| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.98 minutes | 32390414 |
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.11 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.8252 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.51 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 401.1 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 419.0 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 297.2 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 40.9 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 181.5 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 64.1 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 281.5 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 222.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 902.7 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 558.4 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 38.4 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 636.2 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 196.2 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 289.3 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 768.0 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 613.1 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 405.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| D-Glutamine,1TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H](N)CCC(N)=O | 1579.0 | Semi standard non polar | 33892256 |
| D-Glutamine,1TMS,isomer #2 | C[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O | 1653.3 | Semi standard non polar | 33892256 |
| D-Glutamine,1TMS,isomer #3 | C[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O | 1669.4 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C | 1686.5 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C | 1665.2 | Standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C | 2602.5 | Standard polar | 33892256 |
| D-Glutamine,2TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C | 1666.2 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C | 1748.1 | Standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C | 2515.0 | Standard polar | 33892256 |
| D-Glutamine,2TMS,isomer #3 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O | 1764.4 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #3 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O | 1740.0 | Standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #3 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O | 2447.0 | Standard polar | 33892256 |
| D-Glutamine,2TMS,isomer #4 | C[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C | 1843.8 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #4 | C[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C | 1718.8 | Standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #4 | C[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C | 2792.5 | Standard polar | 33892256 |
| D-Glutamine,2TMS,isomer #5 | C[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C | 1828.4 | Semi standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #5 | C[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C | 1745.6 | Standard non polar | 33892256 |
| D-Glutamine,2TMS,isomer #5 | C[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C | 2968.5 | Standard polar | 33892256 |
| D-Glutamine,3TMS,isomer #1 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1755.3 | Semi standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #1 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1800.8 | Standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #1 | C[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2040.1 | Standard polar | 33892256 |
| D-Glutamine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C)[Si](C)(C)C | 1850.3 | Semi standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C)[Si](C)(C)C | 1783.3 | Standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C)[Si](C)(C)C | 2470.5 | Standard polar | 33892256 |
| D-Glutamine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1784.9 | Semi standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C)[Si](C)(C)C | 1834.5 | Standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C)[Si](C)(C)C | 2348.9 | Standard polar | 33892256 |
| D-Glutamine,3TMS,isomer #4 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1893.9 | Semi standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #4 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 1815.5 | Standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #4 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2221.7 | Standard polar | 33892256 |
| D-Glutamine,3TMS,isomer #5 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1933.1 | Semi standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #5 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 1848.7 | Standard non polar | 33892256 |
| D-Glutamine,3TMS,isomer #5 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2186.6 | Standard polar | 33892256 |
| D-Glutamine,4TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1858.9 | Semi standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1890.5 | Standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #1 | C[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1931.7 | Standard polar | 33892256 |
| D-Glutamine,4TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1915.5 | Semi standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1903.4 | Standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #2 | C[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1968.6 | Standard polar | 33892256 |
| D-Glutamine,4TMS,isomer #3 | C[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2006.9 | Semi standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #3 | C[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1947.5 | Standard non polar | 33892256 |
| D-Glutamine,4TMS,isomer #3 | C[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2068.1 | Standard polar | 33892256 |
| D-Glutamine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2049.8 | Semi standard non polar | 33892256 |
| D-Glutamine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2002.0 | Standard non polar | 33892256 |
| D-Glutamine,5TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 1881.8 | Standard polar | 33892256 |
| D-Glutamine,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CCC(N)=O | 1835.8 | Semi standard non polar | 33892256 |
| D-Glutamine,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O | 1912.9 | Semi standard non polar | 33892256 |
| D-Glutamine,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O | 1926.1 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C(C)(C)C | 2151.7 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C(C)(C)C | 2085.4 | Standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(N)=O)C(=O)O[Si](C)(C)C(C)(C)C | 2619.4 | Standard polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 2130.4 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 2135.4 | Standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 2540.0 | Standard polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O | 2259.2 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O | 2117.9 | Standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O | 2451.5 | Standard polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2290.7 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2139.0 | Standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N([C@H](CCC(N)=O)C(=O)O)[Si](C)(C)C(C)(C)C | 2699.8 | Standard polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C | 2252.5 | Semi standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C | 2171.7 | Standard non polar | 33892256 |
| D-Glutamine,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@@H](N)C(=O)O)[Si](C)(C)C(C)(C)C | 2775.6 | Standard polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2422.6 | Semi standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2352.8 | Standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2348.0 | Standard polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2503.3 | Semi standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2404.1 | Standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(N)=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2582.3 | Standard polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2438.1 | Semi standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2446.1 | Standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](N)CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2504.4 | Standard polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2559.7 | Semi standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2410.7 | Standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2431.4 | Standard polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2584.6 | Semi standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2406.2 | Standard non polar | 33892256 |
| D-Glutamine,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2413.1 | Standard polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2720.3 | Semi standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2624.4 | Standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2380.5 | Standard polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2777.9 | Semi standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2619.2 | Standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NC(=O)CC[C@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2396.9 | Standard polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2866.6 | Semi standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2693.9 | Standard non polar | 33892256 |
| D-Glutamine,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(C(=O)CC[C@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2429.0 | Standard polar | 33892256 |
| D-Glutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3062.8 | Semi standard non polar | 33892256 |
| D-Glutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2883.4 | Standard non polar | 33892256 |
| D-Glutamine,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](CCC(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2422.8 | Standard polar | 33892256 |