O)[C@]1(O)C(=O)C(C(=O)NCN1CCCC1)=C(O)[C@H]2N(C)C |
|---|
| InChI Identifier | InChI=1S/C27H33N3O8/c1-26(37)13-7-6-8-16(31)17(13)21(32)18-14(26)11-15-20(29(2)3)22(33)19(24(35)27(15,38)23(18)34)25(36)28-12-30-9-4-5-10-30/h6-8,14-15,20,31,33-34,37-38H,4-5,9-12H2,1-3H3,(H,28,36)/t14-,15-,20-,26+,27-/m0/s1 |
|---|
| InChI Key | HMEYVGGHISAPJR-IAHYZSEUSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as tetracyclines. These are polyketides having an octahydrotetracene-2-carboxamide skeleton, substituted with many hydroxy and other groups. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Tetracyclines |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Tetracyclines |
|---|
| Alternative Parents | |
|---|
| Substituents | - Tetracycline
- Naphthacene
- Tetracene
- Anthracene carboxylic acid or derivatives
- Tetralin
- Aryl ketone
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Cyclohexenone
- Aralkylamine
- Benzenoid
- N-alkylpyrrolidine
- Pyrrolidine
- Tertiary alcohol
- Vinylogous acid
- Amino acid or derivatives
- Carboxamide group
- Ketone
- Secondary carboxylic acid amide
- Tertiary amine
- Tertiary aliphatic amine
- Polyol
- Enol
- Carboxylic acid derivative
- Azacycle
- Organoheterocyclic compound
- Organic oxide
- Organooxygen compound
- Organonitrogen compound
- Organopnictogen compound
- Organic oxygen compound
- Alcohol
- Amine
- Organic nitrogen compound
- Hydrocarbon derivative
- Carbonyl group
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 1.81 g/L | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.36 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.4631 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.75 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 307.2 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 805.7 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 181.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 121.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 165.5 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 73.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 298.7 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 357.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 1026.5 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 653.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 129.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1211.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 223.6 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 268.8 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 428.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 329.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 288.4 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Rolitetracycline,1TMS,isomer #1 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4113.4 | Semi standard non polar | 33892256 | | Rolitetracycline,1TMS,isomer #2 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4096.7 | Semi standard non polar | 33892256 | | Rolitetracycline,1TMS,isomer #3 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4000.9 | Semi standard non polar | 33892256 | | Rolitetracycline,1TMS,isomer #4 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4114.4 | Semi standard non polar | 33892256 | | Rolitetracycline,1TMS,isomer #5 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4052.4 | Semi standard non polar | 33892256 | | Rolitetracycline,1TMS,isomer #6 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3996.3 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4026.1 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #10 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3925.2 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #11 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3969.2 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #12 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3844.2 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #13 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4015.7 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #14 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3944.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #15 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3915.6 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #2 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4040.4 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #3 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3997.1 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #4 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4053.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #5 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3952.8 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #6 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3988.9 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #7 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4009.2 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #8 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3956.8 | Semi standard non polar | 33892256 | | Rolitetracycline,2TMS,isomer #9 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3933.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4008.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #10 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3945.7 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #11 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3961.1 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #12 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3898.9 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #13 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3890.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #14 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3932.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #15 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3904.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #16 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3843.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #17 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3924.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #18 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3822.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #19 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3855.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #2 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3953.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #20 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3893.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #3 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4015.3 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #4 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3924.9 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #5 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3986.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #6 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4012.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #7 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3936.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #8 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3985.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TMS,isomer #9 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3882.0 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3969.4 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #10 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3909.6 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #11 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3924.8 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #12 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3894.7 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #13 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3846.5 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #14 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3867.7 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #15 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3849.5 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #2 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 4002.2 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #3 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3928.5 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #4 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3969.7 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #5 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3888.9 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #6 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3946.1 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #7 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3986.5 