| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2005-11-16 15:48:42 UTC |
|---|
| Update Date | 2022-03-07 02:49:08 UTC |
|---|
| HMDB ID | HMDB0001054 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Dolichyl b-D-glucosyl phosphate |
|---|
| Description | Dolichyl b-D-glucosyl phosphate, also known as dolichol monophosphate glucose, belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. Dolichyl b-D-glucosyl phosphate is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | CC(CCOP(O)(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC\C=C(\C)CCC=C(C)C InChI=1S/C21H39O9P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-28-31(26,27)30-21-20(25)19(24)18(23)17(13-22)29-21/h7,9,16-25H,5-6,8,10-13H2,1-4H3,(H,26,27)/b15-9-/t16?,17-,18-,19+,20-,21+/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| Dolichyl b-D-glucosyl phosphoric acid | Generator | | Dolichol monophosphate glucose | HMDB | | Dolichyl b-delta-glucosyl phosphate | HMDB | | Dolichyl beta-D-glucosyl phosphate | HMDB | | Dolichyl beta-delta-glucosyl phosphate | HMDB | | Dolichyl monophosphate glucose | HMDB | | Dolichyl phosphate glucose | HMDB | | Dolichylphosphoryl glucose | HMDB |
|
|---|
| Chemical Formula | C21H39O9P |
|---|
| Average Molecular Weight | 466.5027 |
|---|
| Monoisotopic Molecular Weight | 466.233169358 |
|---|
| IUPAC Name | {[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}({[(6Z)-3,7,11-trimethyldodeca-6,10-dien-1-yl]oxy})phosphinic acid |
|---|
| Traditional Name | dolichyl phosphate glucose |
|---|
| CAS Registry Number | 220496-27-5 |
|---|
| SMILES | OC[C@H]1O[C@@H](OP(=O)(O)OCCC(C)CC\C=C(\C)CCC=C(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C21H39O9P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-28-31(26,27)30-21-20(25)19(24)18(23)17(13-22)29-21/h7,9,16-25H,5-6,8,10-13H2,1-4H3,(H,26,27)/b15-9-/t16?,17-,18-,19+,20-,21+/m1/s1 |
|---|
| InChI Key | RHJMCOLWMXJOGE-ZTZGTLKASA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Sesquiterpenoids |
|---|
| Direct Parent | Sesquiterpenoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Sesquiterpenoid
- Farsesane sesquiterpenoid
- Hexose monosaccharide
- Monosaccharide phosphate
- Dialkyl phosphate
- Monosaccharide
- Organic phosphoric acid derivative
- Oxane
- Phosphoric acid ester
- Alkyl phosphate
- Secondary alcohol
- Polyol
- Oxacycle
- Organoheterocyclic compound
- Primary alcohol
- Organic oxide
- Organic oxygen compound
- Organooxygen compound
- Hydrocarbon derivative
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.53 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.2464 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.78 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 153.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2378.6 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 169.3 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 139.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 167.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 97.4 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 422.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 429.7 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 141.1 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 855.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 507.5 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 806.1 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 314.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 294.3 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 341.1 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 162.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 39.2 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Dolichyl b-D-glucosyl phosphate,1TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3141.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3127.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3090.0 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3098.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C | 3159.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O | 3043.3 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #10 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C | 3059.0 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O | 3062.6 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C | 3047.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C | 3076.2 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3039.7 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #6 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3033.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #7 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3076.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #8 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3029.2 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TMS,isomer #9 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)O[Si](C)(C)C | 3077.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O | 3024.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #10 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)O[Si](C)(C)C | 3034.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C | 3026.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C | 3040.3 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3022.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O)O[Si](C)(C)C | 3064.4 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #6 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3044.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #7 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3000.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #8 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3038.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TMS,isomer #9 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3035.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,4TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C | 3015.6 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,4TMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O)O[Si](C)(C)C | 3038.4 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,4TMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3034.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,4TMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3036.2 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,4TMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3021.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,5TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3048.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,5TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3080.5 | Standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,5TMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C)O[Si](C)(C)C | 3414.4 | Standard polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TBDMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O | 3381.3 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TBDMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3357.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TBDMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3314.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TBDMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3338.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,1TBDMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3390.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O | 3514.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #10 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3512.6 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3515.2 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3530.4 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3565.0 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3488.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #6 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3489.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #7 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3528.4 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #8 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3475.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,2TBDMS,isomer #9 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3501.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #1 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O | 3675.2 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #10 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3636.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #2 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 3678.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #3 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3690.3 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #4 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3683.8 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #5 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)O[Si](C)(C)C(C)(C)C | 3681.5 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #6 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3702.1 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #7 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O)O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C | 3648.3 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #8 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3646.9 | Semi standard non polar | 33892256 | | Dolichyl b-D-glucosyl phosphate,3TBDMS,isomer #9 | CC(C)=CCC/C(C)=C\CCC(C)CCOP(=O)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3657.0 | Semi standard non polar | 33892256 |
|
|---|