| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.11 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 9.0554 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 7.67 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 380.6 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 447.7 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 237.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 56.8 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 156.2 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 52.3 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 271.6 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 232.7 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 836.9 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 572.9 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 43.6 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 653.6 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 153.2 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 181.9 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 677.4 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 543.5 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 462.2 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Porphobilinogen,1TMS,isomer #1 | C[Si](C)(C)OC(=O)CC1=C(CN)[NH]C=C1CCC(=O)O | 2258.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TMS,isomer #2 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN)=C1CC(=O)O | 2267.2 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TMS,isomer #3 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O)=C[NH]1 | 2346.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TMS,isomer #4 | C[Si](C)(C)N1C=C(CCC(=O)O)C(CC(=O)O)=C1CN | 2321.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN)=C1CC(=O)O[Si](C)(C)C | 2247.8 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #2 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O)=C[NH]1 | 2353.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN)N([Si](C)(C)C)C=C1CCC(=O)O | 2330.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #4 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C)=C[NH]1 | 2369.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN)=C1CC(=O)O | 2325.1 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #6 | C[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=C[NH]1)[Si](C)(C)C | 2450.0 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TMS,isomer #7 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C | 2425.1 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #1 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=C[NH]1 | 2315.2 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #1 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=C[NH]1 | 2371.4 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #1 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=C[NH]1 | 2825.9 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C | 2320.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C | 2289.1 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #2 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C | 3012.0 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)[NH]C=C1CCC(=O)O | 2446.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)[NH]C=C1CCC(=O)O | 2485.5 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)[NH]C=C1CCC(=O)O | 2851.3 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #4 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C | 2412.7 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #4 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C | 2416.7 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #4 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C | 2913.2 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2465.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2490.7 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #5 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2817.1 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #6 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2428.0 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #6 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2425.7 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #6 | C[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2865.1 | Standard polar | 33892256 |
| Porphobilinogen,3TMS,isomer #7 | C[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C)[Si](C)(C)C | 2561.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #7 | C[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C)[Si](C)(C)C | 2524.5 | Standard non polar | 33892256 |
| Porphobilinogen,3TMS,isomer #7 | C[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C)[Si](C)(C)C | 2977.2 | Standard polar | 33892256 |
| Porphobilinogen,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2422.4 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2525.3 | Standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2573.5 | Standard polar | 33892256 |
| Porphobilinogen,4TMS,isomer #2 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2426.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #2 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2448.9 | Standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #2 | C[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C)C(CCC(=O)O[Si](C)(C)C)=CN1[Si](C)(C)C | 2666.0 | Standard polar | 33892256 |
| Porphobilinogen,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C=C1CCC(=O)O | 2567.3 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C=C1CCC(=O)O | 2546.3 | Standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #3 | C[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C=C1CCC(=O)O | 2789.2 | Standard polar | 33892256 |
| Porphobilinogen,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2576.1 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2554.5 | Standard non polar | 33892256 |
| Porphobilinogen,4TMS,isomer #4 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O | 2749.9 | Standard polar | 33892256 |
| Porphobilinogen,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2563.7 | Semi standard non polar | 33892256 |
| Porphobilinogen,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2564.8 | Standard non polar | 33892256 |
| Porphobilinogen,5TMS,isomer #1 | C[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C)C(CN([Si](C)(C)C)[Si](C)(C)C)=C1CC(=O)O[Si](C)(C)C | 2591.1 | Standard polar | 33892256 |
| Porphobilinogen,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN)[NH]C=C1CCC(=O)O | 2537.0 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN)=C1CC(=O)O | 2561.4 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O)=C[NH]1 | 2632.2 | Semi standard non polar | 33892256 |
| Porphobilinogen,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)N1C=C(CCC(=O)O)C(CC(=O)O)=C1CN | 2599.3 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 2712.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O)=C[NH]1 | 2837.3 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN)N([Si](C)(C)C(C)(C)C)C=C1CCC(=O)O | 2818.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=C[NH]1 | 2865.2 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN)=C1CC(=O)O | 2840.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=C[NH]1)[Si](C)(C)C(C)(C)C | 2912.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C | 2916.4 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=C[NH]1 | 2972.2 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=C[NH]1 | 2969.2 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=C[NH]1 | 3031.2 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 2983.8 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 2852.5 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3125.6 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C=C1CCC(=O)O | 3114.4 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C=C1CCC(=O)O | 3077.5 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[NH]C=C1CCC(=O)O | 3039.2 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C | 3100.8 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C | 2955.9 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C | 3091.6 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3120.7 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3080.1 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3012.9 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 3115.9 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 2957.0 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 3059.2 | Standard polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3223.8 | Semi standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3027.7 | Standard non polar | 33892256 |
| Porphobilinogen,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)N(CC1=C(CC(=O)O)C(CCC(=O)O)=CN1[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3131.4 | Standard polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3283.5 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3285.3 | Standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=C[NH]C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 2936.9 | Standard polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 3246.8 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 3136.0 | Standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCC1=C(CC(=O)O[Si](C)(C)C(C)(C)C)C(CCC(=O)O[Si](C)(C)C(C)(C)C)=CN1[Si](C)(C)C(C)(C)C | 3020.1 | Standard polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C=C1CCC(=O)O | 3378.1 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C=C1CCC(=O)O | 3217.3 | Standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)OC(=O)CC1=C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C=C1CCC(=O)O | 3067.9 | Standard polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3380.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3211.9 | Standard non polar | 33892256 |
| Porphobilinogen,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O | 3034.0 | Standard polar | 33892256 |
| Porphobilinogen,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3555.6 | Semi standard non polar | 33892256 |
| Porphobilinogen,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3380.8 | Standard non polar | 33892256 |
| Porphobilinogen,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)OC(=O)CCC1=CN([Si](C)(C)C(C)(C)C)C(CN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)=C1CC(=O)O[Si](C)(C)C(C)(C)C | 3019.9 | Standard polar | 33892256 |