| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2005-11-16 15:48:42 UTC |
|---|
| Update Date | 2021-09-14 15:48:16 UTC |
|---|
| HMDB ID | HMDB0000998 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | dCTP |
|---|
| Description | dCTP, also known as deoxy-CTP, belongs to the class of organic compounds known as pyrimidine 2'-deoxyribonucleoside triphosphates. These are pyrimidine nucleotides with a triphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. dCTP is an extremely weak basic (essentially neutral) compound (based on its pKa). dCTP exists in all living species, ranging from bacteria to humans. Within humans, dCTP participates in a number of enzymatic reactions. In particular, cytidine triphosphate and dCTP can be biosynthesized from uridine triphosphate through its interaction with the enzyme CTP synthase 1. In addition, dCTP can be biosynthesized from dCDP; which is catalyzed by the enzyme nucleoside diphosphate kinase 6. In humans, dCTP is involved in the metabolic disorder called the beta-ureidopropionase deficiency pathway. Outside of the human body, dCTP is found, on average, in the highest concentration within beers. dCTP has also been detected, but not quantified in, several different foods, such as common verbena, ryes, sorghums, white lupines, and mugworts. This could make dCTP a potential biomarker for the consumption of these foods. A 2'-deoxycytidine phosphate having cytosine as the nucleobase. |
|---|
| Structure | NC1=NC(=O)N(C=C1)[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 2'-Deoxycytidine 5'-triphosphate | ChEBI | | Deoxycytidine 5'-triphosphate | ChEBI | | Deoxycytidine triphosphate | ChEBI | | 2'-Deoxycytidine 5'-triphosphoric acid | Generator | | Deoxycytidine 5'-triphosphoric acid | Generator | | Deoxycytidine triphosphoric acid | Generator | | 2'-Deoxycytidine-5'-triphosphate | HMDB | | Deoxy-CTP | HMDB | | Deoxycytidine-triphosphate | HMDB | | 2'-Deoxycytidine 5'-triphosphate, 3H-labeled | HMDB | | 2'-Deoxycytidine 5'-triphosphate, p-(32)p-labeled | HMDB | | 2'-Deoxycytidine 5'-triphosphate, magnesium salt | HMDB | | 2'-Deoxycytidine 5'-triphosphate, p''-(32)p-labeled | HMDB | | 2'-DeoxyCTP | HMDB | | 2'-Deoxycytidine 5'-(tetrahydrogen triphosphate) | HMDB | | 2’-DeoxyCTP | HMDB | | 2’-Deoxycytidine 5’-(tetrahydrogen triphosphate) | HMDB | | 2’-Deoxycytidine 5’-triphosphate | HMDB | | 5'-DCTP | HMDB | | 5’-DCTP | HMDB | | Deoxy-5'-CTP | HMDB | | Deoxy-5’-CTP | HMDB | | Deoxycytidine 5’-triphosphate | HMDB | | dCTP | HMDB |
|
|---|
| Chemical Formula | C9H16N3O13P3 |
|---|
| Average Molecular Weight | 467.1569 |
|---|
| Monoisotopic Molecular Weight | 466.989597149 |
|---|
| IUPAC Name | ({[({[(2R,3S,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid |
|---|
| Traditional Name | dCTP |
|---|
| CAS Registry Number | 2056-98-6 |
|---|
| SMILES | NC1=NC(=O)N(C=C1)[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 |
|---|
| InChI Identifier | InChI=1S/C9H16N3O13P3/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t5-,6+,8+/m0/s1 |
|---|
| InChI Key | RGWHQCVHVJXOKC-SHYZEUOFSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as pyrimidine 2'-deoxyribonucleoside triphosphates. These are pyrimidine nucleotides with a triphosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Pyrimidine nucleotides |
|---|
| Sub Class | Pyrimidine deoxyribonucleotides |
|---|
| Direct Parent | Pyrimidine 2'-deoxyribonucleoside triphosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Pyrimidine 2'-deoxyribonucleoside triphosphate
- Hydroxypyrimidine
- Monoalkyl phosphate
- Hydropyrimidine
- Organic phosphoric acid derivative
- Phosphoric acid ester
- Pyrimidine
- Alkyl phosphate
- Tetrahydrofuran
- Heteroaromatic compound
- Secondary alcohol
- Oxacycle
- Organoheterocyclic compound
- Azacycle
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organooxygen compound
- Organonitrogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aromatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.05 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 9.6962 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 9.7 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 518.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 414.5 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 242.4 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 32.8 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 171.5 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 60.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 297.6 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 294.9 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 887.6 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 560.6 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 77.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 602.2 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 175.2 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 287.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 896.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 444.4 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 572.8 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| dCTP,1TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 3798.8 | Semi standard non polar | 33892256 | | dCTP,1TMS,isomer #2 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 3827.9 | Semi standard non polar | 33892256 | | dCTP,1TMS,isomer #3 | C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3843.7 | Semi standard non polar | 33892256 | | dCTP,1TMS,isomer #4 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3826.2 | Semi standard non polar | 33892256 | | dCTP,1TMS,isomer #5 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3829.0 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 3762.8 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 3494.2 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 6039.1 | Standard polar | 33892256 | | dCTP,2TMS,isomer #10 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3764.8 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #10 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3563.3 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #10 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5838.7 | Standard polar | 33892256 | | dCTP,2TMS,isomer #11 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3809.6 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #11 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3608.1 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #11 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5846.8 | Standard polar | 33892256 | | dCTP,2TMS,isomer #12 | C[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C | 3819.9 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #12 | C[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C | 3631.4 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #12 | C[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C | 6069.2 | Standard polar | 33892256 | | dCTP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3771.9 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3506.7 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 6104.9 | Standard polar | 33892256 | | dCTP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3751.7 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3491.2 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 6065.1 | Standard polar | 33892256 | | dCTP,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3785.2 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3535.5 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 6122.7 | Standard polar | 33892256 | | dCTP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3784.6 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3590.7 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 5805.9 | Standard polar | 33892256 | | dCTP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3774.6 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3576.9 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #6 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 5797.3 | Standard polar | 33892256 | | dCTP,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3829.7 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3613.3 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 5800.5 | Standard polar | 33892256 | | dCTP,2TMS,isomer #8 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3778.6 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #8 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3592.8 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #8 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5846.4 | Standard polar | 33892256 | | dCTP,2TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3836.9 | Semi standard non polar | 33892256 | | dCTP,2TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3630.8 | Standard non polar | 33892256 | | dCTP,2TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 5815.5 | Standard polar | 33892256 | | dCTP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3674.7 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3517.5 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 5638.4 | Standard polar | 33892256 | | dCTP,3TMS,isomer #10 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3777.6 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #10 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3666.2 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #10 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 5282.5 | Standard polar | 33892256 | | dCTP,3TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3686.0 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3585.6 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 5456.4 | Standard polar | 33892256 | | dCTP,3TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3759.2 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3646.5 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5360.3 | Standard polar | 33892256 | | dCTP,3TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 3734.7 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 3673.7 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 5482.3 | Standard polar | 33892256 | | dCTP,3TMS,isomer #14 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3686.1 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #14 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3591.8 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #14 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5480.3 | Standard polar | 33892256 | | dCTP,3TMS,isomer #15 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3765.8 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #15 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3662.7 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #15 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5340.8 | Standard polar | 33892256 | | dCTP,3TMS,isomer #16 | C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3732.8 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #16 | C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3693.7 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #16 | C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 5441.6 | Standard polar | 33892256 | | dCTP,3TMS,isomer #17 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3761.7 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #17 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3632.9 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #17 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 5383.0 | Standard polar | 33892256 | | dCTP,3TMS,isomer #18 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3732.3 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #18 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3668.1 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #18 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 5532.8 | Standard polar | 33892256 | | dCTP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3659.8 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3502.7 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 5648.0 | Standard polar | 33892256 | | dCTP,3TMS,isomer #3 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3733.6 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #3 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3575.6 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #3 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 5563.4 | Standard polar | 33892256 | | dCTP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3662.6 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3515.1 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 5672.2 | Standard polar | 33892256 | | dCTP,3TMS,isomer #5 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3729.0 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #5 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3586.5 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #5 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 5548.4 | Standard polar | 33892256 | | dCTP,3TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3659.3 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3490.0 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 5676.7 | Standard polar | 33892256 | | dCTP,3TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3714.1 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3567.0 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5615.9 | Standard polar | 33892256 | | dCTP,3TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 3690.1 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 3606.3 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 5756.2 | Standard polar | 33892256 | | dCTP,3TMS,isomer #9 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3682.5 | Semi standard non polar | 33892256 | | dCTP,3TMS,isomer #9 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3604.3 | Standard non polar | 33892256 | | dCTP,3TMS,isomer #9 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 5437.7 | Standard polar | 33892256 | | dCTP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3620.1 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3501.0 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 5307.6 | Standard polar | 33892256 | | dCTP,4TMS,isomer #10 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3654.2 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #10 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3597.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #10 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 5293.3 | Standard polar | 33892256 | | dCTP,4TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3652.4 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3570.9 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 5103.8 | Standard polar | 33892256 | | dCTP,4TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3744.4 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3655.