| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter)). Predicted by Afia on May 17, 2022. | 1.05 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 9.9609 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.53 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 510.0 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 420.7 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 297.4 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 31.3 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 178.1 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 80.3 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 296.3 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 229.2 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 1011.1 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 609.1 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 42.6 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 626.5 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 185.5 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 300.0 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 993.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 717.4 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 534.0 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Diaminopimelic acid,1TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@H](N)C(=O)O | 1857.9 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,1TMS,isomer #2 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O)C(=O)O | 1958.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@H](N)C(=O)O[Si](C)(C)C | 1834.3 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TMS,isomer #2 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O)C(=O)O[Si](C)(C)C | 1925.1 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TMS,isomer #3 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C)C(=O)O | 1925.9 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TMS,isomer #4 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O)C(=O)O | 2009.7 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TMS,isomer #5 | C[Si](C)(C)N([C@@H](CCC[C@H](N)C(=O)O)C(=O)O)[Si](C)(C)C | 2110.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1913.0 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2024.4 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2795.5 | Standard polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #2 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2004.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #2 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2030.2 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #2 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O | 2572.2 | Standard polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2101.4 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2037.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #3 | C[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 3057.0 | Standard polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2078.5 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2079.8 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #4 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C | 2870.9 | Standard polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #5 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2152.1 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #5 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2059.6 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TMS,isomer #5 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2707.2 | Standard polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 1974.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2086.6 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C)C(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2235.1 | Standard polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2096.2 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2133.5 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2694.4 | Standard polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #3 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2124.5 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #3 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2160.6 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #3 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2385.7 | Standard polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #4 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2149.3 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #4 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2133.8 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #4 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O | 2434.1 | Standard polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #5 | C[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2272.7 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #5 | C[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2210.3 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TMS,isomer #5 | C[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O)[Si](C)(C)C | 2526.3 | Standard polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2144.3 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2183.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #1 | C[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)C(=O)O[Si](C)(C)C | 2158.3 | Standard polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2302.1 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2270.0 | Standard non polar | 33892256 |
| Diaminopimelic acid,5TMS,isomer #2 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2277.6 | Standard polar | 33892256 |
| Diaminopimelic acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2409.4 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2283.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,6TMS,isomer #1 | C[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C | 2140.3 | Standard polar | 33892256 |
| Diaminopimelic acid,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@H](N)C(=O)O | 2102.4 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O)C(=O)O | 2219.9 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C | 2290.5 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O)C(=O)O[Si](C)(C)C(C)(C)C | 2410.7 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2398.7 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O)C(=O)O | 2496.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N([C@@H](CCC[C@H](N)C(=O)O)C(=O)O)[Si](C)(C)C(C)(C)C | 2554.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2584.1 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2596.8 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2919.1 | Standard polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2677.8 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2570.7 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O | 2767.6 | Standard polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2756.3 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2627.0 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@H](N)C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3057.1 | Standard polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2733.4 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2635.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2951.5 | Standard polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2833.0 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2613.3 | Standard non polar | 33892256 |
| Diaminopimelic acid,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2845.2 | Standard polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2852.2 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2771.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2691.5 | Standard polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2985.8 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2842.1 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@@H](N)CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2907.7 | Standard polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3026.1 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2827.2 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2746.3 | Standard polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 3049.6 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2828.7 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O | 2774.3 | Standard polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 3149.5 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2884.6 | Standard non polar | 33892256 |
| Diaminopimelic acid,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)N([C@@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)C(C)(C)C | 2812.2 | Standard polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 3257.9 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2997.0 | Standard non polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)N[C@@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 2710.0 | Standard polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3363.2 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3063.4 | Standard non polar | 33892256 |
| Diaminopimelic acid,5TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2745.0 | Standard polar | 33892256 |
| Diaminopimelic acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3653.2 | Semi standard non polar | 33892256 |
| Diaminopimelic acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3242.6 | Standard non polar | 33892256 |
| Diaminopimelic acid,6TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)[C@H](CCC[C@@H](C(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2764.7 | Standard polar | 33892256 |