| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2006-05-22 15:12:11 UTC |
|---|
| Update Date | 2022-03-07 02:49:17 UTC |
|---|
| HMDB ID | HMDB0002802 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Cortisone |
|---|
| Description | Cortisone is a naturally occurring glucocorticoid. It has been used in replacement therapy for adrenal insufficiency and as an anti-inflammatory agent. Cortisone itself is inactive. It is converted in the liver into the active metabolite cortisol. Cortisone is a corticosteroid hormone released by the adrenal gland in response to stress. One of cortisone's effects on the body, and a potentially harmful side effect when administered clinically, is the suppression of the immune system. This is an explanation for the apparent correlation between high stress and sickness. |
|---|
| Structure | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 11-Dehydro-17-hydroxycorticosterone | ChEBI | | 17-Hydroxy-11-dehydrocorticosterone | ChEBI | | 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione | ChEBI | | 4-Pregnene-17alpha,21-diol-3,11,20-trione | ChEBI | | Cortison | ChEBI | | Delta(4)-Pregnene-17alpha,21-diol-3,11,20-trione | ChEBI | | Kendall's compound e | ChEBI | | Kortison | ChEBI | | Pregn-4-en-17alpha,21-diol-3,11,20-trione | ChEBI | | Reichstein's substance fa | ChEBI | | Wintersteiner's compound F | ChEBI | | 17a,21-Dihydroxy-4-pregnene-3,11,20-trione | Generator | | 17Α,21-dihydroxy-4-pregnene-3,11,20-trione | Generator | | 4-Pregnene-17a,21-diol-3,11,20-trione | Generator | | 4-Pregnene-17α,21-diol-3,11,20-trione | Generator | | delta(4)-Pregnene-17a,21-diol-3,11,20-trione | Generator | | Δ(4)-pregnene-17α,21-diol-3,11,20-trione | Generator | | Pregn-4-en-17a,21-diol-3,11,20-trione | Generator | | Pregn-4-en-17α,21-diol-3,11,20-trione | Generator | | Δ(4)-pregnene-17a,21-diol-3,11,20-trione | HMDB | | Andreson | HMDB | | Anusol HC | HMDB | | Balneol-HC | HMDB | | beta-HC | HMDB | | Colocort | HMDB | | Compound e | HMDB | | Corlin | HMDB | | Cortadren | HMDB | | Cortandren | HMDB | | Cortef | HMDB | | Cortef acetate | HMDB | | Cortisal | HMDB | | Cortisate | HMDB | | Cortisone acetate | HMDB | | Cortistal | HMDB | | Cortivite | HMDB | | Cortogen | HMDB | | Cortone | HMDB | | Cortril | HMDB | | Dermacort | HMDB | | Dricort | HMDB | | Flexicort | HMDB | | Florinef | HMDB | | Fludrocortisone acetate | HMDB | | Glycort | HMDB | | Hemsol-HC | HMDB | | Hi-cor | HMDB | | Incortin | HMDB | | Kendall'S compound | HMDB | | Locoid | HMDB | | Locoid lipocream | HMDB | | Micort-HC | HMDB | | Nogenic HC | HMDB | | Orabase hca | HMDB | | Pandel | HMDB | | Prestwick_132 | HMDB | | Reichstein fa | HMDB | | Scheroson | HMDB | | Solu-cortef | HMDB | | Stie-cort | HMDB | | Texacort | HMDB | | Westcort | HMDB | | Adreson | HMDB | | Cortone acetate | HMDB | | 17-Hydroxy-3,11,20-trioxopregn-4-en-21-yl acetate | HMDB |
|
|---|
| Chemical Formula | C21H28O5 |
|---|
| Average Molecular Weight | 360.444 |
|---|
| Monoisotopic Molecular Weight | 360.193674006 |
|---|
| IUPAC Name | (1S,2R,10S,11S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-ene-5,17-dione |
|---|
| Traditional Name | (1S,2R,10S,11S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-ene-5,17-dione |
|---|
| CAS Registry Number | 53-06-5 |
|---|
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
|---|
| InChI Key | MFYSYFVPBJMHGN-ZPOLXVRWSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Hydroxysteroids |
|---|
| Direct Parent | 21-hydroxysteroids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 21-hydroxysteroid
- Pregnane-skeleton
- 20-oxosteroid
- 3-oxo-delta-4-steroid
- 3-oxosteroid
- 17-hydroxysteroid
- Oxosteroid
- 11-oxosteroid
- Delta-4-steroid
- Cyclohexenone
- Alpha-hydroxy ketone
- Cyclic alcohol
- Tertiary alcohol
- Cyclic ketone
- Ketone
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Carbonyl group
- Organic oxygen compound
- Organooxygen compound
- Primary alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 222 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.28 mg/mL at 25 °C | Not Available | | LogP | 1.47 | HANSCH,C ET AL. (1995) |
|
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 4.94 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.8573 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 1.16 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2372.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 198.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 173.2 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 166.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 159.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 463.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 511.1 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 122.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 952.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 397.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1326.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 280.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 382.7 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 309.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 235.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 64.0 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Cortisone,1TMS,isomer #1 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3372.5 | Semi standard non polar | 33892256 | | Cortisone,1TMS,isomer #2 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3351.2 | Semi standard non polar | 33892256 | | Cortisone,1TMS,isomer #3 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3197.4 | Semi standard non polar | 33892256 | | Cortisone,1TMS,isomer #4 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3311.8 | Semi standard non polar | 33892256 | | Cortisone,1TMS,isomer #5 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3251.7 | Semi standard non polar | 33892256 | | Cortisone,1TMS,isomer #6 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO | 3302.2 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #1 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3406.5 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #10 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3084.8 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #11 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3111.2 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #12 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3133.4 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #13 