| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected but not Quantified |
|---|
| Creation Date | 2006-05-18 08:52:05 UTC |
|---|
| Update Date | 2022-03-07 02:49:11 UTC |
|---|
| HMDB ID | HMDB0001933 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Furosemide |
|---|
| Description | Furosemide or frusemide is a loop diuretic used in the treatment of congestive heart failure and edema. It is most commonly marketed by Aventis Pharma under the brand name Lasix. It has also been used to prevent thoroughbred race horses from bleeding through the nose during races. An antibiotic isolated from the fermentation broth of Fusidium coccineum. (From Merck Index, 11th ed) It acts by inhibiting translocation during protein synthesis. |
|---|
| Structure | NS(=O)(=O)C1=C(Cl)C=C(NCC2=CC=CO2)C(=C1)C(O)=O InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
|---|
| Synonyms | | Value | Source |
|---|
| 2-Furfurylamino-4-chloro-5-sulfamoylbenzoic acid | ChEBI | | 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilic acid | ChEBI | | 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilic acid | ChEBI | | 4-Chloro-N-furfuryl-5-sulfamoylanthranilic acid | ChEBI | | Frusemide | ChEBI | | Lasix | ChEBI | | 2-Furfurylamino-4-chloro-5-sulfamoylbenzoate | Generator | | 2-Furfurylamino-4-chloro-5-sulphamoylbenzoate | Generator | | 2-Furfurylamino-4-chloro-5-sulphamoylbenzoic acid | Generator | | 4-Chloro-5-sulfamoyl-N-furfuryl-anthranilate | Generator | | 4-Chloro-5-sulphamoyl-N-furfuryl-anthranilate | Generator | | 4-Chloro-5-sulphamoyl-N-furfuryl-anthranilic acid | Generator | | 4-Chloro-N-(2-furylmethyl)-5-sulfamoylanthranilate | Generator | | 4-Chloro-N-(2-furylmethyl)-5-sulphamoylanthranilate | Generator | | 4-Chloro-N-(2-furylmethyl)-5-sulphamoylanthranilic acid | Generator | | 4-Chloro-N-furfuryl-5-sulfamoylanthranilate | Generator | | 4-Chloro-N-furfuryl-5-sulphamoylanthranilate | Generator | | 4-Chloro-N-furfuryl-5-sulphamoylanthranilic acid | Generator | | Acetic acid potassium salt | HMDB | | Aisemide | HMDB | | Aldalix | HMDB | | Aldic | HMDB | | Aluzine | HMDB | | Anfuramaide | HMDB | | Apo-frusemide | HMDB | | Apo-furosemide | HMDB | | Aquarid | HMDB | | Aquasin | HMDB | | Arasemide | HMDB | | Beronald | HMDB | | Bioretic | HMDB | | Cetasix | HMDB | | Depix | HMDB | | Desal | HMDB | | Desdemin | HMDB | | Dirine | HMDB | | Disal | HMDB | | Discoid | HMDB | | Disemide | HMDB | | Diural | HMDB | | Diurapid | HMDB | | Diuretic salt | HMDB | | Diurin | HMDB | | Diurolasa | HMDB | | Diusemide | HMDB | | Diusil | HMDB | | Diuzol | HMDB | | Dranex | HMDB | | Dryptal | HMDB | | Durafurid | HMDB | | Edemid | HMDB | | Edenol | HMDB | | Eliur | HMDB | | Endural | HMDB | | Errolon | HMDB | | Eutensin | HMDB | | Farsix | HMDB | | Fluidrol | HMDB | | Fluss | HMDB | | Franyl | HMDB | | Frumex | HMDB | | Frumide | HMDB | | Frumil | HMDB | | Frusedan | HMDB | | Frusema | HMDB | | Frusemid | HMDB | | Frusemin | HMDB | | Frusenex | HMDB | | Frusetic | HMDB | | Frusid | HMDB | | Fulsix | HMDB | | Fuluvamide | HMDB | | Fuluvamine | HMDB | | Furanthril | HMDB | | Furanthryl | HMDB | | Furantril | HMDB | | Furanturil | HMDB | | Furesis | HMDB | | Furetic | HMDB | | Furex | HMDB | | Furfan | HMDB | | Furix | HMDB | | Furmid | HMDB | | Furo-basan | HMDB | | Furo-puren | HMDB | | Furobeta | HMDB | | Furocot | HMDB | | Furodiurol | HMDB | | Furodrix | HMDB | | Furomen | HMDB | | Furomex | HMDB | | Furomide m.d. | HMDB | | Furorese | HMDB | | Furosan | HMDB | | Furose | HMDB | | Furosedon | HMDB | | Furosemid | HMDB | | Furosemida | HMDB | | Furosemide "mita" | HMDB | | Furosemidu | HMDB | | Furosemidum | HMDB | | Furosemix | HMDB | | Furoside | HMDB | | Furosifar | HMDB | | Furosix | HMDB | | Furoter | HMDB | | Furovite | HMDB | | Fursemid | HMDB | | Fursemida | HMDB | | Fursemide | HMDB | | Fursol | HMDB | | Fusid | HMDB | | Fusidic acid | HMDB | | Golan | HMDB | | Hissuflux | HMDB | | Hydrex | HMDB | | Hydro | HMDB | | Hydro-rapid | HMDB | | Hydroled | HMDB | | Impugan | HMDB | | Jenafusid | HMDB | | Katlex | HMDB | | Kofuzon | HMDB | | Kolkin | HMDB | | Kutrix | HMDB | | Lasemid | HMDB | | Lasex | HMDB | | Lasiletten | HMDB | | Lasilix | HMDB | | Lasix retard | HMDB | | Laxur | HMDB | | Lazix | HMDB | | Less diur | HMDB | | Liside | HMDB | | Logirene | HMDB | | Lowpston | HMDB | | Lowpstron | HMDB | | Luscek | HMDB | | Macasirool | HMDB | | Marsemide | HMDB | | Mirfat | HMDB | | Mita | HMDB | | Moilarorin | HMDB | | Nadis | HMDB | | Nelsix | HMDB | | Neo-renal | HMDB | | Nephron | HMDB | | Nicorol | HMDB | | Novosemide | HMDB | | Octan draselny | HMDB | | Odemase | HMDB | | Odemex | HMDB | | Oedemex | HMDB | | Osyrol | HMDB | | Polysquall a | HMDB | | Prefemin | HMDB | | Profemin | HMDB | | Promedes | HMDB | | Promide | HMDB | | Protargen | HMDB | | Puresis | HMDB | | Radisemide | HMDB | | Radonna | HMDB | | Radouna | HMDB | | Retep | HMDB | | Rosemide | HMDB | | Rosis | HMDB | | Rusyde | HMDB | | Sal diureticum | HMDB | | Salinex | HMDB | | Salix | HMDB | | Salurex | HMDB | | Salurid | HMDB | | Seguril | HMDB | | Selectofur | HMDB | | Sigasalur | HMDB | | Spirofur | HMDB | | Synephron | HMDB | | Transit | HMDB | | Trofurit | HMDB | | Uremide | HMDB | | Uresix | HMDB | | Urex | HMDB | | Urex-m | HMDB | | Urian | HMDB | | Uridon | HMDB | | Uritol | HMDB | | Urosemide | HMDB | | Vesix | HMDB | | Yidoli | HMDB | | Zafimida | HMDB | | Furantral | HMDB | | Furosemide monohydrochloride | HMDB | | Salix (brand OF furosemide) | HMDB | | Furosemide monosodium salt | HMDB |
|
|---|
| Chemical Formula | C12H11ClN2O5S |
|---|
| Average Molecular Weight | 330.744 |
|---|
| Monoisotopic Molecular Weight | 330.007719869 |
|---|
| IUPAC Name | 4-chloro-2-{[(furan-2-yl)methyl]amino}-5-sulfamoylbenzoic acid |
|---|
| Traditional Name | furosemide |
|---|
| CAS Registry Number | 54-31-9 |
|---|
| SMILES | NS(=O)(=O)C1=C(Cl)C=C(NCC2=CC=CO2)C(=C1)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C12H11ClN2O5S/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19/h1-5,15H,6H2,(H,16,17)(H2,14,18,19) |
|---|
| InChI Key | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as aminobenzenesulfonamides. These are organic compounds containing a benzenesulfonamide moiety with an amine group attached to the benzene ring. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Benzenesulfonamides |
|---|
| Direct Parent | Aminobenzenesulfonamides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Aminobenzenesulfonamide
- 4-halobenzoic acid or derivatives
- Aminobenzoic acid
- Aminobenzoic acid or derivatives
- Halobenzoic acid or derivatives
- 4-halobenzoic acid
- Halobenzoic acid
- Benzenesulfonyl group
- Benzoic acid
- Benzoic acid or derivatives
- Aniline or substituted anilines
- Phenylalkylamine
- Benzoyl
- Aralkylamine
- Secondary aliphatic/aromatic amine
- Halobenzene
- Chlorobenzene
- Organosulfonic acid amide
- Aryl chloride
- Aryl halide
- Furan
- Heteroaromatic compound
- Sulfonyl
- Organosulfonic acid or derivatives
- Organic sulfonic acid or derivatives
- Aminosulfonyl compound
- Vinylogous amide
- Amino acid or derivatives
- Amino acid
- Oxacycle
- Organoheterocyclic compound
- Secondary amine
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Organopnictogen compound
- Organosulfur compound
- Organic oxygen compound
- Organic nitrogen compound
- Amine
- Hydrocarbon derivative
- Organic oxide
- Organooxygen compound
- Organonitrogen compound
- Organochloride
- Organohalogen compound
- Aromatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aromatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 295 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.073 mg/mL at 30 °C | Not Available | | LogP | 2.03 | SANGSTER (1993) |
|
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 5.22 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.3538 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 3.52 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 30.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1315.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 285.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 120.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 180.3 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 81.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 305.6 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 518.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 226.