| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2008-09-15 17:11:39 UTC |
|---|
| Update Date | 2022-03-07 02:50:53 UTC |
|---|
| HMDB ID | HMDB0010331 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Palmitoyl glucuronide |
|---|
| Description | Palmitoyl glucuronide is a natural human metabolite of Palmitic acid generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. |
|---|
| Structure | CCCCCCCCCCCCCCCCO[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O InChI=1S/C22H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-28-22-19(25)17(23)18(24)20(29-22)21(26)27/h17-20,22-25H,2-16H2,1H3,(H,26,27)/t17-,18-,19+,20-,22+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 1-O-Palmityl-D-glucuronic acid | HMDB | | 1-O-Palmityl-delta-glucuronic acid | HMDB | | 1-O-Palmitylglucuronic acid | HMDB | | Hexadecylbeta-D-glucopyranosiduronic acid | HMDB | | Hexadecylbeta-delta-glucopyranosiduronic acid | HMDB | | Pglcua | HMDB | | (2S,3S,4S,5R,6R)-6-(Hexadecyloxy)-3,4,5-trihydroxyoxane-2-carboxylate | HMDB | | Palmitoyl glucuronide | MeSH |
|
|---|
| Chemical Formula | C22H42O7 |
|---|
| Average Molecular Weight | 418.5647 |
|---|
| Monoisotopic Molecular Weight | 418.293053698 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6R)-6-(hexadecyloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6R)-6-(hexadecyloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CCCCCCCCCCCCCCCCO[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C22H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-28-22-19(25)17(23)18(24)20(29-22)21(26)27/h17-20,22-25H,2-16H2,1H3,(H,26,27)/t17-,18-,19+,20-,22+/m0/s1 |
|---|
| InChI Key | QFUQXEVPTHAOHS-SXFAUFNYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Fatty Acyls |
|---|
| Sub Class | Fatty acyl glycosides |
|---|
| Direct Parent | Fatty acyl glycosides of mono- and disaccharides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Fatty acyl glycoside of mono- or disaccharide
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Alkyl glycoside
- Hexose monosaccharide
- Glycosyl compound
- O-glycosyl compound
- Beta-hydroxy acid
- Hydroxy acid
- Monosaccharide
- Pyran
- Oxane
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Acetal
- Organoheterocyclic compound
- Oxacycle
- Carboxylic acid
- Carboxylic acid derivative
- Polyol
- Alcohol
- Hydrocarbon derivative
- Carbonyl group
- Organic oxide
- Organic oxygen compound
- Organooxygen compound
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 9.54 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 16.8163 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.05 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 48.2 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3208.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 248.5 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 206.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 176.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 521.8 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 701.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 743.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 192.0 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1587.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 626.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1757.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 571.1 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 456.9 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 361.1 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 201.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 9.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Palmitoyl glucuronide,1TMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3133.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3110.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3105.8 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3145.4 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3167.5 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3165.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3156.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3164.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #5 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3147.6 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TMS,isomer #6 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3153.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3189.0 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3212.1 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3177.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3186.2 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,4TMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3185.1 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TBDMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3349.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TBDMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3322.1 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TBDMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3334.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,1TBDMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3382.6 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3608.1 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3589.5 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3584.9 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3597.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #5 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3574.6 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,2TBDMS,isomer #6 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3613.7 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TBDMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3804.3 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TBDMS,isomer #2 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3833.4 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TBDMS,isomer #3 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3792.8 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,3TBDMS,isomer #4 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3812.0 | Semi standard non polar | 33892256 | | Palmitoyl glucuronide,4TBDMS,isomer #1 | CCCCCCCCCCCCCCCCO[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 4048.0 | Semi standard non polar | 33892256 |
|
|---|