| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2007-05-22 18:18:29 UTC |
|---|
| Update Date | 2021-09-14 15:40:24 UTC |
|---|
| HMDB ID | HMDB0006224 |
|---|
| Secondary Accession Numbers | - HMDB0006767
- HMDB06224
- HMDB06767
|
|---|
| Metabolite Identification |
|---|
| Common Name | 17-beta-Estradiol-3-glucuronide |
|---|
| Description | 17beta-Estradiol 3-glucuronide belongs to the class of organic compounds known as steroid glucuronide conjugates. These are sterol lipids containing a glucuronide moiety linked to the steroid skeleton. 17beta-Estradiol 3-glucuronide is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. Estradiol glucuronide is believed to play an important role in the mechanism of 17beta-estradiol(E2)-mediated tumour formation. Conjugation with glucuronic acid lowers tissue levels by facilitating excretion. Heterotropic activation by daidzein appears to be specific for the glucuronidation of E2 because daidzein did not affect the glucuronidation of the 2- and 4-hydroxy metabolites of E2 (PMID: 16598814 ). |
|---|
| Structure | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O)C=C3 InChI=1S/C24H32O8/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30)/t14-,15-,16+,17+,18+,19+,20-,21+,23-,24+/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 17beta-Estradiol 3-(beta-D-glucuronide) | ChEBI | | 17beta-Estradiol 3-glucuronide | ChEBI | | Estradiol-17beta 3-glucuronide | ChEBI | | Estradiol-3-glucuronide | ChEBI | | 17b-Estradiol 3-(b-D-glucuronide) | Generator | | 17Β-estradiol 3-(β-D-glucuronide) | Generator | | 17b-Estradiol 3-glucuronide | Generator | | 17Β-estradiol 3-glucuronide | Generator | | Estradiol-17b 3-glucuronide | Generator | | Estradiol-17β 3-glucuronide | Generator | | 17-b-Estradiol-3-glucuronide | Generator | | 17-Β-estradiol-3-glucuronide | Generator | | (17beta)-17-Hydroxyestra-1,3,5(10)-trien-3-yl beta-D-glucopyranosiduronic acid | HMDB | | (17Β)-17-hydroxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronic acid | HMDB | | 17beta-Estradiol 3-glucosiduronate | HMDB | | 17Β-estradiol 3-glucosiduronate | HMDB | | Estradiol 3-glucosiduronate | HMDB | | Estradiol 3-glucuronide | HMDB | | Estradiol-17beta-3-(beta-D-glucuronide) | HMDB | | Estradiol-17β-3-(β-D-glucuronide) | HMDB |
|
|---|
| Chemical Formula | C24H32O8 |
|---|
| Average Molecular Weight | 448.5061 |
|---|
| Monoisotopic Molecular Weight | 448.209718 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(1S,10R,11S,14S,15S)-14-hydroxy-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-2(7),3,5-trien-5-yl]oxy}oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(1S,10R,11S,14S,15S)-14-hydroxy-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-2(7),3,5-trien-5-yl]oxy}oxane-2-carboxylic acid |
|---|
| CAS Registry Number | 15270-30-1 |
|---|
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O)C=C3 |
|---|
| InChI Identifier | InChI=1S/C24H32O8/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30)/t14-,15-,16+,17+,18+,19+,20-,21+,23-,24+/m1/s1 |
|---|
| InChI Key | MUOHJTRCBBDUOW-QXYWQCSFSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as steroid glucuronide conjugates. These are sterol lipids containing a glucuronide moiety linked to the steroid skeleton. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Steroidal glycosides |
|---|
| Direct Parent | Steroid glucuronide conjugates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Steroid-glucuronide-skeleton
- Estrane-skeleton
- Hydroxysteroid
- 17-hydroxysteroid
- Fatty acyl glycoside
- Phenolic glycoside
- Fatty acyl glycoside of mono- or disaccharide
- 1-o-glucuronide
- O-glucuronide
- Phenanthrene
- Glucuronic acid or derivatives
- Alkyl glycoside
- O-glycosyl compound
- Glycosyl compound
- Tetralin
- Beta-hydroxy acid
- Fatty acyl
- Pyran
- Benzenoid
- Oxane
- Monosaccharide
- Hydroxy acid
- Cyclic alcohol
- Secondary alcohol
- Polyol
- Organoheterocyclic compound
- Carboxylic acid derivative
- Carboxylic acid
- Acetal
- Monocarboxylic acid or derivatives
- Oxacycle
- Alcohol
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Carbonyl group
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.94 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 12.4066 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.52 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2152.1 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 200.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 164.5 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 181.2 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 185.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 466.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 507.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 198.9 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 920.4 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 496.8 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1460.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 310.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 356.5 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 357.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 192.2 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 142.2 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 17-beta-Estradiol-3-glucuronide,1TMS,isomer #1 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3872.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TMS,isomer #2 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3866.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TMS,isomer #3 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3873.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TMS,isomer #4 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3869.8 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TMS,isomer #5 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3824.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #1 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3813.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #10 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3843.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #2 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3844.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #3 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3851.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #4 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3851.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #5 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3841.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #6 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3855.0 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #7 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3860.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #8 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3834.2 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TMS,isomer #9 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3860.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #1 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3836.9 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #10 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3860.2 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #2 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3826.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #3 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3831.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #4 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3861.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #5 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3855.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #6 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3857.8 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #7 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3850.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #8 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3856.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TMS,isomer #9 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3869.4 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,4TMS,isomer #1 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3860.4 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,4TMS,isomer #2 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3866.9 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,4TMS,isomer #3 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3875.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,4TMS,isomer #4 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3890.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,4TMS,isomer #5 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O | 3878.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,5TMS,isomer #1 | C[C@]12CC[C@@H]3C4=CC=C(O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)C=C4CC[C@H]3[C@@H]1CC[C@@H]2O[Si](C)(C)C | 3878.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)=CC=C4[C@H]3CC[C@]12C | 4115.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@H]1O | 4118.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)O[C@H](C(=O)O)[C@H]1O | 4125.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O | 4114.4 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O | 4098.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O | 4323.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4341.0 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O)[C@H]1O | 4329.0 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)O[C@H](C(=O)O)[C@H]1O | 4342.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C(C)(C)C)=CC=C4[C@H]3CC[C@]12C | 4336.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4336.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4332.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4332.2 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@@H]1O[Si](C)(C)C(C)(C)C | 4333.0 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4338.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4542.3 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4533.7 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4535.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4535.4 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4534.5 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]5O)=CC=C4[C@H]3CC[C@]12C | 4530.1 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)[C@@H]1O[Si](C)(C)C(C)(C)C | 4531.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4556.4 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4530.6 | Semi standard non polar | 33892256 | | 17-beta-Estradiol-3-glucuronide,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=CC=C3C(=C2)CC[C@@H]2[C@@H]3CC[C@]3(C)[C@@H](O)CC[C@@H]23)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C(C)(C)C | 4536.0 | Semi standard non polar | 33892256 |
|
|---|