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #8 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3907.6 | Semi standard non polar | 33892256 | | Rolitetracycline,4TMS,isomer #9 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3948.3 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3997.4 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #2 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 3918.0 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #3 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3955.6 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #4 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3920.8 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #5 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3938.3 | Semi standard non polar | 33892256 | | Rolitetracycline,5TMS,isomer #6 | CN(C)[C@@H]1C(O[Si](C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C)[C@H]3C[C@@H]12 | 3882.6 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #1 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4325.9 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #2 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4307.5 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #3 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4268.0 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #4 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4326.8 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #5 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4315.1 | Semi standard non polar | 33892256 | | Rolitetracycline,1TBDMS,isomer #6 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4230.4 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4457.4 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #10 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4376.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #11 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4403.2 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #12 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4299.3 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #13 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4443.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #14 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4361.9 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #15 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4352.6 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #2 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4462.9 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #3 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4435.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #4 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4490.1 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #5 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4383.3 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #6 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4425.3 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #7 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4424.0 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #8 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4396.1 | Semi standard non polar | 33892256 | | Rolitetracycline,2TBDMS,isomer #9 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4364.1 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #1 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4571.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #10 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4545.9 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #11 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4535.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #12 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4488.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #13 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4490.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #14 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4509.8 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #15 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4495.3 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #16 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4450.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #17 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4506.7 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #18 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4421.5 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #19 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4462.7 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #2 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4532.3 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #20 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4481.6 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #3 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4601.4 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #4 | CN(C)[C@@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4512.0 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #5 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4564.3 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #6 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4587.7 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #7 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O[Si](C)(C)C(C)(C)C)C(O)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4521.7 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #8 | CN(C)[C@@H]1C(O)=C(C(=O)NCN2CCCC2)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]12 | 4574.2 | Semi standard non polar | 33892256 | | Rolitetracycline,3TBDMS,isomer #9 | CN(C)[C@@H]1C(O)=C(C(=O)N(CN2CCCC2)[Si](C)(C)C(C)(C)C)C(=O)[C@@]2(O)C(O[Si](C)(C)C(C)(C)C)=C3C(=O)C4=C(O[Si](C)(C)C(C)(C)C)C=CC=C4[C@@](C)(O)[C@H]3C[C@@H]12 | 4486.4 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (Non-derivatized) - 70eV, Positive | splash10-0bu0-4239220000-6c97d917c57a42060234 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_2_11) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_3_5) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_3_14) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_3_17) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_3_19) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_1) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_7) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_8) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_11) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_14) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_4_15) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_5_1) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_5_2) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_5_5) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TMS_5_6) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TBDMS_2_11) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TBDMS_3_5) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TBDMS_3_14) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TBDMS_3_17) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS (TBDMS_3_19) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Rolitetracycline GC-MS ("Rolitetracycline,2TMS,#11" TMS) - 70eV, Positive | Not Available | 2021-10-14 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 10V, Positive-QTOF | splash10-03fr-3000290000-c912c89b208cba70a91b | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 20V, Positive-QTOF | splash10-01pk-9100620000-91fbdb6ffee0cfd79c75 | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 40V, Positive-QTOF | splash10-059t-9005000000-6857cc4f27670b82634c | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 10V, Negative-QTOF | splash10-004i-3111390000-55de8e4f714b83a0ab1e | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 20V, Negative-QTOF | splash10-0fl9-7629540000-5404804f7663e0b79329 | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 40V, Negative-QTOF | splash10-00di-9136200000-d6c850f5107b959a782b | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 10V, Positive-QTOF | splash10-03di-1000090000-6deec75321105828ee77 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 20V, Positive-QTOF | splash10-03di-0000930000-ea074d6980ad66a17888 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 40V, Positive-QTOF | splash10-001i-9230300000-940adf85a8ccc6bc677e | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 10V, Negative-QTOF | splash10-004i-0000290000-c4aaf96b7fb1ddb52894 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 20V, Negative-QTOF | splash10-0006-8106950000-f206bb17855c6e12f48d | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Rolitetracycline 40V, Negative-QTOF | splash10-053u-0012940000-713f06b6578b3d0cb5b6 | 2021-10-11 | Wishart Lab | View Spectrum |
|
|---|