| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-06 15:16:51 UTC |
|---|
| Update Date | 2022-03-07 02:51:54 UTC |
|---|
| HMDB ID | HMDB0015234 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Arbutamine |
|---|
| Description | Arbutamine, also known as genesa, belongs to the class of organic compounds known as phenylbutylamines. Phenylbutylamines are compounds containing a phenylbutylamine moiety, which consists of a phenyl group substituted at the fourth carbon by an butan-1-amine. Arbutamine is a drug which is used to elicit acute cardiovascular responses (cardiac stumulant), similar to those produced by exercise, in order to aid in diagnosing the presence or absence of coronary artery disease (cad) in patients who cannot exercise adequately. Arbutamine is a very strong basic compound (based on its pKa). In humans, arbutamine is involved in arbutamine action pathway. |
|---|
| Structure | O[C@@H](CNCCCCC1=CC=C(O)C=C1)C1=CC(O)=C(O)C=C1 InChI=1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Arbutamina | ChEBI | | Arbutaminum | ChEBI | | Arbutamine hydrochloride | HMDB | | Arbutamine hydrochloride, (R)-isomer | HMDB | | GenESA | HMDB |
|
|---|
| Chemical Formula | C18H23NO4 |
|---|
| Average Molecular Weight | 317.3795 |
|---|
| Monoisotopic Molecular Weight | 317.162708229 |
|---|
| IUPAC Name | 4-[(1R)-1-hydroxy-2-{[4-(4-hydroxyphenyl)butyl]amino}ethyl]benzene-1,2-diol |
|---|
| Traditional Name | arbutamine |
|---|
| CAS Registry Number | 128470-16-6 |
|---|
| SMILES | O[C@@H](CNCCCCC1=CC=C(O)C=C1)C1=CC(O)=C(O)C=C1 |
|---|
| InChI Identifier | InChI=1S/C18H23NO4/c20-15-7-4-13(5-8-15)3-1-2-10-19-12-18(23)14-6-9-16(21)17(22)11-14/h4-9,11,18-23H,1-3,10,12H2/t18-/m0/s1 |
|---|
| InChI Key | IIRWWTKISYTTBL-SFHVURJKSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as phenylbutylamines. Phenylbutylamines are compounds containing a phenylbutylamine moiety, which consists of a phenyl group substituted at the fourth carbon by an butan-1-amine. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Phenylbutylamines |
|---|
| Direct Parent | Phenylbutylamines |
|---|
| Alternative Parents | |
|---|
| Substituents | - Phenylbutylamine
- Catechol
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Aralkylamine
- 1,2-aminoalcohol
- Secondary alcohol
- Secondary aliphatic amine
- Secondary amine
- Hydrocarbon derivative
- Organopnictogen compound
- Organooxygen compound
- Organonitrogen compound
- Organic nitrogen compound
- Organic oxygen compound
- Amine
- Aromatic alcohol
- Alcohol
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.084 g/L | Not Available | | LogP | 2.9 | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.34 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 10.078 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.72 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 117.9 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 755.3 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 180.4 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 134.2 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 152.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 91.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 361.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 321.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 719.0 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 684.0 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 293.9 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 955.1 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 193.3 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 250.0 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 603.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 400.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 130.0 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Arbutamine,1TMS,isomer #1 | C[Si](C)(C)O[C@@H](CNCCCCC1=CC=C(O)C=C1)C1=CC=C(O)C(O)=C1 | 3208.3 | Semi standard non polar | 33892256 | | Arbutamine,1TMS,isomer #2 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O)C(O)=C2)C=C1 | 3122.8 | Semi standard non polar | 33892256 | | Arbutamine,1TMS,isomer #3 | C[Si](C)(C)OC1=CC([C@@H](O)CNCCCCC2=CC=C(O)C=C2)=CC=C1O | 3084.7 | Semi standard non polar | 33892256 | | Arbutamine,1TMS,isomer #4 | C[Si](C)(C)OC1=CC=C([C@@H](O)CNCCCCC2=CC=C(O)C=C2)C=C1O | 3113.6 | Semi standard non polar | 33892256 | | Arbutamine,1TMS,isomer #5 | C[Si](C)(C)N(CCCCC1=CC=C(O)C=C1)C[C@H](O)C1=CC=C(O)C(O)=C1 | 3228.6 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C)C2=CC=C(O)C(O)=C2)C=C1 | 