| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2008-08-06 16:00:14 UTC |
|---|
| Update Date | 2021-09-14 15:47:10 UTC |
|---|
| HMDB ID | HMDB0006765 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 2-Methoxy-estradiol-17b 3-glucuronide |
|---|
| Description | 2-Methoxy-estradiol-17beta 3-glucuronide is a natural human metabolite of 2-Methoxy-estradiol-17beta generated in the liver by UDP glucuonyltransferase. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. |
|---|
| Structure | COC1=C(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)C=C2CC[C@H]3[C@@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]3C2=C1 InChI=1S/C25H34O9/c1-25-8-7-12-13(15(25)5-6-18(25)26)4-3-11-9-17(16(32-2)10-14(11)12)33-24-21(29)19(27)20(28)22(34-24)23(30)31/h9-10,12-13,15,18-22,24,26-29H,3-8H2,1-2H3,(H,30,31)/t12-,13+,15-,18-,19-,20-,21+,22-,24+,25-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (17beta)-17-Hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl beta-D-glucopyranosiduronic acid | ChEBI | | 2-MeOE2 3g | ChEBI | | 2-Methoxy-17beta-estradiol 3-beta-D-glucuronide | ChEBI | | 2-Methoxy-17beta-estradiol 3-beta-glucuronide | ChEBI | | 2-Methoxy-17beta-estradiol 3-glucosiduronic acid | ChEBI | | 2-Methoxy-17beta-estradiol 3-glucuronide | ChEBI | | 2-Methoxy-17beta-estradiol 3-O-(beta-D-glucuronic acid) | ChEBI | | 2-Methoxy-17beta-estradiol 3-O-glucuronide | ChEBI | | 2-Methoxy-estradiol-17beta 3-glucuronide | ChEBI | | 2-Methoxyestradiol 3-glucuronide | ChEBI | | (17b)-17-Hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl b-D-glucopyranosiduronate | Generator | | (17b)-17-Hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl b-D-glucopyranosiduronic acid | Generator | | (17beta)-17-Hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl beta-D-glucopyranosiduronate | Generator | | (17Β)-17-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate | Generator | | (17Β)-17-hydroxy-2-methoxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid | Generator | | 2-Methoxy-17b-estradiol 3-b-D-glucuronide | Generator | | 2-Methoxy-17β-estradiol 3-β-D-glucuronide | Generator | | 2-Methoxy-17b-estradiol 3-b-glucuronide | Generator | | 2-Methoxy-17β-estradiol 3-β-glucuronide | Generator | | 2-Methoxy-17b-estradiol 3-glucosiduronate | Generator | | 2-Methoxy-17b-estradiol 3-glucosiduronic acid | Generator | | 2-Methoxy-17beta-estradiol 3-glucosiduronate | Generator | | 2-Methoxy-17β-estradiol 3-glucosiduronate | Generator | | 2-Methoxy-17β-estradiol 3-glucosiduronic acid | Generator | | 2-Methoxy-17b-estradiol 3-glucuronide | Generator | | 2-Methoxy-17β-estradiol 3-glucuronide | Generator | | 2-Methoxy-17b-estradiol 3-O-(b-D-glucuronate) | Generator | | 2-Methoxy-17b-estradiol 3-O-(b-D-glucuronic acid) | Generator | | 2-Methoxy-17beta-estradiol 3-O-(beta-D-glucuronate) | Generator | | 2-Methoxy-17β-estradiol 3-O-(β-D-glucuronate) | Generator | | 2-Methoxy-17β-estradiol 3-O-(β-D-glucuronic acid) | Generator | | 2-Methoxy-17b-estradiol 3-O-glucuronide | Generator | | 2-Methoxy-17β-estradiol 3-O-glucuronide | Generator | | 2-Methoxy-estradiol-17β 3-glucuronide | Generator | | 2-Methoxy-estradiol-17b 3-glucuronide | Generator |
|
|---|
| Chemical Formula | C25H34O9 |
|---|
| Average Molecular Weight | 478.5321 |
|---|
| Monoisotopic Molecular Weight | 478.220282686 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(1S,10R,11S,14S,15S)-14-hydroxy-4-methoxy-15-methyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-5-yl]oxy}oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(1S,10R,11S,14S,15S)-14-hydroxy-4-methoxy-15-methyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadeca-2,4,6-trien-5-yl]oxy}oxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | COC1=C(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)C=C2CC[C@H]3[C@@H]4CC[C@H](O)[C@@]4(C)CC[C@@H]3C2=C1 |
|---|
| InChI Identifier | InChI=1S/C25H34O9/c1-25-8-7-12-13(15(25)5-6-18(25)26)4-3-11-9-17(16(32-2)10-14(11)12)33-24-21(29)19(27)20(28)22(34-24)23(30)31/h9-10,12-13,15,18-22,24,26-29H,3-8H2,1-2H3,(H,30,31)/t12-,13+,15-,18-,19-,20-,21+,22-,24+,25-/m0/s1 |
|---|
| InChI Key | LLCPFVIBUZJITJ-GVEMAFOVSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as steroid glucuronide conjugates. These are sterol lipids containing a glucuronide moiety linked to the steroid skeleton. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Steroidal glycosides |
|---|
| Direct Parent | Steroid glucuronide conjugates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Steroid-glucuronide-skeleton
- Hydroxysteroid
- 17-hydroxysteroid
- Estrane-skeleton
- Fatty acyl glycoside
- Fatty acyl glycoside of mono- or disaccharide
- Phenolic glycoside
- 1-o-glucuronide
- O-glucuronide
- Phenanthrene
- Glucuronic acid or derivatives
- Alkyl glycoside
- Glycosyl compound
- O-glycosyl compound
- Tetralin
- Anisole
- Beta-hydroxy acid
- Alkyl aryl ether
- Fatty acyl
- Benzenoid
- Pyran
- Hydroxy acid
- Monosaccharide
- Oxane
- Cyclic alcohol
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Polyol
- Oxacycle
- Carboxylic acid derivative
- Carboxylic acid
- Acetal
- Ether
- Organoheterocyclic compound
- Organooxygen compound
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Carbonyl group
- Alcohol
