| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-06 15:16:50 UTC |
|---|
| Update Date | 2022-03-07 02:51:47 UTC |
|---|
| HMDB ID | HMDB0014907 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Hydrocortamate |
|---|
| Description | Hydrocortamate is a synthetic glucocorticoid used for its anti-inflammatory or immunosuppressive properties to treat inflammation due to corticosteroid-responsive dermatoses. Glucocorticoids are a class of steroid hormones characterised by an ability to bind with the cortisol receptor and trigger a variety of important cardiovascular, metabolic, immunologic and homeostatic effects. |
|---|
| Structure | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CN(CC)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C InChI=1S/C27H41NO6/c1-5-28(6-2)15-23(32)34-16-22(31)27(33)12-10-20-19-8-7-17-13-18(29)9-11-25(17,3)24(19)21(30)14-26(20,27)4/h13,19-21,24,30,33H,5-12,14-16H2,1-4H3/t19-,20-,21-,24+,25-,26-,27-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 17-Hydroxycorticosterone, 21-(diethylamino)acetate | ChEBI | | Hidrocortamato | ChEBI | | Hydrocortamatum | ChEBI | | 17-Hydroxycorticosterone, 21-(diethylamino)acetic acid | Generator | | Hydrocortamic acid | Generator |
|
|---|
| Chemical Formula | C27H41NO6 |
|---|
| Average Molecular Weight | 475.6175 |
|---|
| Monoisotopic Molecular Weight | 475.293388049 |
|---|
| IUPAC Name | 2-[(1S,2R,10S,11S,14R,15S,17S)-14,17-dihydroxy-2,15-dimethyl-5-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-6-en-14-yl]-2-oxoethyl 2-(diethylamino)acetate |
|---|
| Traditional Name | hidrocortamato |
|---|
| CAS Registry Number | 76-47-1 |
|---|
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CN(CC)CC)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C27H41NO6/c1-5-28(6-2)15-23(32)34-16-22(31)27(33)12-10-20-19-8-7-17-13-18(29)9-11-25(17,3)24(19)21(30)14-26(20,27)4/h13,19-21,24,30,33H,5-12,14-16H2,1-4H3/t19-,20-,21-,24+,25-,26-,27-/m0/s1 |
|---|
| InChI Key | FWFVLWGEFDIZMJ-FOMYWIRZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as gluco/mineralocorticoids, progestogins and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Pregnane steroids |
|---|
| Direct Parent | Gluco/mineralocorticoids, progestogins and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 20-oxosteroid
- 3-oxo-delta-4-steroid
- Oxosteroid
- Hydroxysteroid
- 3-oxosteroid
- 11-beta-hydroxysteroid
- 11-hydroxysteroid
- 17-hydroxysteroid
- Delta-4-steroid
- Alpha-amino acid ester
- Alpha-amino acid or derivatives
- Alpha-acyloxy ketone
- Cyclohexenone
- Tertiary alcohol
- Cyclic alcohol
- Alpha-hydroxy ketone
- Carboxylic acid ester
- Cyclic ketone
- Amino acid or derivatives
- Ketone
- Secondary alcohol
- Tertiary amine
- Tertiary aliphatic amine
- Carboxylic acid derivative
- Monocarboxylic acid or derivatives
- Organic nitrogen compound
- Organonitrogen compound
- Carbonyl group
- Organooxygen compound
- Amine
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Alcohol
- Organic oxygen compound
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.086 g/L | Not Available | | LogP | 1.2 | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.85 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.446 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.0 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2359.0 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 146.5 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 199.4 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 151.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 127.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 437.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 494.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 168.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 928.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 421.2 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1298.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 294.5 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 342.1 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 272.3 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 200.7 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 49.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Hydrocortamate,1TMS,isomer #1 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3877.6 | Semi standard non polar | 33892256 | | Hydrocortamate,1TMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3708.8 | Semi standard non polar | 33892256 | | Hydrocortamate,1TMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3728.7 | Semi standard non polar | 33892256 | | Hydrocortamate,1TMS,isomer #4 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3737.6 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #1 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3759.4 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #2 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3767.4 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #3 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3762.4 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3593.5 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #5 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3599.1 | Semi standard non polar | 33892256 | | Hydrocortamate,2TMS,isomer #6 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3607.5 | Semi standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3659.7 | Semi standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3585.6 | Standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 4215.7 | Standard polar | 33892256 | | Hydrocortamate,3TMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3666.8 | Semi standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3638.3 | Standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 4226.7 | Standard polar | 33892256 | | Hydrocortamate,3TMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3665.2 | Semi standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3684.1 | Standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4283.6 | Standard polar | 33892256 | | Hydrocortamate,3TMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3507.6 | Semi standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3599.4 | Standard non polar | 33892256 | | Hydrocortamate,3TMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 4350.0 | Standard polar | 33892256 | | Hydrocortamate,4TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3572.3 | Semi standard non polar | 33892256 | | Hydrocortamate,4TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 3605.0 | Standard non polar | 33892256 | | Hydrocortamate,4TMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C)[C@@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C)C[C@@]21C | 4141.4 | Standard polar | 33892256 | | Hydrocortamate,1TBDMS,isomer #1 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4108.2 | Semi standard non polar | 33892256 | | Hydrocortamate,1TBDMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3938.0 | Semi standard non polar | 33892256 | | Hydrocortamate,1TBDMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3946.4 | Semi standard non polar | 33892256 | | Hydrocortamate,1TBDMS,isomer #4 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 3961.1 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #1 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4209.1 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #2 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4212.0 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #3 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4219.3 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4032.3 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #5 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4033.0 | Semi standard non polar | 33892256 | | Hydrocortamate,2TBDMS,isomer #6 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4044.9 | Semi standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4287.5 | Semi standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4179.7 | Standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #1 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4371.4 | Standard polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4293.4 | Semi standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4179.6 | Standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #2 | CCN(CC)CC(=O)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4383.7 | Standard polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4299.9 | Semi standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4197.6 | Standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #3 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C | 4445.1 | Standard polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4103.0 | Semi standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4129.8 | Standard non polar | 33892256 | | Hydrocortamate,3TBDMS,isomer #4 | CCN(CC)CC(=O)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]21C | 4525.6 | Standard polar | 33892256 |
|
|---|