3056.0 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #10 | C[Si](C)(C)OC1=CC=C([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)C=C1O | 3147.4 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #2 | C[Si](C)(C)OC1=CC=C([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C)C=C1O | 3077.5 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #3 | C[Si](C)(C)OC1=CC([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C)=CC=C1O | 3058.4 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #4 | C[Si](C)(C)O[C@@H](CN(CCCCC1=CC=C(O)C=C1)[Si](C)(C)C)C1=CC=C(O)C(O)=C1 | 3213.3 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1 | 3065.1 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #6 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1 | 3044.4 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O)C(O)=C2)[Si](C)(C)C)C=C1 | 3146.3 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #8 | C[Si](C)(C)OC1=CC=C([C@@H](O)CNCCCCC2=CC=C(O)C=C2)C=C1O[Si](C)(C)C | 3078.3 | Semi standard non polar | 33892256 | | Arbutamine,2TMS,isomer #9 | C[Si](C)(C)OC1=CC([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)=CC=C1O | 3129.7 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O)=C2)C=C1 | 3003.7 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #10 | C[Si](C)(C)OC1=CC=C([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)C=C1O[Si](C)(C)C | 3131.5 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #2 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C)C2=CC=C(O)C(O[Si](C)(C)C)=C2)C=C1 | 2987.7 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O)C(O)=C2)[Si](C)(C)C)C=C1 | 3097.0 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #4 | C[Si](C)(C)OC1=CC=C([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C)C=C1O[Si](C)(C)C | 3036.0 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #5 | C[Si](C)(C)OC1=CC=C([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)O[Si](C)(C)C)C=C1O | 3107.1 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #6 | C[Si](C)(C)OC1=CC([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)O[Si](C)(C)C)=CC=C1O | 3095.3 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #7 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1 | 3082.4 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #8 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O[Si](C)(C)C)C(O)=C2)[Si](C)(C)C)C=C1 | 3091.7 | Semi standard non polar | 33892256 | | Arbutamine,3TMS,isomer #9 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 3071.4 | Semi standard non polar | 33892256 | | Arbutamine,4TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)C=C1 | 3045.9 | Semi standard non polar | 33892256 | | Arbutamine,4TMS,isomer #2 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O)=C2)[Si](C)(C)C)C=C1 | 3090.1 | Semi standard non polar | 33892256 | | Arbutamine,4TMS,isomer #3 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 3073.7 | Semi standard non polar | 33892256 | | Arbutamine,4TMS,isomer #4 | C[Si](C)(C)OC1=CC=C([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C)O[Si](C)(C)C)C=C1O[Si](C)(C)C | 3085.7 | Semi standard non polar | 33892256 | | Arbutamine,4TMS,isomer #5 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 3115.2 | Semi standard non polar | 33892256 | | Arbutamine,5TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 3135.2 | Semi standard non polar | 33892256 | | Arbutamine,5TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 2826.9 | Standard non polar | 33892256 | | Arbutamine,5TMS,isomer #1 | C[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[Si](C)(C)C)C=C1 | 3038.3 | Standard polar | 33892256 | | Arbutamine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H](CNCCCCC1=CC=C(O)C=C1)C1=CC=C(O)C(O)=C1 | 3441.7 | Semi standard non polar | 33892256 | | Arbutamine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O)C(O)=C2)C=C1 | 3399.3 | Semi standard non polar | 33892256 | | Arbutamine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC([C@@H](O)CNCCCCC2=CC=C(O)C=C2)=CC=C1O | 3387.9 | Semi standard non polar | 33892256 | | Arbutamine,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@@H](O)CNCCCCC2=CC=C(O)C=C2)C=C1O | 3413.5 | Semi standard non polar | 33892256 | | Arbutamine,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(CCCCC1=CC=C(O)C=C1)C[C@H](O)C1=CC=C(O)C(O)=C1 | 3498.2 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C(O)=C2)C=C1 | 3606.7 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C=C1O | 3681.3 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C(C)(C)C)C=C1O | 3604.6 