| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2008-08-06 15:19:57 UTC |
|---|
| Update Date | 2022-03-07 02:49:33 UTC |
|---|
| HMDB ID | HMDB0006760 |
|---|
| Secondary Accession Numbers | - HMDB0006761
- HMDB06760
- HMDB06761
|
|---|
| Metabolite Identification |
|---|
| Common Name | 11b,17a,21-Trihydroxypreg-nenolone |
|---|
| Description | 11beta,17alpha,21-Trihydroxypregnenolone is an intermediate in C21-Steroid hormone metabolism. 11beta,17alpha,21-Trihydroxypregnenolone is the 4th to last step in the synthesis of Cortol and is converted from 17alpha,21-Dihydroxypregnenolone via the enzyme cytochrome P450 (EC:1.14.15.4). It is then converted to Cortisol via the enzyme 3beta-hydroxy-delta5-steroid dehydrogenase (EC 1.1.1.145) and the enzyme steroid delta-isomerase (EC 5.3.3.1). |
|---|
| Structure | CC12CC(O)C3C(CC=C4CC(O)CCC34C)C1CC[C@]2(O)C(=O)CO InChI=1S/C21H32O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h3,13-16,18,22-24,26H,4-11H2,1-2H3/t13?,14?,15?,16?,18?,19?,20?,21-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 11beta,17alpha,21-Trihydroxypreg-nenolone | HMDB | | 11beta,17alpha,21-Trihydroxypregnenolone | HMDB |
|
|---|
| Chemical Formula | C21H32O5 |
|---|
| Average Molecular Weight | 364.4758 |
|---|
| Monoisotopic Molecular Weight | 364.224974134 |
|---|
| IUPAC Name | 2-hydroxy-1-[(14R)-5,14,17-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl]ethan-1-one |
|---|
| Traditional Name | 2-hydroxy-1-[(14R)-5,14,17-trihydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl]ethanone |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CC12CC(O)C3C(CC=C4CC(O)CCC34C)C1CC[C@]2(O)C(=O)CO |
|---|
| InChI Identifier | InChI=1S/C21H32O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h3,13-16,18,22-24,26H,4-11H2,1-2H3/t13?,14?,15?,16?,18?,19?,20?,21-/m0/s1 |
|---|
| InChI Key | HAFVWTUQBYRPOB-QGGNSXJXSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 21-hydroxysteroid
- 20-oxosteroid
- Pregnane-skeleton
- 3-hydroxy-delta-5-steroid
- 3-hydroxysteroid
- Oxosteroid
- 11-hydroxysteroid
- 17-hydroxysteroid
- Delta-5-steroid
- Cyclic alcohol
- Tertiary alcohol
- Alpha-hydroxy ketone
- Ketone
- Secondary alcohol
- Polyol
- Alcohol
- Hydrocarbon derivative
- Organooxygen compound
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Primary alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. | 4.14 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.0825 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.14 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2199.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 184.7 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 155.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 168.5 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 141.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 437.2 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 478.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 160.7 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 825.3 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 365.2 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1286.4 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 268.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 334.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 421.3 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 263.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 109.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 11b,17a,21-Trihydroxypreg-nenolone,1TMS,isomer #1 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO | 3319.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TMS,isomer #2 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO | 3347.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TMS,isomer #3 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3341.6 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3318.4 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TMS,isomer #5 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3247.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO | 3300.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #10 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3327.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #2 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3339.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #3 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3337.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3225.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #5 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3366.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #6 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3356.2 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #7 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3259.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #8 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3399.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TMS,isomer #9 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3312.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3246.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #10 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3310.8 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #2 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3246.5 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #3 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3149.6 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3325.5 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #5 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3206.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #6 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3201.2 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #7 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3343.5 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #8 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3227.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TMS,isomer #9 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3247.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3268.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TMS,isomer #2 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3142.6 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TMS,isomer #3 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3157.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3227.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TMS,isomer #5 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3237.6 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,5TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3135.8 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,5TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3145.2 | Standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,5TMS,isomer #1 | CC12CCC(O[Si](C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3444.0 | Standard polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TBDMS,isomer #1 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO | 3580.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TBDMS,isomer #2 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO | 3593.5 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TBDMS,isomer #3 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3597.4 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TBDMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C(C)(C)C | 3596.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,1TBDMS,isomer #5 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3488.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #1 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO | 3781.4 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #10 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3828.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #2 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3836.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #3 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C(C)(C)C | 3856.4 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3703.2 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #5 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3843.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #6 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C(C)(C)C | 3861.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #7 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3737.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #8 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C | 3900.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,2TBDMS,isomer #9 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3792.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #1 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3942.5 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #10 | CC12CCC(O)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4023.8 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #2 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=O)CO[Si](C)(C)C(C)(C)C | 3946.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #3 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3824.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C | 4060.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #5 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3898.2 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #6 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3920.1 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #7 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C | 4072.7 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #8 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3939.8 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,3TBDMS,isomer #9 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3964.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TBDMS,isomer #1 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO[Si](C)(C)C(C)(C)C | 4152.9 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TBDMS,isomer #2 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 4058.3 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TBDMS,isomer #3 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4032.4 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TBDMS,isomer #4 | CC12CCC(O)CC1=CCC1C2C(O[Si](C)(C)C(C)(C)C)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4136.0 | Semi standard non polar | 33892256 | | 11b,17a,21-Trihydroxypreg-nenolone,4TBDMS,isomer #5 | CC12CCC(O[Si](C)(C)C(C)(C)C)CC1=CCC1C2C(O)CC2(C)C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4141.6 | Semi standard non polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone GC-MS (Non-derivatized) - 70eV, Positive | splash10-0541-3359000000-db5da057c94c2a047b10 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone GC-MS (4 TMS) - 70eV, Positive | splash10-000i-1010239000-01d0907903079ebb80e5 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 10V, Positive-QTOF | splash10-002b-0019000000-d6f315e61bbd67eae72a | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 20V, Positive-QTOF | splash10-004j-0059000000-80e727e264ca8a26a2b6 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 40V, Positive-QTOF | splash10-000i-0292000000-3aa262e1ed45e0e16207 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 10V, Negative-QTOF | splash10-03di-0009000000-c6648ee147e3babd9fc5 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 20V, Negative-QTOF | splash10-0btj-2029000000-37d8ba5fa07061ac854a | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 40V, Negative-QTOF | splash10-0a4i-9087000000-1ebec2db5084d047ee8e | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 10V, Positive-QTOF | splash10-016s-0009000000-6ce3ed6f29dccbfe6478 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 20V, Positive-QTOF | splash10-0002-1926000000-f119874166aedccc6ac9 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 40V, Positive-QTOF | splash10-0007-5791000000-559a7f43ae2c76413fe6 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 10V, Negative-QTOF | splash10-00lr-0009000000-67b158b5ac05ed2344ab | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 20V, Negative-QTOF | splash10-067i-5019000000-a9c81ea29263a6d18742 | 2021-09-22 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 11b,17a,21-Trihydroxypreg-nenolone 40V, Negative-QTOF | splash10-00n0-2098000000-67c584ed2fd965c412d9 | 2021-09-22 | Wishart Lab | View Spectrum |
|
|---|