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #12 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 4926.2 | Standard polar | 33892256 | | dCTP,4TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3698.3 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3695.4 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #13 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 4970.7 | Standard polar | 33892256 | | dCTP,4TMS,isomer #14 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3754.5 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #14 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3632.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #14 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4975.9 | Standard polar | 33892256 | | dCTP,4TMS,isomer #15 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3700.8 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #15 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3669.7 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #15 | C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 5082.2 | Standard polar | 33892256 | | dCTP,4TMS,isomer #16 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3749.9 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #16 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3641.2 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #16 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4952.1 | Standard polar | 33892256 | | dCTP,4TMS,isomer #17 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3698.1 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #17 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3692.4 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #17 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 5022.6 | Standard polar | 33892256 | | dCTP,4TMS,isomer #18 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3698.7 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #18 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3656.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #18 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 5098.7 | Standard polar | 33892256 | | dCTP,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3705.0 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 3599.3 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O2)C=C1 | 5083.1 | Standard polar | 33892256 | | dCTP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3620.1 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3475.3 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 5351.3 | Standard polar | 33892256 | | dCTP,4TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3703.1 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3578.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5184.6 | Standard polar | 33892256 | | dCTP,4TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 3659.8 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 3604.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O | 5239.9 | Standard polar | 33892256 | | dCTP,4TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3622.3 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3485.8 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #6 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 5341.7 | Standard polar | 33892256 | | dCTP,4TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3693.4 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3594.4 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #7 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 5138.2 | Standard polar | 33892256 | | dCTP,4TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3655.3 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3623.5 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 5183.4 | Standard polar | 33892256 | | dCTP,4TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3698.1 | Semi standard non polar | 33892256 | | dCTP,4TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3568.3 | Standard non polar | 33892256 | | dCTP,4TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 5208.3 | Standard polar | 33892256 | | dCTP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3598.4 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3440.0 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4996.4 | Standard polar | 33892256 | | dCTP,5TMS,isomer #10 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3699.0 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #10 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 3654.3 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #10 | C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)O[Si](C)(C)C | 4616.0 | Standard polar | 33892256 | | dCTP,5TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3711.0 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3623.7 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #11 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4691.2 | Standard polar | 33892256 | | dCTP,5TMS,isomer #12 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3700.4 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #12 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 3638.3 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #12 | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O | 4633.2 | Standard polar | 33892256 | | dCTP,5TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3686.2 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 3568.6 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #2 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O2)C=C1 | 4715.3 | Standard polar | 33892256 | | dCTP,5TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3650.9 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 3587.4 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O | 4751.2 | Standard polar | 33892256 | | dCTP,5TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3694.6 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3543.1 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #4 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4788.9 | Standard polar | 33892256 | | dCTP,5TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3667.4 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 3568.7 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #5 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C | 4883.0 | Standard polar | 33892256 | | dCTP,5TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3686.5 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3553.5 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #6 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4741.0 | Standard polar | 33892256 | | dCTP,5TMS,isomer #7 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3652.8 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #7 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3588.8 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #7 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 4801.6 | Standard polar | 33892256 | | dCTP,5TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3659.6 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3552.6 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #8 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4907.5 | Standard polar | 33892256 | | dCTP,5TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3739.7 | Semi standard non polar | 33892256 | | dCTP,5TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3619.2 | Standard non polar | 33892256 | | dCTP,5TMS,isomer #9 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4514.1 | Standard polar | 33892256 | | dCTP,6TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3671.2 | Semi standard non polar | 33892256 | | dCTP,6TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 3519.7 | Standard non polar | 33892256 | | dCTP,6TMS,isomer #1 | C[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O2)C=C1 | 4327.2 | Standard polar | 33892256 | | dCTP,6TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3681.1 | Semi standard non polar | 33892256 | | dCTP,6TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 3548.0 | Standard non polar | 33892256 | | dCTP,6TMS,isomer #2 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C | 4419.2 | Standard polar | 33892256 | | dCTP,6TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3689.6 | Semi standard non polar | 33892256 | | dCTP,6TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3515.6 | Standard non polar | 33892256 | | dCTP,6TMS,isomer #3 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4490.1 | Standard polar | 33892256 | | dCTP,6TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3671.5 | Semi standard non polar | 33892256 | | dCTP,6TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3530.9 | Standard non polar | 33892256 | | dCTP,6TMS,isomer #4 | C[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4436.8 | Standard polar | 33892256 | | dCTP,6TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3732.2 | Semi standard non polar | 33892256 | | dCTP,6TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 3590.9 | Standard non polar | 33892256 | | dCTP,6TMS,isomer #5 | C[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C)[Si](C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C | 4233.6 | Standard polar | 33892256 | | dCTP,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 4032.8 | Semi standard non polar | 33892256 | | dCTP,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 4077.4 | Semi standard non polar | 33892256 | | dCTP,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 4091.2 | Semi standard non polar | 33892256 | | dCTP,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 4068.9 | Semi standard non polar | 33892256 | | dCTP,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 4099.3 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O | 4174.2 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O | 3858.5 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O | 6087.8 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 4195.3 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3874.7 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5953.6 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4289.8 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 3965.9 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 5896.0 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C(C)(C)C | 4212.4 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C(C)(C)C | 3977.8 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)N(C1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1)[Si](C)(C)C(C)(C)C | 5977.3 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 4176.9 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3867.0 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 6133.2 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4178.1 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3861.3 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 6105.2 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 4246.4 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3924.9 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 6052.4 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 4201.4 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3911.6 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 5904.8 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4197.5 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 3903.2 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 5905.6 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 4291.1 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 3960.0 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 5857.4 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 4198.5 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3913.5 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5930.5 | Standard polar | 33892256 | | dCTP,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 4284.9 | Semi standard non polar | 33892256 | | dCTP,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 3969.7 | Standard non polar | 33892256 | | dCTP,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 5850.3 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 4286.4 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 3964.7 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O | 5726.3 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 4402.6 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 4119.2 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 5434.0 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4309.7 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3985.6 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #11 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 5603.4 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4398.5 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4119.8 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #12 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 5524.8 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 4336.0 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 4153.6 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #13 | CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O)OP(=O)(O)OP(=O)(O)O | 5575.4 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 4296.6 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 3993.1 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #14 | CC(C)(C)[Si](C)(C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O | 5593.4 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4396.8 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4131.6 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #15 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 5475.1 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 4335.5 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 4166.1 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #16 | CC(C)(C)[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 5517.3 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #17 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4394.6 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #17 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4084.1 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #17 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 5559.7 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #18 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 4326.6 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #18 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 4164.7 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #18 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)C[C@@H]1O | 5609.8 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4291.2 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3958.7 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 5759.9 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 4361.9 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 4072.7 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OP(=O)(O)O)O2)C=C1 | 5669.3 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 4286.2 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 3972.0 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O[Si](C)(C)C(C)(C)C | 5749.7 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 4358.7 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 4082.5 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)O)O2)C=C1 | 5630.0 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4287.4 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 3937.7 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 5800.5 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4355.6 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 4083.5 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NC1=NC(=O)N([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C(C)(C)C)O2)C=C1 | 5707.7 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 4295.0 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 4104.9 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](N2C=CC(N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=NC2=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O | 5751.6 | Standard polar | 33892256 | | dCTP,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4296.7 | Semi standard non polar | 33892256 | | dCTP,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 4019.3 | Standard non polar | 33892256 | | dCTP,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)C[C@@H]1O)O[Si](C)(C)C(C)(C)C | 5541.5 | Standard polar | 33892256 |
|
|---|
| GC-MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental GC-MS | GC-MS Spectrum - dCTP GC-EI-TOF (Non-derivatized) | splash10-03di-1900000000-3d90990d3831fc38abb6 | 2017-09-12 | HMDB team, MONA, MassBank | View Spectrum | | Experimental GC-MS | GC-MS Spectrum - dCTP GC-EI-TOF (Non-derivatized) | splash10-03di-1900000000-3d90990d3831fc38abb6 | 2018-05-18 | HMDB team, MONA, MassBank | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (Non-derivatized) - 70eV, Positive | splash10-0002-9734200000-676373c19e4530dc2572 | 2017-09-01 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (1 TMS) - 70eV, Positive | splash10-00dm-9207110000-47dd719accdfad2d1bb7 | 2017-10-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (Non-derivatized) - 70eV, Positive | Not Available | 2021-10-12 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TMS_1_2) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TMS_1_3) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TMS_1_4) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TMS_1_5) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TBDMS_1_1) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TBDMS_1_2) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TBDMS_1_3) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TBDMS_1_4) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - dCTP GC-MS (TBDMS_1_5) - 70eV, Positive | Not Available | 2021-11-06 | Wishart Lab | View Spectrum |
MS/MS Spectra| Spectrum Type | Description | Splash Key | Deposition Date | Source | View |
|---|
| Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 16V, negative-QTOF | splash10-014i-0100900000-0c4be9d6bd044dcc30a0 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 21V, negative-QTOF | splash10-066r-0703900000-fba71bd6110938a88717 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 28V, negative-QTOF | splash10-0a4i-0903100000-bc9ee1b07578fee8fe60 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 34V, negative-QTOF | splash10-0a4i-1912000000-502a328c4dd3b85b1261 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 41V, negative-QTOF | splash10-0a4i-3910000000-24e79fde8d9f943e5918 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 47V, negative-QTOF | splash10-0a6r-7910000000-97e0df7b280b0847ad0e | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 56V, negative-QTOF | splash10-056r-9600000000-76ddb7ea2b1e0425b8bf | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 64V, negative-QTOF | splash10-004i-9300000000-d6ad5706c5825292a03c | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 77V, negative-QTOF | splash10-004i-9100000000-df323aba3fe0d34ef447 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-014i-0419100000-8e37a6184a56a1ce0b9e | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-004i-9000000000-46d4cee1b5ac630ba9b8 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-0a4i-0190000000-e5ee855f41773e79d603 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-0a4r-1950000000-00c42d75643af2669e6b | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-014r-0119100000-ec7aadc4870ab3921ecc | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, negative-QTOF | splash10-052r-0691000000-113e1278b4a989de2daa | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, positive-QTOF | splash10-0006-0900400000-65f4077bcb5020b2d9a1 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP n/a 32V, positive-QTOF | splash10-00di-0102900000-863c74032b703a479a57 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 3V, positive-QTOF | splash10-014i-0100900000-764a12da50ad51ce0497 | 2020-07-22 | HMDB team, MONA | View Spectrum | | Experimental LC-MS/MS | LC-MS/MS Spectrum - dCTP Orbitrap 12V, positive-QTOF | splash10-03di-0900200000-7b013855e19e8393c74d | 2020-07-22 | HMDB team, MONA | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 10V, Positive-QTOF | splash10-03di-0900000000-939cbd147b029e517cc1 | 2015-09-15 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 20V, Positive-QTOF | splash10-03di-2911000000-f4b496ca2bd6dcb38361 | 2015-09-15 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 40V, Positive-QTOF | splash10-03di-4900000000-a5e5fd690ddf51310279 | 2015-09-15 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 10V, Negative-QTOF | splash10-00xu-4110900000-42349a9362c5d3d7c6ef | 2015-09-15 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 20V, Negative-QTOF | splash10-057r-9540100000-7a06dee6889dcffec4e9 | 2015-09-15 | Wishart Lab | View Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - dCTP 40V, Negative-QTOF | splash10-056r-9610000000-0a85daf50b374c5ac8ba | 2015-09-15 | Wishart Lab | View Spectrum |
NMR Spectra| Spectrum Type | Description | Deposition Date | Source | View |
|---|
| Predicted 1D NMR | 1H NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 100 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 200 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 300 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 400 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 500 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 600 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 700 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 800 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 900 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 1H NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum | | Predicted 1D NMR | 13C NMR Spectrum (1D, 1000 MHz, D2O, predicted) | 2021-09-16 | Wishart Lab | View Spectrum |
|
|---|