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C(C)(C)C)=CC=C1O | 3582.8 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H](CN(CCCCC1=CC=C(O)C=C1)[Si](C)(C)C(C)(C)C)C1=CC=C(O)C(O)=C1 | 3717.8 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1 | 3647.9 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1 | 3615.6 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O)C(O)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3662.9 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@@H](O)CNCCCCC2=CC=C(O)C=C2)C=C1O[Si](C)(C)C(C)(C)C | 3640.3 | Semi standard non polar | 33892256 | | Arbutamine,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)=CC=C1O | 3652.8 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)C=C1 | 3765.3 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@@H](O)CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C | 3851.9 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1 | 3746.4 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C(O)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3864.6 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@H](CNCCCCC2=CC=C(O)C=C2)O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C | 3754.0 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C=C1O | 3854.1 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)=CC=C1O | 3839.7 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1 | 3848.7 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3872.1 | Semi standard non polar | 33892256 | | Arbutamine,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3838.7 | Semi standard non polar | 33892256 | | Arbutamine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCNC[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)C=C1 | 3957.8 | Semi standard non polar | 33892256 | | Arbutamine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 4051.9 | Semi standard non polar | 33892256 | | Arbutamine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 4034.9 | Semi standard non polar | 33892256 | | Arbutamine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC=C([C@H](CN(CCCCC2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C | 4040.4 | Semi standard non polar | 33892256 | | Arbutamine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 4090.6 | Semi standard non polar | 33892256 | | Arbutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 4267.6 | Semi standard non polar | 33892256 | | Arbutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3678.6 | Standard non polar | 33892256 | | Arbutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC1=CC=C(CCCCN(C[C@H](O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[Si](C)(C)C(C)(C)C)C=C1 | 3433.4 | Standard polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Arbutamine GC-MS (Non-derivatized) - 70eV, Positive | splash10-0a4r-0900000000-beab4528e7ae0c5e38b5 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Arbutamine GC-MS (4 TMS) - 70eV, Positive | splash10-001l-1191070000-bc9a7cc5fdaffaee1815 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Arbutamine GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 10V, Positive-QTOF | splash10-0uxr-0209000000-cb09be2863ef695c2d29 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 20V, Positive-QTOF | splash10-0udj-0913000000-0491c75318d1f3342f09 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 40V, Positive-QTOF | splash10-0a4j-5900000000-053a6953711858f14790 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 10V, Negative-QTOF | splash10-014i-0229000000-c34a09d0f43937c79954 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 20V, Negative-QTOF | splash10-03xs-0933000000-11bf8026af6aaad0368d | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 40V, Negative-QTOF | splash10-0bt9-1900000000-1c392070d0270adc6ce8 | 2016-08-03 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 10V, Positive-QTOF | splash10-0uxr-0109000000-38c3340b26375b90d1bb | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 20V, Positive-QTOF | splash10-0udi-0947000000-265ff6fc9fb91b44eb44 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 40V, Positive-QTOF | splash10-0a4j-3910000000-475756670ba2db15f4f4 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 10V, Negative-QTOF | splash10-014i-0009000000-3fe3b20def364ac29f1a | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 20V, Negative-QTOF | splash10-00ri-0944000000-82eb66b772a067f48e57 | 2021-10-11 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Arbutamine 40V, Negative-QTOF | splash10-0acc-3980000000-a6c3b823ca6dc07e05fb | 2021-10-11 | Wishart Lab | View Spectrum |
|
|---|