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3234.8 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #14 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3102.4 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3183.7 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #3 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3241.2 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #4 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3296.3 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #5 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3321.8 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #6 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3181.9 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #7 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3214.4 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #8 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3270.6 | Semi standard non polar | 33892256 | | Cortisone,2TMS,isomer #9 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3347.5 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #1 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3208.2 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #1 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3164.8 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #1 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3552.4 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #10 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3070.8 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #10 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3236.4 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #10 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3623.7 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #11 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3102.9 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #11 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3124.4 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #11 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3624.4 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #12 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3078.3 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #12 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3175.5 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #12 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO[Si](C)(C)C | 3722.0 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #13 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3127.1 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #13 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3033.8 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #13 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3708.7 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #14 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3206.2 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #14 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3118.3 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #14 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3604.5 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #15 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3017.4 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #15 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3146.3 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #15 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3683.2 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #16 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3013.6 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #16 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3092.2 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #16 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C | 3768.3 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3253.1 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3097.0 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3595.5 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #3 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3316.7 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #3 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3160.7 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #3 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3527.3 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #4 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3348.2 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #4 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3092.5 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #4 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3521.7 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #5 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3096.1 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #5 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3199.1 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #5 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3603.3 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #6 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3117.8 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #6 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3088.3 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #6 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3586.6 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3112.2 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3149.8 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO | 3648.3 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #8 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3138.9 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #8 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3020.8 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #8 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3635.7 | Standard polar | 33892256 | | Cortisone,3TMS,isomer #9 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3235.0 | Semi standard non polar | 33892256 | | Cortisone,3TMS,isomer #9 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3083.2 | Standard non polar | 33892256 | | Cortisone,3TMS,isomer #9 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3570.7 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3102.7 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3258.3 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3477.8 