| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2006-08-16 15:13:08 UTC |
|---|
| Update Date | 2022-03-07 02:49:10 UTC |
|---|
| HMDB ID | HMDB0001455 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Alloepipregnanolone |
|---|
| Description | Alloepipregnanolone, also known as eltanolone, belongs to the class of organic compounds known as gluco/mineralocorticoids, progestogins and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. Thus, alloepipregnanolone is considered to be a steroid. Based on a literature review very few articles have been published on Alloepipregnanolone. |
|---|
| Structure | [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (3beta,5alpha)-3-Hydroxypregnan-20-one | ChEBI | | 3beta-Hydroxy-5alpha-pregnane-20-one | ChEBI | | 5alpha-Pregnan-3beta-ol-20-one | ChEBI | | Allopregnan-3beta-ol-20-one | ChEBI | | Epiallopregnanolone | Kegg | | 3beta-Hydroxy-5alpha-pregnan-20-one | Kegg | | (3b,5a)-3-Hydroxypregnan-20-one | Generator | | (3Β,5α)-3-hydroxypregnan-20-one | Generator | | 3b-Hydroxy-5a-pregnane-20-one | Generator | | 3Β-hydroxy-5α-pregnane-20-one | Generator | | 5a-Pregnan-3b-ol-20-one | Generator | | 5Α-pregnan-3β-ol-20-one | Generator | | Allopregnan-3b-ol-20-one | Generator | | Allopregnan-3β-ol-20-one | Generator | | 3b-Hydroxy-5a-pregnan-20-one | Generator | | 3Β-hydroxy-5α-pregnan-20-one | Generator | | 3 Hydroxypregnan 20 one | MeSH | | 3 alpha Hydroxy 5 alpha pregnan 20 one | MeSH | | 3 alpha Hydroxy 5 beta pregnan 20 one | MeSH | | 3 alpha, 5 beta Tetrahydroprogesterone | MeSH | | 3 alpha, 5 beta-Tetrahydroprogesterone | MeSH | | 3 alpha-Hydroxy-5 alpha-pregnan-20-one | MeSH | | 3 alpha-Hydroxy-5 beta-pregnan-20-one | MeSH | | 3-Hydroxypregnan-20-one | MeSH | | 3beta Hydroxy 5alpha pregnan 20 one | MeSH | | Allopregnan 3 beta ol 20 one | MeSH | | Allopregnan-3 beta-ol-20-one | MeSH | | Eltanolone | MeSH | | Epipregnanolone | MeSH | | Pregnan 3alpha ol 20 one | MeSH | | Pregnan-3alpha-ol-20-one | MeSH | | Pregnanolone | MeSH | | Pregnanolone, (3alpha)-isomer | MeSH | | Pregnanolone, (3alpha, 5beta, 17-alpha)-isomer | MeSH | | Pregnanolone, (3alpha,5alpha)-isomer | MeSH | | Pregnanolone, (3alpha,5beta)-isomer | MeSH | | Pregnanolone, (3beta)-isomer | MeSH | | Pregnanolone, (3beta, 5alpha)-isomer | MeSH | | Pregnanolone, (3beta, 5alpha, 17alpha)-isomer | MeSH | | Pregnanolone, (3beta, 5alpha, 8alpha, 17beta)-isomer | MeSH | | Pregnanolone, (3beta, 5beta)-isomer | MeSH | | Pregnanolone, (3beta, 5beta, 17alpha)-isomer | MeSH | | Pregnanolone, (3beta, 5beta,14beta)-isomer | MeSH | | Pregnanolone, (5alpha)-isomer | MeSH | | Sepranolone | MeSH | | alpha-Hydroxy-5 alpha-pregnan-20-one, 3 | MeSH | | alpha-Hydroxy-5 beta-pregnan-20-one, 3 | MeSH | | alpha-Pregnan-20-one, 3 alpha-hydroxy-5 | MeSH | | beta-Ol-20-one, allopregnan-3 | MeSH | | beta-Pregnan-20-one, 3 alpha-hydroxy-5 | MeSH | | 3-deoxo-3b-Hydroxy-5a-dihydroprogesterone | HMDB | | 3b-Allopregnanolone | HMDB | | 3b-Hydroxy-5a,17b-pregnan-20-one | HMDB | | 3b-Hydroxy-5a-tetrahydroprogesterone | HMDB | | 5a-Dihydropregnenolone | HMDB | | 5a-Pregnane-3b-ol-20-one | HMDB | | Allopregnanolone | HMDB, MeSH | | Isopregnanolone | HMDB |
|
|---|
| Chemical Formula | C21H34O2 |
|---|
| Average Molecular Weight | 318.4935 |
|---|
| Monoisotopic Molecular Weight | 318.255880332 |
|---|
| IUPAC Name | 1-[(1S,2S,5S,7S,10R,11S,14S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecan-14-yl]ethan-1-one |
|---|
| Traditional Name | isopregnanolone |
|---|
| CAS Registry Number | 516-55-2 |
|---|
| SMILES | [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C |
|---|
| InChI Identifier | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
|---|
| InChI Key | AURFZBICLPNKBZ-FZCSVUEKSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as gluco/mineralocorticoids, progestogins and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Pregnane steroids |
|---|
| Direct Parent | Gluco/mineralocorticoids, progestogins and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 20-oxosteroid
- 3-hydroxysteroid
- Hydroxysteroid
- 3-beta-hydroxysteroid
- Oxosteroid
- Cyclic alcohol
- Ketone
- Secondary alcohol
- Organooxygen compound
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | - 3-hydroxy-5alpha-pregnan-20-one (CHEBI:11909 )
- C21 steroids (gluco/mineralocorticoids, progestogins) and derivatives (LMST02030173 )
|
|---|
| Ontology |
|---|
| Physiological effect | |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 194.5 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.46 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 17.457 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.36 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2755.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 444.8 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 225.5 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 194.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 527.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 719.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 706.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 102.5 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1346.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 495.6 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1610.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 419.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 466.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 263.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 443.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 12.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Alloepipregnanolone,1TMS,isomer #1 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2738.7 | Semi standard non polar | 33892256 | | Alloepipregnanolone,1TMS,isomer #2 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2783.9 | Semi standard non polar | 33892256 | | Alloepipregnanolone,1TMS,isomer #3 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2734.6 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2787.6 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2777.0 | Standard non polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3133.8 | Standard polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2760.9 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2765.2 | Standard non polar | 33892256 | | Alloepipregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3230.8 | Standard polar | 33892256 | | Alloepipregnanolone,1TBDMS,isomer #1 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2985.7 | Semi standard non polar | 33892256 | | Alloepipregnanolone,1TBDMS,isomer #2 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 3032.5 | Semi standard non polar | 33892256 | | Alloepipregnanolone,1TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2995.8 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3282.4 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3254.0 | Standard non polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3369.8 | Standard polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3288.7 | Semi standard non polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3256.2 | Standard non polar | 33892256 | | Alloepipregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3436.2 | Standard polar | 33892256 |
|
|---|