| Chromatographic Method | Retention Time | Reference |
|---|
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 502.8 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 380.0 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 312.5 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 32.7 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 187.1 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 78.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 334.2 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 227.3 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 997.3 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 615.1 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 43.8 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 632.3 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 194.8 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 333.0 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 817.0 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 692.9 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 537.6 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Selenocystine,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(N)C(=O)O | 2353.1 | Semi standard non polar | 33892256 |
| Selenocystine,1TMS,isomer #2 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O)C(=O)O | 2443.2 | Semi standard non polar | 33892256 |
| Selenocystine,2TMS,isomer #1 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(N)C(=O)O[Si](C)(C)C | 2363.0 | Semi standard non polar | 33892256 |
| Selenocystine,2TMS,isomer #2 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O)C(=O)O[Si](C)(C)C | 2403.7 | Semi standard non polar | 33892256 |
| Selenocystine,2TMS,isomer #3 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C)C(=O)O | 2419.3 | Semi standard non polar | 33892256 |
| Selenocystine,2TMS,isomer #4 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O)C(=O)O | 2484.0 | Semi standard non polar | 33892256 |
| Selenocystine,2TMS,isomer #5 | C[Si](C)(C)N(C(C[Se][Se]CC(N)C(=O)O)C(=O)O)[Si](C)(C)C | 2545.6 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2430.9 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2201.1 | Standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2943.5 | Standard polar | 33892256 |
| Selenocystine,3TMS,isomer #2 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2466.9 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #2 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2195.6 | Standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #2 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2711.3 | Standard polar | 33892256 |
| Selenocystine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2498.1 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2222.7 | Standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 3215.8 | Standard polar | 33892256 |
| Selenocystine,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2501.3 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2270.7 | Standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #4 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 3048.0 | Standard polar | 33892256 |
| Selenocystine,3TMS,isomer #5 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2538.7 | Semi standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #5 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2256.3 | Standard non polar | 33892256 |
| Selenocystine,3TMS,isomer #5 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2863.4 | Standard polar | 33892256 |
| Selenocystine,4TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2473.4 | Semi standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2250.9 | Standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2334.1 | Standard polar | 33892256 |
| Selenocystine,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2510.0 | Semi standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2320.5 | Standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #2 | C[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2829.9 | Standard polar | 33892256 |
| Selenocystine,4TMS,isomer #3 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2531.4 | Semi standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #3 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2337.3 | Standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #3 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2513.7 | Standard polar | 33892256 |
| Selenocystine,4TMS,isomer #4 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2524.4 | Semi standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #4 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2312.4 | Standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #4 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2556.6 | Standard polar | 33892256 |
| Selenocystine,4TMS,isomer #5 | C[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2660.2 | Semi standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #5 | C[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2411.1 | Standard non polar | 33892256 |
| Selenocystine,4TMS,isomer #5 | C[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2672.1 | Standard polar | 33892256 |
| Selenocystine,5TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2506.4 | Semi standard non polar | 33892256 |
| Selenocystine,5TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2356.0 | Standard non polar | 33892256 |
| Selenocystine,5TMS,isomer #1 | C[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2260.5 | Standard polar | 33892256 |
| Selenocystine,5TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2658.2 | Semi standard non polar | 33892256 |
| Selenocystine,5TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2444.9 | Standard non polar | 33892256 |
| Selenocystine,5TMS,isomer #2 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2414.5 | Standard polar | 33892256 |
| Selenocystine,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2647.9 | Semi standard non polar | 33892256 |
| Selenocystine,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2465.0 | Standard non polar | 33892256 |
| Selenocystine,6TMS,isomer #1 | C[Si](C)(C)OC(=O)C(C[Se][Se]CC(C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2231.0 | Standard polar | 33892256 |
| Selenocystine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(N)C(=O)O | 2633.4 | Semi standard non polar | 33892256 |
| Selenocystine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O)C(=O)O | 2688.5 | Semi standard non polar | 33892256 |
| Selenocystine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(N)C(=O)O[Si](C)(C)C(C)(C)C | 2868.9 | Semi standard non polar | 33892256 |
| Selenocystine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2911.0 | Semi standard non polar | 33892256 |
| Selenocystine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2907.9 | Semi standard non polar | 33892256 |
| Selenocystine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)O | 2934.1 | Semi standard non polar | 33892256 |
| Selenocystine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(C[Se][Se]CC(N)C(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2984.7 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3131.4 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2765.0 | Standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3046.2 | Standard polar | 33892256 |
| Selenocystine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 3154.4 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2735.2 | Standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2877.7 | Standard polar | 33892256 |
| Selenocystine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3213.7 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2805.7 | Standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)C(C[Se][Se]CC(N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3196.8 | Standard polar | 33892256 |
| Selenocystine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3202.5 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2792.8 | Standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3095.4 | Standard polar | 33892256 |
| Selenocystine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3229.4 | Semi standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2773.4 | Standard non polar | 33892256 |
| Selenocystine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2976.1 | Standard polar | 33892256 |
| Selenocystine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3369.2 | Semi standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2931.3 | Standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2770.8 | Standard polar | 33892256 |
| Selenocystine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3439.1 | Semi standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3007.5 | Standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C(N)C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3025.2 | Standard polar | 33892256 |
| Selenocystine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3461.2 | Semi standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2978.6 | Standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2843.6 | Standard polar | 33892256 |
| Selenocystine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3470.2 | Semi standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2986.3 | Standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC(C[Se][Se]CC(C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2871.8 | Standard polar | 33892256 |
| Selenocystine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3537.9 | Semi standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3019.4 | Standard non polar | 33892256 |
| Selenocystine,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(C[Se][Se]CC(C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2929.3 | Standard polar | 33892256 |