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3137.2 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3150.0 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #2 | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3496.4 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #3 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3124.9 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #3 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3213.8 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #3 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=O)CO[Si](C)(C)C | 3525.0 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #4 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3162.3 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #4 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3094.4 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #4 | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3537.1 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #5 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3220.3 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #5 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3147.6 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #5 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(O[Si](C)(C)C)=CC[C@@]43C)[C@@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3479.5 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #6 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3056.0 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #6 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3202.4 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #6 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3554.1 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3059.9 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3155.0 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #7 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO)O[Si](C)(C)C | 3599.7 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #8 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3007.7 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #8 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3223.8 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #8 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3609.6 | Standard polar | 33892256 | | Cortisone,4TMS,isomer #9 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3014.0 | Semi standard non polar | 33892256 | | Cortisone,4TMS,isomer #9 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3166.5 | Standard non polar | 33892256 | | Cortisone,4TMS,isomer #9 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3691.0 | Standard polar | 33892256 | | Cortisone,5TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3039.2 | Semi standard non polar | 33892256 | | Cortisone,5TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3257.0 | Standard non polar | 33892256 | | Cortisone,5TMS,isomer #1 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1C2=C(O[Si](C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3457.1 | Standard polar | 33892256 | | Cortisone,5TMS,isomer #2 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3047.5 | Semi standard non polar | 33892256 | | Cortisone,5TMS,isomer #2 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3208.4 | Standard non polar | 33892256 | | Cortisone,5TMS,isomer #2 | C[C@]12CC=C(O[Si](C)(C)C)C=C1CC[C@@H]1[C@@H]2C(O[Si](C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C)C(=CO[Si](C)(C)C)O[Si](C)(C)C | 3504.3 | Standard polar | 33892256 | | Cortisone,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@]1(C(=O)CO)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3617.2 | Semi standard non polar | 33892256 | | Cortisone,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3631.2 | Semi standard non polar | 33892256 | | Cortisone,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC1=C2[C@@H](CCC3=CC(=O)CC[C@@]32C)[C@@H]2CC[C@](O)(C(=O)CO)[C@@]2(C)C1 | 3437.5 | Semi standard non polar | 33892256 | | Cortisone,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3558.2 | Semi standard non polar | 33892256 | | Cortisone,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O)C(=O)CO)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3483.4 | Semi standard non polar | 33892256 | | Cortisone,1TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=O)CO)[C@@]3(C)CC(=O)[C@@H]12 | 3556.0 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3900.9 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3542.9 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3566.4 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O)(C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC(=O)[C@@H]12 | 3704.1 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3589.4 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 3570.4 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC1=C2[C@@H](CCC3=CC(=O)CC[C@@]32C)[C@@H]2CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)CO)[C@@]2(C)C1 | 3629.2 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3838.8 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)CO)[C@@]3(C)CC(=O)[C@@H]12 | 3774.7 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3701.8 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3653.1 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3824.9 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3767.1 | Semi standard non polar | 33892256 | | Cortisone,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3689.1 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3887.3 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3846.5 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3798.5 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3751.8 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3773.7 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3884.6 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3721.8 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3816.4 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3882.3 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3885.8 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3702.1 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3867.6 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3783.9 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3610.3 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3943.5 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3740.9 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3640.4 