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 886.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 350.2 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1137.0 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 278.3 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 315.7 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 403.2 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 234.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 168.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Furosemide,1TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1NCC1=CC=CO1 | 3043.9 | Semi standard non polar | 33892256 | | Furosemide,1TMS,isomer #2 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3102.7 | Semi standard non polar | 33892256 | | Furosemide,1TMS,isomer #3 | C[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(N)(=O)=O)C=C1C(=O)O | 2896.6 | Semi standard non polar | 33892256 | | Furosemide,2TMS,isomer #1 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 3006.3 | Semi standard non polar | 33892256 | | Furosemide,2TMS,isomer #1 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 2969.5 | Standard non polar | 33892256 | | Furosemide,2TMS,isomer #1 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 3673.4 | Standard polar | 33892256 | | Furosemide,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 2883.3 | Semi standard non polar | 33892256 | | Furosemide,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 2961.3 | Standard non polar | 33892256 | | Furosemide,2TMS,isomer #2 | C[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 4196.6 | Standard polar | 33892256 | | Furosemide,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 2995.9 | Semi standard non polar | 33892256 | | Furosemide,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3044.7 | Standard non polar | 33892256 | | Furosemide,2TMS,isomer #3 | C[Si](C)(C)N([Si](C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3875.9 | Standard polar | 33892256 | | Furosemide,2TMS,isomer #4 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 2897.7 | Semi standard non polar | 33892256 | | Furosemide,2TMS,isomer #4 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 3004.1 | Standard non polar | 33892256 | | Furosemide,2TMS,isomer #4 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 3660.1 | Standard polar | 33892256 | | Furosemide,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 2962.6 | Semi standard non polar | 33892256 | | Furosemide,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 3149.7 | Standard non polar | 33892256 | | Furosemide,3TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 3577.4 | Standard polar | 33892256 | | Furosemide,3TMS,isomer #2 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 2845.2 | Semi standard non polar | 33892256 | | Furosemide,3TMS,isomer #2 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 3073.5 | Standard non polar | 33892256 | | Furosemide,3TMS,isomer #2 | C[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C)C=C1Cl | 3377.9 | Standard polar | 33892256 | | Furosemide,3TMS,isomer #3 | C[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)C=C1C(=O)O | 2855.7 | Semi standard non polar | 33892256 | | Furosemide,3TMS,isomer #3 | C[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)C=C1C(=O)O | 3186.6 | Standard non polar | 33892256 | | Furosemide,3TMS,isomer #3 | C[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)C=C1C(=O)O | 3551.6 | Standard polar | 33892256 | | Furosemide,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 2878.4 | Semi standard non polar | 33892256 | | Furosemide,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 3252.0 | Standard non polar | 33892256 | | Furosemide,4TMS,isomer #1 | C[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C)[Si](C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C | 3347.6 | Standard polar | 33892256 | | Furosemide,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1NCC1=CC=CO1 | 3275.4 | Semi standard non polar | 33892256 | | Furosemide,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3325.1 | Semi standard non polar | 33892256 | | Furosemide,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(N)(=O)=O)C=C1C(=O)O | 3170.5 | Semi standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 3442.8 | Semi standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 3487.0 | Standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(NCC2=CC=CO2)C=C1Cl | 3718.1 | Standard polar | 33892256 | | Furosemide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 3351.5 | Semi standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 3434.1 | Standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(N)(=O)=O)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 4181.5 | Standard polar | 33892256 | | Furosemide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3476.3 | Semi standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3537.1 | Standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N([Si](C)(C)C(C)(C)C)S(=O)(=O)C1=CC(C(=O)O)=C(NCC2=CC=CO2)C=C1Cl | 3837.4 | Standard polar | 33892256 | | Furosemide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3351.6 | Semi standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3505.7 | Standard non polar | 33892256 | | Furosemide,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3697.7 | Standard polar | 33892256 | | Furosemide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 3635.7 | Semi standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 3869.9 | Standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1NCC1=CC=CO1 | 3676.5 | Standard polar | 33892256 | | Furosemide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3491.6 | Semi standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3829.1 | Standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NS(=O)(=O)C1=CC(C(=O)O[Si](C)(C)C(C)(C)C)=C(N(CC2=CC=CO2)[Si](C)(C)C(C)(C)C)C=C1Cl | 3567.0 | Standard polar | 33892256 | | Furosemide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1C(=O)O | 3558.2 | Semi standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1C(=O)O | 3900.3 | Standard non polar | 33892256 | | Furosemide,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CC1=CC=CO1)C1=CC(Cl)=C(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C=C1C(=O)O | 3652.7 | Standard polar | 33892256 | | Furosemide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 3727.7 | Semi standard non polar | 33892256 | | Furosemide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 4193.2 | Standard non polar | 33892256 | | Furosemide,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)C1=CC(S(=O)(=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C(Cl)C=C1N(CC1=CC=CO1)[Si](C)(C)C(C)(C)C | 3553.0 | Standard polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - Furosemide GC-MS (Non-derivatized) - 70eV, Positive | splash10-0gxa-6293000000-f457e26eb77dd682fe06 | 2017-08-28 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Furosemide GC-MS (1 TMS) - 70eV, Positive | splash10-0089-9005000000-e4a5fbc3253373e3940f | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - Furosemide GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide Quattro_QQQ 10V, N/A-QTOF (Annotated) | splash10-03dr-0090000000-da505a3f09285d049f34 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide Quattro_QQQ 25V, N/A-QTOF (Annotated) | splash10-0f89-2190000000-53c91100e89c81f0fa30 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide Quattro_QQQ 40V, N/A-QTOF (Annotated) | splash10-01ox-9660000000-83d8486cbca0dd3487c9 | 2012-07-25 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-000i-0090000000-f3a3dcb92cfcdff9f7dc | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-0019000000-946089b12d2ab6fd05a4 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-000i-0090000000-04af1dec204d462d4bc4 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-0udi-1090000000-1af70d23e1a0ebaa0878 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9770000000-0c5cd578b5b69a1a61d4 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9800000000-3303b20f9b23e24ae312 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9400000000-23cfec716ac8fbcb092f | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-0019000000-e73aa1d969ab4255732b | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-000i-0090000000-33053544119c01ac6b45 