| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2006-05-22 15:12:38 UTC |
|---|
| Update Date | 2022-03-07 02:49:18 UTC |
|---|
| HMDB ID | HMDB0003173 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Petunidin |
|---|
| Description | Petunidin, also known as petunidin chloride (CAS: 1429-30-7), belongs to the class of organic compounds known as 3'-O-methylated flavonoids. These are flavonoids with methoxy groups attached to the C3' atom of the flavonoid backbone. Petunidin is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, petunidin has been detected, but not quantified in, several different foods, such as saffrons, french plantains, highbush blueberries, bilberries, and fruits. This could make petunidin a potential biomarker for the consumption of these foods. Petunidin is an anthocyanin. Anthocyanins are water-soluble pigments belonging to the flavonoids compound family that are widespread in nature and involved in numerous functions such as flower, fruit, and seed pigmentation to attract pollinators, seed dispersion, UV light protection, and plant defence against pathogen attack. Because anthocyanins impart much of the colour and flavour of fruits and vegetables, they are usually components of the human diet and are not only considered exclusively as food products but also as therapeutic agents. In fact, anthocyanins have been suggested to protect against oxidative stress, coronary heart diseases, certain cancers, and other age-related diseases. At least part of these presumed health-promoting features can be attributed to the antioxidant properties of these compounds whose chemical structure appears ideal for free radical scavenging (PMID: 16277406 ). BioTransformer predicts that petunidin is a product of peonidin metabolism via a hydroxylation-of-benzene-ortho-to-edg reaction catalyzed by the CYP1A2, CYP2C9, and CYP3A4 enzymes (PMID: 30612223 ). |
|---|
| Structure | COC1=C(O)C(O)=CC(=C1)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1 |
|---|
| Synonyms | | Value | Source |
|---|
| 2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium | ChEBI | | 3,3',4',5,7-Pentahydroxy-5'-methoxyflavylium | ChEBI | | Petunidin chloride | ChEBI | | Petunidol | ChEBI | | Pt | ChEBI | | Petunidin | HMDB |
|
|---|
| Chemical Formula | C16H13O7 |
|---|
| Average Molecular Weight | 317.2702 |
|---|
| Monoisotopic Molecular Weight | 317.06612777 |
|---|
| IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1lambda4-chromen-1-ylium |
|---|
| Traditional Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1lambda4-chromen-1-ylium |
|---|
| CAS Registry Number | 13270-60-5 |
|---|
| SMILES | COC1=C(O)C(O)=CC(=C1)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O |
|---|
| InChI Identifier | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1 |
|---|
| InChI Key | AFOLOMGWVXKIQL-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as 3'-o-methylated flavonoids. These are flavonoids with methoxy groups attached to the C3' atom of the flavonoid backbone. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Phenylpropanoids and polyketides |
|---|
| Class | Flavonoids |
|---|
| Sub Class | O-methylated flavonoids |
|---|
| Direct Parent | 3'-O-methylated flavonoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - 3p-methoxyflavonoid-skeleton
- 3'-hydroxyflavonoid
- 3-hydroxyflavonoid
- 4'-hydroxyflavonoid
- 5-hydroxyflavonoid
- 7-hydroxyflavonoid
- Hydroxyflavonoid
- Anthocyanidin
- Benzopyran
- Methoxyphenol
- 1-benzopyran
- Phenoxy compound
- Anisole
- Methoxybenzene
- Catechol
- Phenol ether
- 1-hydroxy-2-unsubstituted benzenoid
- 1-hydroxy-4-unsubstituted benzenoid
- Alkyl aryl ether
- Phenol
- Benzenoid
- Monocyclic benzene moiety
- Heteroaromatic compound
- Organoheterocyclic compound
- Ether
- Oxacycle
- Polyol
- Organic oxygen compound
- Organooxygen compound
- Hydrocarbon derivative
- Organic cation
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 134.5 mg/L @ 25 °C (est) | The Good Scents Company Information System | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.88 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 13.0468 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.53 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1940.1 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 292.3 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 137.7 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 169.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 309.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 711.7 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 493.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 160.3 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 954.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 414.0 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1503.6 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 359.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 480.1 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 535.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 276.4 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 219.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Petunidin,1TMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C | 3226.6 | Semi standard non polar | 33892256 | | Petunidin,1TMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O | 3295.6 | Semi standard non polar | 33892256 | | Petunidin,1TMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O)=CC(O)=C1O | 3340.4 | Semi standard non polar | 33892256 | | Petunidin,1TMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O)=C1O | 3287.9 | Semi standard non polar | 33892256 | | Petunidin,1TMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O | 3400.8 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C | 3125.0 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #10 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O | 3191.9 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C | 3099.1 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3209.4 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3133.7 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O | 3135.2 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #6 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O | 3116.7 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #7 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3246.8 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #8 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O)=C1O | 3123.4 | Semi standard non polar | 33892256 | | Petunidin,2TMS,isomer #9 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O | 3216.1 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C | 3033.8 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #10 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O | 3031.4 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3047.2 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3018.9 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3042.4 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3009.1 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #6 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3125.1 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #7 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O | 3047.9 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #8 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3065.8 | Semi standard non polar | 33892256 | | Petunidin,3TMS,isomer #9 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3058.7 | Semi standard non polar | 33892256 | | Petunidin,4TMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C | 3059.4 | Semi standard non polar | 33892256 | | Petunidin,4TMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3009.0 | Semi standard non polar | 33892256 | | Petunidin,4TMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3022.8 | Semi standard non polar | 33892256 | | Petunidin,4TMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3007.6 | Semi standard non polar | 33892256 | | Petunidin,4TMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O | 3073.2 | Semi standard non polar | 33892256 | | Petunidin,5TMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C3C=C2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C | 3073.6 | Semi standard non polar | 33892256 | | Petunidin,1TBDMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3584.3 | Semi standard non polar | 33892256 | | Petunidin,1TBDMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3649.8 | Semi standard non polar | 33892256 | | Petunidin,1TBDMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O)=CC(O)=C1O | 3674.1 | Semi standard non polar | 33892256 | | Petunidin,1TBDMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O)=C1O | 3648.4 | Semi standard non polar | 33892256 | | Petunidin,1TBDMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3701.1 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3751.2 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #10 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3818.0 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3736.3 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3826.1 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3775.5 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3769.3 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #6 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3757.3 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #7 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3873.5 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #8 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O)=C1O | 3728.9 | Semi standard non polar | 33892256 | | Petunidin,2TBDMS,isomer #9 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3827.2 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3898.8 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #10 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O | 3847.7 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3885.7 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3866.8 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 3875.0 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3856.3 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #6 | COC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3910.9 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #7 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3907.6 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #8 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3895.8 | Semi standard non polar | 33892256 | | Petunidin,3TBDMS,isomer #9 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 3888.9 | Semi standard non polar | 33892256 | | Petunidin,4TBDMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C | 4009.2 | Semi standard non polar | 33892256 | | Petunidin,4TBDMS,isomer #2 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4004.3 | Semi standard non polar | 33892256 | | Petunidin,4TBDMS,isomer #3 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3997.3 | Semi standard non polar | 33892256 | | Petunidin,4TBDMS,isomer #4 | COC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 3986.2 | Semi standard non polar | 33892256 | | Petunidin,4TBDMS,isomer #5 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O | 4012.2 | Semi standard non polar | 33892256 | | Petunidin,5TBDMS,isomer #1 | COC1=CC(C2=[O+]C3=CC(O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C | 4156.0 | Semi standard non polar | 33892256 |
|
|---|