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3952.7 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3682.4 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3693.8 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3953.5 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3697.3 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 3551.1 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O)C(=CO)O[Si](C)(C)C(C)(C)C | 4022.8 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 4086.7 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3734.4 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3756.9 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 4025.2 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3781.0 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3756.7 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3932.2 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3674.1 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3796.1 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3746.7 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3773.7 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3846.8 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3794.0 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3727.8 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC(=CO)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3818.5 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC(=O)[C@@H]12 | 3945.0 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC(=O)[C@@H]12 | 3670.6 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CC[C@](O[Si](C)(C)C(C)(C)C)(C(=CO)O[Si](C)(C)C(C)(C)C)[C@@]3(C)CC(=O)[C@@H]12 | 3815.7 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3825.0 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3579.1 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC1=C[C@@]2(C)[C@@H](CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C)[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@@H]12 | 3834.3 | Standard polar | 33892256 | | Cortisone,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3770.6 | Semi standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3606.8 | Standard non polar | 33892256 | | Cortisone,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=O)CO | 3868.8 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3966.7 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3944.4 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3747.4 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3935.9 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3961.9 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3743.9 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 4127.0 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3870.9 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(=O)C[C@@]21C | 3723.3 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 4016.1 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3800.8 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3758.1 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3956.6 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3800.4 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OCC(=O)[C@@]1(O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3753.3 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3896.7 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3866.7 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1C2=C(O[Si](C)(C)C(C)(C)C)C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3817.2 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3903.1 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3740.8 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)OC1=CC[C@@]2(C)C(=C1)CC[C@@H]1[C@@H]2C(O[Si](C)(C)C(C)(C)C)=C[C@@]2(C)[C@H]1CC[C@]2(O[Si](C)(C)C(C)(C)C)C(=CO)O[Si](C)(C)C(C)(C)C | 3843.3 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3845.5 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3897.0 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)C3=C(O[Si](C)(C)C(C)(C)C)C[C@@]21C | 3890.5 | Standard polar | 33892256 | | Cortisone,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3868.2 | Semi standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3756.9 | Standard non polar | 33892256 | | Cortisone,4TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OC=C(O[Si](C)(C)C(C)(C)C)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(O[Si](C)(C)C(C)(C)C)=CC[C@]4(C)[C@H]3C(O[Si](C)(C)C(C)(C)C)=C[C@@]21C | 3959.4 | Standard polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental GC-MS | GC-MS Spectrum - Cortisone GC-EI-TOF (Non-derivatized) | splash10-00kf-2910000000-da435cee921dd7b9f8e6 | 2017-09-12 | HMDB team, MONA, MassBank | View Spectrum | | Experimental GC-MS | GC-MS Spectrum - Cortisone GC-EI-TOF (Non-derivatized) | splash10-00kf-2910000000-da435cee921dd7b9f8e6 | 2018-05-18 | HMDB team, MONA, MassBank | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisone GC-MS (Non-derivatized) - 70eV, Positive | splash10-05ai-5879000000-d8ce750671bf51b487e2 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisone GC-MS (2 TMS) - 70eV, Positive | splash10-0f79-2918800000-ab308a6a5023c34bc22f | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisone GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Cortisone GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Quattro_QQQ 10V, Positive-QTOF (Annotated) | splash10-03di-0009000000-5d34de066e82cc9f0a41 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Quattro_QQQ 25V, Positive-QTOF (Annotated) | splash10-03di-0900000000-24ec04976da03c3f9c77 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Quattro_QQQ 40V, Positive-QTOF (Annotated) | splash10-0fdo-4900000000-d0880bfc6f3d80e4aa72 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-qTof , Positive-QTOF | splash10-03di-3940000000-16be8720b1c49cea9b06 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-004i-0009000000-6c22c083c2dfab97a299 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-004i-0109000000-48c96b3d1471c5cd6171 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-002r-0914000000-2466a9146383b4265e42 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-000i-0900000000-214430a00501054cc774 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-059j-1900000000-0e23516e07f0baf74c79 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-0abj-1900000000-ad0282ab7188d9ec3dc1 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-0aba-3900000000-e36e464b157b3e6159f1 