| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2006-08-13 19:41:24 UTC |
|---|
| Update Date | 2022-03-07 02:49:21 UTC |
|---|
| HMDB ID | HMDB0004484 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Etiocholanolone glucuronide |
|---|
| Description | Etiocholanolone glucuronide is a natural human metabolite of etiocholanolone generated in the liver by UDP glucuonyltransferase. Etiocholanolone (or 5-isoandrosterone) is a metabolite of testosterone. Classified a ketosteroid, it causes fever, immunostimulation and leukocytosis. Glucuronidation is used to assist in the excretion of toxic substances, drugs or other substances that cannot be used as an energy source. Glucuronic acid is attached via a glycosidic bond to the substance, and the resulting glucuronide, which has a much higher water solubility than the original substance, is eventually excreted by the kidneys. |
|---|
| Structure | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@@H](CC[C@]12C)O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13-,14+,15+,16+,18+,19+,20-,21+,23-,24+,25+/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 3alpha-Hydroxyetiocholan-17-one 3-glucosiduronic acid | ChEBI | | 3alpha-Hydroxyetiocholan-17-one 3-glucuronide | ChEBI | | Etiocholan-3alpha-ol-17-one 3-glucuronide | ChEBI | | Etiocholan-3alpha-ol-17-one 3-glucuronoside | ChEBI | | 3a-Hydroxyetiocholan-17-one 3-glucosiduronate | Generator | | 3a-Hydroxyetiocholan-17-one 3-glucosiduronic acid | Generator | | 3alpha-Hydroxyetiocholan-17-one 3-glucosiduronate | Generator | | 3Α-hydroxyetiocholan-17-one 3-glucosiduronate | Generator | | 3Α-hydroxyetiocholan-17-one 3-glucosiduronic acid | Generator | | 3a-Hydroxyetiocholan-17-one 3-glucuronide | Generator | | 3Α-hydroxyetiocholan-17-one 3-glucuronide | Generator | | Etiocholan-3a-ol-17-one 3-glucuronide | Generator | | Etiocholan-3α-ol-17-one 3-glucuronide | Generator | | Etiocholan-3a-ol-17-one 3-glucuronoside | Generator | | Etiocholan-3α-ol-17-one 3-glucuronoside | Generator | | 17-Oxoandrostan-3-yl hexopyranosiduronic acid | HMDB | | 3alpha-Hydroxy-5beta-androstan-17-one 3-glucuronide | HMDB | | 5Alpha.-androstan-3.alpha.-ol-17-one glucoronide | HMDB | | 5beta-Androstan-3alpha-ol-17-one 3-glucuronide | HMDB | | Etiocholanolone 3-glucuronide | HMDB | | Androsterone glucosiduronate | HMDB | | Androsterone glucuronide | HMDB | | Androsterone glucuronide, (3beta,5alpha)-isomer | HMDB | | Androsterone glucuronide, (beta-D)-isomer | HMDB | | Androsterone glucuronide, sodium salt, (3alpha,5alpha)-isomer | HMDB | | Androsterone glucuronide, sodium salt, (3alpha,5beta)-isomer | HMDB | | (3alpha,5alpha)-17-Oxoandrostan-3-yl beta-D-glucopyranosiduronic acid | HMDB |
|
|---|
| Chemical Formula | C25H38O8 |
|---|
| Average Molecular Weight | 466.5644 |
|---|
| Monoisotopic Molecular Weight | 466.256668192 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6R)-6-{[(1S,2S,5R,7R,10R,11S,15S)-2,15-dimethyl-14-oxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|
| Traditional Name | androsterone glucuronide |
|---|
| CAS Registry Number | 3602-09-3 |
|---|
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@@H](CC[C@]12C)O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13-,14+,15+,16+,18+,19+,20-,21+,23-,24+,25+/m1/s1 |
|---|
| InChI Key | VFUIRAVTUVCQTF-SDHZCXLISA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as steroid glucuronide conjugates. These are sterol lipids containing a glucuronide moiety linked to the steroid skeleton. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Steroidal glycosides |
|---|
| Direct Parent | Steroid glucuronide conjugates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Steroid-glucuronide-skeleton
- Androstane-skeleton
- Oxosteroid
- 17-oxosteroid
- 1-o-glucuronide
- O-glucuronide
- Glucuronic acid or derivatives
- Hexose monosaccharide
- Glycosyl compound
- O-glycosyl compound
- Beta-hydroxy acid
- Monosaccharide
- Pyran
- Oxane
- Hydroxy acid
- Ketone
- Secondary alcohol
- Acetal
- Carboxylic acid derivative
- Carboxylic acid
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Monocarboxylic acid or derivatives
- Hydrocarbon derivative
- Organic oxygen compound
- Organic oxide
- Carbonyl group
- Organooxygen compound
- Alcohol
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.91 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.6422 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.71 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2737.3 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 189.9 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 188.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 173.0 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 512.1 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 512.2 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 634.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 174.6 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1065.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 508.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1481.6 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 334.0 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 434.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 307.0 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 216.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 65.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Etiocholanolone glucuronide,1TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3858.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TMS,isomer #2 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3884.7 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TMS,isomer #3 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3873.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TMS,isomer #4 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3817.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3768.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3821.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #10 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3696.7 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #2 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3850.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #3 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3859.5 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #4 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3715.7 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3831.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #6 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3857.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #7 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3730.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #8 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3823.2 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TMS,isomer #9 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3712.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CCC2=O | 3842.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #10 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3674.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #2 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3843.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #3 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3676.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #4 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3851.5 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3706.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #6 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3705.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #7 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3855.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #8 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3686.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TMS,isomer #9 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3709.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,4TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CCC2=O | 3833.5 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,4TMS,isomer #2 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3681.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,4TMS,isomer #3 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3677.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,4TMS,isomer #4 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3694.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,4TMS,isomer #5 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3691.0 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,5TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3657.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,5TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 3792.3 | Standard non polar | 33892256 | | Etiocholanolone glucuronide,5TMS,isomer #1 | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]5O[Si](C)(C)C)CC[C@]34C)[C@@H]1CC=C2O[Si](C)(C)C | 4196.3 | Standard polar | 33892256 | | Etiocholanolone glucuronide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@H]1O | 4098.8 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@@H]1O | 4132.6 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](C(=O)O)O[C@H]1O[C@@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)C(=O)CC[C@H]4[C@@H]3CC[C@@H]2C1 | 4121.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O)[C@@H]1O | 4094.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 3998.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4298.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O)[C@@H]1O | 4168.8 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 4317.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 4304.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 4175.8 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4313.1 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@@H]1O[Si](C)(C)C(C)(C)C | 4317.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 4191.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4315.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 4188.8 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4496.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O | 4355.9 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C | 4490.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C | 4346.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C(=O)O)O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@@H]1O[Si](C)(C)C(C)(C)C | 4506.2 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]5O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 4361.3 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]5O)CC[C@]4(C)[C@H]3CC[C@]12C | 4346.8 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(=O)CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4510.2 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](O[C@@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(O[Si](C)(C)C(C)(C)C)=CC[C@H]5[C@@H]4CC[C@@H]3C2)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O | 4353.4 | Semi standard non polar | 33892256 | | Etiocholanolone glucuronide,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]5O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 4362.2 | Semi standard non polar | 33892256 |
|
|---|