| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.32 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 7.9531 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.19 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 475.1 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 296.1 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 255.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 41.6 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 178.1 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 58.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 268.0 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 222.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 1042.7 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 495.3 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 38.8 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 476.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 189.9 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 284.8 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 1016.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 725.4 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 381.6 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Amifostine,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)SCCNCCCN | 2059.8 | Semi standard non polar | 33892256 |
| Amifostine,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)SCCNCCCN | 1980.2 | Standard non polar | 33892256 |
| Amifostine,1TMS,isomer #1 | C[Si](C)(C)OP(=O)(O)SCCNCCCN | 3277.3 | Standard polar | 33892256 |
| Amifostine,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O | 2169.9 | Semi standard non polar | 33892256 |
| Amifostine,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O | 2002.9 | Standard non polar | 33892256 |
| Amifostine,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O | 3415.6 | Standard polar | 33892256 |
| Amifostine,1TMS,isomer #3 | C[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 2117.9 | Semi standard non polar | 33892256 |
| Amifostine,1TMS,isomer #3 | C[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 1937.2 | Standard non polar | 33892256 |
| Amifostine,1TMS,isomer #3 | C[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 3583.9 | Standard polar | 33892256 |
| Amifostine,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN | 2114.6 | Semi standard non polar | 33892256 |
| Amifostine,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN | 2092.2 | Standard non polar | 33892256 |
| Amifostine,2TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN | 2874.7 | Standard polar | 33892256 |
| Amifostine,2TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C | 2202.6 | Semi standard non polar | 33892256 |
| Amifostine,2TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C | 2162.5 | Standard non polar | 33892256 |
| Amifostine,2TMS,isomer #2 | C[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C | 2776.4 | Standard polar | 33892256 |
| Amifostine,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C | 2101.7 | Semi standard non polar | 33892256 |
| Amifostine,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C | 2101.6 | Standard non polar | 33892256 |
| Amifostine,2TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C | 3060.5 | Standard polar | 33892256 |
| Amifostine,2TMS,isomer #4 | C[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C | 2286.2 | Semi standard non polar | 33892256 |
| Amifostine,2TMS,isomer #4 | C[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C | 2183.4 | Standard non polar | 33892256 |
| Amifostine,2TMS,isomer #4 | C[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C | 3237.4 | Standard polar | 33892256 |
| Amifostine,2TMS,isomer #5 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C | 2251.6 | Semi standard non polar | 33892256 |
| Amifostine,2TMS,isomer #5 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C | 2181.3 | Standard non polar | 33892256 |
| Amifostine,2TMS,isomer #5 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C | 3243.4 | Standard polar | 33892256 |
| Amifostine,3TMS,isomer #1 | C[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 2223.4 | Semi standard non polar | 33892256 |
| Amifostine,3TMS,isomer #1 | C[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 2258.1 | Standard non polar | 33892256 |
| Amifostine,3TMS,isomer #1 | C[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 2363.3 | Standard polar | 33892256 |
| Amifostine,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN)[Si](C)(C)C | 2127.0 | Semi standard non polar | 33892256 |
| Amifostine,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN)[Si](C)(C)C | 2188.2 | Standard non polar | 33892256 |
| Amifostine,3TMS,isomer #2 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN)[Si](C)(C)C | 2743.1 | Standard polar | 33892256 |
| Amifostine,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2318.1 | Semi standard non polar | 33892256 |
| Amifostine,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2284.8 | Standard non polar | 33892256 |
| Amifostine,3TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2668.2 | Standard polar | 33892256 |
| Amifostine,3TMS,isomer #4 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C | 2238.3 | Semi standard non polar | 33892256 |
| Amifostine,3TMS,isomer #4 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C | 2284.4 | Standard non polar | 33892256 |
| Amifostine,3TMS,isomer #4 | C[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C | 2697.8 | Standard polar | 33892256 |
| Amifostine,3TMS,isomer #5 | C[Si](C)(C)N(CCCN([Si](C)(C)C)[Si](C)(C)C)CCSP(=O)(O)O | 2404.2 | Semi standard non polar | 33892256 |
| Amifostine,3TMS,isomer #5 | C[Si](C)(C)N(CCCN([Si](C)(C)C)[Si](C)(C)C)CCSP(=O)(O)O | 2382.7 | Standard non polar | 33892256 |
| Amifostine,3TMS,isomer #5 | C[Si](C)(C)N(CCCN([Si](C)(C)C)[Si](C)(C)C)CCSP(=O)(O)O | 3061.7 | Standard polar | 33892256 |
| Amifostine,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2344.0 | Semi standard non polar | 33892256 |