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-0a4j-5900000000-fe9092d76099e1e70a4e | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone LC-ESI-QFT , negative-QTOF | splash10-0aou-6900000000-1b218b97a890ac7e8f45 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-03fr-0049000000-3bd424d473bdadd2b9b4 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-03di-0039000000-fd181dfb87e1cbb8ab6f | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-03di-0049000000-7633496a1a53bda21707 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-004i-0009000000-59db5e627634e4be3907 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-004i-0009000000-9781e204df305d722d2d | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Cortisone Linear Ion Trap , negative-QTOF | splash10-004i-0009000000-0b5e40226163a1a334db | 2017-09-14 | HMDB team, MONA | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 10V, Positive-QTOF | splash10-03dl-0009000000-946472abc72d41b1633c | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 20V, Positive-QTOF | splash10-003u-0149000000-efb3f94efcbdfc468859 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 40V, Positive-QTOF | splash10-0a5j-2392000000-d014016e46f2ae8b1bd1 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 10V, Negative-QTOF | splash10-0a4i-0009000000-1c4a8c3698ff1bfa2bd9 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 20V, Negative-QTOF | splash10-0pb9-2029000000-82b546174619108311f8 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Cortisone 40V, Negative-QTOF | splash10-0ab9-8093000000-47f7996c84edb1324aad | 2017-09-01 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Predicted 1D NMR | 13C NMR Spectrum (1D, 100 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 100 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 200 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 200 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 300 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 300 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 400 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 400 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 500 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 500 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 600 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 600 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 700 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 700 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 800 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 800 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 900 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 900 MHz, H2O, predicted) | 2022-08-22 | Wishart Lab | View Spectrum | | Experimental 2D NMR | [1H, 13C]-HSQC NMR Spectrum (2D, 600 MHz, 100%_DMSO, experimental) | 2012-12-05 | Wishart Lab | View Spectrum |
|
|---|
| General References | - Bolt RJ, Van Weissenbruch MM, Popp-Snijders C, Sweep FG, Lafeber HN, Delemarre-van de Waal HA: Maturity of the adrenal cortex in very preterm infants is related to gestational age. Pediatr Res. 2002 Sep;52(3):405-10. [PubMed:12193676 ]
- AvRuskin TW, Krishnan N, Juan CS: Congenital adrenal hypoplasia and male pseudohermaphroditism due to DAX1 mutation, SF1 mutation or neither: a patient report. J Pediatr Endocrinol Metab. 2004 Aug;17(8):1125-32. [PubMed:15379426 ]
- Zuber M, Miesel R, Brandl B: A patient with a high titer of antinuclear antibody and a functioning adrenal tumour. Clin Rheumatol. 1995 Jan;14(1):100-3. [PubMed:7743733 ]
- Edwin B, Raeder I, Trondsen E, Kaaresen R, Buanes T: Outpatient laparoscopic adrenalectomy in patients with Conn's syndrome. Surg Endosc. 2001 Jun;15(6):589-91. Epub 2001 Mar 13. [PubMed:11591947 ]
- Onyimba CU, Vijapurapu N, Curnow SJ, Khosla P, Stewart PM, Murray PI, Walker EA, Rauz S: Characterisation of the prereceptor regulation of glucocorticoids in the anterior segment of the rabbit eye. J Endocrinol. 2006 Aug;190(2):483-93. [PubMed:16899581 ]
- Weigand A, Hinzpeter B, Schicha H: [Deterioration of endocrine ophthalmology after radioiodine therapy in Graves' disease?]. Nuklearmedizin. 1998;37(7):234-8. [PubMed:9830613 ]
- Mark PJ, Waddell BJ: P-glycoprotein restricts access of cortisol and dexamethasone to the glucocorticoid receptor in placental BeWo cells. Endocrinology. 2006 Nov;147(11):5147-52. Epub 2006 Jul 27. [PubMed:16873536 ]
- Sandeep TC, Andrew R, Homer NZ, Andrews RC, Smith K, Walker BR: Increased in vivo regeneration of cortisol in adipose tissue in human obesity and effects of the 11beta-hydroxysteroid dehydrogenase type 1 inhibitor carbenoxolone. Diabetes. 2005 Mar;54(3):872-9. [PubMed:15734867 ]
- Pepe GJ, Albrecht ED: Regulation of the primate fetal adrenal cortex. Endocr Rev. 1990 Feb;11(1):151-76. [PubMed:2180686 ]
- Boman HG: Innate immunity and the normal microflora. Immunol Rev. 2000 Feb;173:5-16. [PubMed:10719663 ]
- Andrew R, Westerbacka J, Wahren J, Yki-Jarvinen H, Walker BR: The contribution of visceral adipose tissue to splanchnic cortisol production in healthy humans. Diabetes. 2005 May;54(5):1364-70. [PubMed:15855321 ]
- Sharma KK, Lindqvist A, Zhou XJ, Auchus RJ, Penning TM, Andersson S: Deoxycorticosterone inactivation by AKR1C3 in human mineralocorticoid target tissues. Mol Cell Endocrinol. 2006 Mar 27;248(1-2):79-86. Epub 2005 Dec 5. [PubMed:16337083 ]
- Draper N, Stewart PM: 11beta-hydroxysteroid dehydrogenase and the pre-receptor regulation of corticosteroid hormone action. J Endocrinol. 2005 Aug;186(2):251-71. [PubMed:16079253 ]
- Ferrari P, Bianchetti M, Frey FJ: Juvenile hypertension, the role of genetically altered steroid metabolism. Horm Res. 2001;55(5):213-23. [PubMed:11740142 ]
- Stormer FC, Reistad R, Alexander J: Glycyrrhizic acid in liquorice--evaluation of health hazard. Food Chem Toxicol. 1993 Apr;31(4):303-12. [PubMed:8386690 ]
- Jiang JQ, Wang DS, Senthilkumaran B, Kobayashi T, Kobayashi HK, Yamaguchi A, Ge W, Young G, Nagahama Y: Isolation, characterization and expression of 11beta-hydroxysteroid dehydrogenase type 2 cDNAs from the testes of Japanese eel (Anguilla japonica) and Nile tilapia (Oreochromis niloticus). J Mol Endocrinol. 2003 Oct;31(2):305-15. [PubMed:14519098 ]
- Elshenawy S, Pinney SE, Stuart T, Doulias PT, Zura G, Parry S, Elovitz MA, Bennett MJ, Bansal A, Strauss JF 3rd, Ischiropoulos H, Simmons RA: The Metabolomic Signature of the Placenta in Spontaneous Preterm Birth. Int J Mol Sci. 2020 Feb 4;21(3). pii: ijms21031043. doi: 10.3390/ijms21031043. [PubMed:32033212 ]
|
|---|