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-0udi-1090000000-7029ab63efa73a3ff88d | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9670000000-4bad8928bbcfc85f431f | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9800000000-2193e38e314f2b18be26 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-004i-9600000000-e703f7ab6221182df156 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-000i-0090000000-f3645e993869ff3886ba | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-000i-0090000000-18400153a811f7100a2f | 2017-09-14 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - Furosemide LC-ESI-ITFT , negative-QTOF | splash10-0f79-0090000000-7e491b92dab050fb81c0 | 2017-09-14 | HMDB team, MONA | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 10V, Positive-QTOF | splash10-001i-0029000000-8dad548395d661a23aeb | 2017-07-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 20V, Positive-QTOF | splash10-01q0-0095000000-9350244c3603284fb554 | 2017-07-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 40V, Positive-QTOF | splash10-05o0-0290000000-6f3a7c51c8cbbf91e9a0 | 2017-07-25 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 10V, Negative-QTOF | splash10-004r-1097000000-a65ddeb1624425b6a0b7 | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 20V, Negative-QTOF | splash10-004r-4091000000-73474c5bbe697da9eb13 | 2017-07-26 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - Furosemide 40V, Negative-QTOF | splash10-004i-9010000000-611ee6d1e47c2cd8a7d8 | 2017-07-26 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Experimental 1D NMR | 1H NMR Spectrum (1D, 600 MHz, H2O, experimental) | 2012-12-05 | Wishart Lab | View Spectrum | | Experimental 2D NMR | [1H, 13C]-HSQC NMR Spectrum (2D, 600 MHz, CD3OD, experimental) | 2012-12-05 | Wishart Lab | View Spectrum |
|
|---|
| General References | - Wilson FH, Disse-Nicodeme S, Choate KA, Ishikawa K, Nelson-Williams C, Desitter I, Gunel M, Milford DV, Lipkin GW, Achard JM, Feely MP, Dussol B, Berland Y, Unwin RJ, Mayan H, Simon DB, Farfel Z, Jeunemaitre X, Lifton RP: Human hypertension caused by mutations in WNK kinases. Science. 2001 Aug 10;293(5532):1107-12. [PubMed:11498583 ]
- Humke U, Siemer S, Uder M, Ziegler M: [Long-term outcome of conservative surgery for kidney cancer: survival, blood pressure, and renal function]. Ann Urol (Paris). 2002 Dec;36(6):349-53. [PubMed:12611132 ]
- Schonfelder EM, Knuppel T, Tasic V, Miljkovic P, Konrad M, Wuhl E, Antignac C, Bakkaloglu A, Schaefer F, Weber S: Mutations in Uroplakin IIIA are a rare cause of renal hypodysplasia in humans. Am J Kidney Dis. 2006 Jun;47(6):1004-12. [PubMed:16731295 ]
- Albqami N, Janetschek G: Laparoscopic partial nephrectomy. Curr Opin Urol. 2005 Sep;15(5):306-11. [PubMed:16093853 ]
- Reyes L, Manalich R: Long-term consequences of low birth weight. Kidney Int Suppl. 2005 Aug;(97):S107-11. [PubMed:16014086 ]
- Delakas D, Karyotis I, Daskalopoulos G, Terhorst B, Lymberopoulos S, Cranidis A: Nephron-sparing surgery for localized renal cell carcinoma with a normal contralateral kidney: a European three-center experience. Urology. 2002 Dec;60(6):998-1002. [PubMed:12475657 ]
- Moog R, Becmeur F, Dutson E, Chevalier-Kauffmann I, Sauvage P, Brunot B: Functional evaluation by quantitative dimercaptosuccinic Acid scintigraphy after kidney trauma in children. J Urol. 2003 Feb;169(2):641-4. [PubMed:12544333 ]
- Korpi ER, Kuner T, Seeburg PH, Luddens H: Selective antagonist for the cerebellar granule cell-specific gamma-aminobutyric acid type A receptor. Mol Pharmacol. 1995 Feb;47(2):283-9. [PubMed:7870036 ]
- Tia S, Wang JF, Kotchabhakdi N, Vicini S: Developmental changes of inhibitory synaptic currents in cerebellar granule neurons: role of GABA(A) receptor alpha 6 subunit. J Neurosci. 1996 Jun 1;16(11):3630-40. [PubMed:8642407 ]
- Wafford KA, Thompson SA, Thomas D, Sikela J, Wilcox AS, Whiting PJ: Functional characterization of human gamma-aminobutyric acidA receptors containing the alpha 4 subunit. Mol Pharmacol. 1996 Sep;50(3):670-8. [PubMed:8794909 ]
- Rais-Bahrami K, Majd M, Veszelovszky E, Short BL: Use of furosemide and hearing loss in neonatal intensive care survivors. Am J Perinatol. 2004 Aug;21(6):329-32. [PubMed:15311369 ]
|
|---|