| Amifostine,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2349.6 | Standard non polar | 33892256 |
| Amifostine,4TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 2324.2 | Standard polar | 33892256 |
| Amifostine,4TMS,isomer #2 | C[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2267.3 | Semi standard non polar | 33892256 |
| Amifostine,4TMS,isomer #2 | C[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2340.6 | Standard non polar | 33892256 |
| Amifostine,4TMS,isomer #2 | C[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C | 2336.1 | Standard polar | 33892256 |
| Amifostine,4TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2441.4 | Semi standard non polar | 33892256 |
| Amifostine,4TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2418.7 | Standard non polar | 33892256 |
| Amifostine,4TMS,isomer #3 | C[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2595.7 | Standard polar | 33892256 |
| Amifostine,5TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2483.1 | Semi standard non polar | 33892256 |
| Amifostine,5TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2433.6 | Standard non polar | 33892256 |
| Amifostine,5TMS,isomer #1 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2321.1 | Standard polar | 33892256 |
| Amifostine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN | 2299.7 | Semi standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN | 2170.5 | Standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN | 3335.7 | Standard polar | 33892256 |
| Amifostine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O | 2405.9 | Semi standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O | 2213.3 | Standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O | 3466.8 | Standard polar | 33892256 |
| Amifostine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 2341.3 | Semi standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 2166.7 | Standard non polar | 33892256 |
| Amifostine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCN)CCSP(=O)(O)O | 3655.8 | Standard polar | 33892256 |
| Amifostine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN | 2598.9 | Semi standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN | 2465.8 | Standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN | 2964.0 | Standard polar | 33892256 |
| Amifostine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C(C)(C)C | 2698.5 | Semi standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C(C)(C)C | 2540.2 | Standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O)O[Si](C)(C)C(C)(C)C | 2929.2 | Standard polar | 33892256 |
| Amifostine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2613.5 | Semi standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2501.9 | Standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 3171.2 | Standard polar | 33892256 |
| Amifostine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 2729.2 | Semi standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 2587.0 | Standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N(CCCNCCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 3262.5 | Standard polar | 33892256 |
| Amifostine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 2750.2 | Semi standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 2605.4 | Standard non polar | 33892256 |
| Amifostine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O)[Si](C)(C)C(C)(C)C | 3304.7 | Standard polar | 33892256 |
| Amifostine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2965.4 | Semi standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2777.0 | Standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 2666.7 | Standard polar | 33892256 |
| Amifostine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2859.0 | Semi standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2705.7 | Standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2902.7 | Standard polar | 33892256 |
| Amifostine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3002.2 | Semi standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2838.3 | Standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2876.3 | Standard polar | 33892256 |
| Amifostine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3036.5 | Semi standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2833.2 | Standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2923.6 | Standard polar | 33892256 |
| Amifostine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)CCSP(=O)(O)O | 3063.7 | Semi standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)CCSP(=O)(O)O | 2952.8 | Standard non polar | 33892256 |
| Amifostine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)CCSP(=O)(O)O | 3181.0 | Standard polar | 33892256 |
| Amifostine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3237.5 | Semi standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3003.1 | Standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2685.6 | Standard polar | 33892256 |
| Amifostine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3236.3 | Semi standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2976.7 | Standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCSP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2728.5 | Standard polar | 33892256 |
| Amifostine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3327.0 | Semi standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3102.6 | Standard non polar | 33892256 |
| Amifostine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(O)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2873.7 | Standard polar | 33892256 |
| Amifostine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3549.1 | Semi standard non polar | 33892256 |
| Amifostine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3182.5 | Standard non polar | 33892256 |
| Amifostine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2762.9 | Standard polar | 33892256 |