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.87 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.7939 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.01 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2116.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 192.4 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 157.9 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 179.7 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 162.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 427.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 483.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 269.0 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 865.3 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 478.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1403.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 303.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 341.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 383.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 230.7 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 142.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-Methoxy-estradiol-17b 3-glucuronide,1TMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3939.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3951.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3949.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3909.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3945.3 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3894.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #10 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3870.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3917.4 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3923.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3908.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3881.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #6 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3915.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #7 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3920.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #8 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3895.4 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TMS,isomer #9 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3914.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3881.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #10 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3874.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3890.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3877.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3908.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3902.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #6 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3902.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #7 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3886.4 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #8 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3866.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TMS,isomer #9 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3899.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,4TMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 3894.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,4TMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3891.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,4TMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3894.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,4TMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3905.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,4TMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3898.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,5TMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C)CC[C@@H]12 | 3908.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TBDMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4173.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TBDMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4189.5 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TBDMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4184.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TBDMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4168.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,1TBDMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4173.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4369.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #10 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4347.4 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4369.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4375.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4362.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4368.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #6 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4372.7 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #7 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4381.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #8 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4378.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,2TBDMS,isomer #9 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4377.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #1 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4552.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #10 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4566.1 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #2 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4576.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #3 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4552.9 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #4 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4552.6 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #5 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4555.8 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #6 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4562.2 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #7 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 | 4557.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #8 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4548.0 | Semi standard non polar | 33892256 | | 2-Methoxy-estradiol-17b 3-glucuronide,3TBDMS,isomer #9 | COC1=CC2=C(C=C1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 | 4558.3 | Semi standard non polar | 33892256 |
|
|---|